The coordination chemistry of cationic main group clusters: syntheses and structures of [Fe3(Se2)2(CO)10] and [Fe4(Se2)3(CO)12]

The reactions of the polysulfur and selenium cationic clusters S₈²⁺ and Se₈²⁺ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF₆⁻ as a counterion, the cluster [Fe₃(E₂)₂(CO)₁₀] [SbF₆]₂·SO₂ (E = S, Se) could be isolated from the reaction of E₈²⁺ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se₂ groups, with the whole fragment capped by an Fe(CO)₄ group. Crystallographic data for C₁₀O₁₂Fe₃Se₄Sb₂F₁₂S (I): space group monoclinic P2₁/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) ų, Z = 4, R = 0.0426, R_w = 0.0503. When Sb₂F₁₁⁻ is present as the counterion, or Se₄[Sb₂F₁₁]₂ is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe₄(Se₂)₃(CO)₁₂] [SbF₆]₂·3SO₂. The dication contains two Fe₂Se₂ fragments bridged by an Se₂ group. Crystallographic data for C₁₂O₁₈Fe₄Se₆Sb₂F₁₂S₃ (III): space group triclinic , b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) ų, Z = 2, R = 0.0328, R_w = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO₂ when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated.     

Ruthenium complexes containing tertiary phosphines and imidazole or 2,2′-bipyridine ligands

Complexes RuCl₃(PPh₃)L₂ (L = MeIm (1a, Im (1b)) and [RuCl₂(PPh₃)₂(bipy)]Cl·4H₂O (2) have been synthesized via the ruthenium(III) precursor RuCl₃(PPh₃)₂ (DMA), and characterized, including an X-ray structural analysis for 1a (MeIm = N-methylimidazole, Im = imidazole, bipy = 2,2′-bipyridyl, and DMA = N, N′-dimethylacetamide). Crystals of 1a are monoclinic, space group P2₁/n, A = 10.5491(5), B = 20.4934(9), C = 12.8285(4) Å, β = 90.166(4)°, Z = 4. The structure, which reveals a mer configuration for the chlorides, and cis-methylimidazoles, was solved by conventional heavy atom methods and was refined by full-matrix least-square procedures to R = 0.041 and R_w = 0.042 for 3328 reflections with I 3σ(I). From the RuCl₂(PPh₃)₃ precursor, the ruthenium(II) complexes RuCl₂(PPh₃)₂L₂ and [RuCl(PPh₃)L₄]Cl have been made (L = Im or MeIm), while [RuCl(dppb)Im₃]Cl has been made from [RuCl₂(dppb)]₂(μ-dppb) (dppb = Ph₂P(CH₂)₄PPh₂).     

Molecular structures of Fe(II) complexes with mono- and di-protonated ethylenediamine-N,N,N′,N′-tetraacetate (Hedta and H2edta), as determined by X-ray crystal analyses

The molecular structure of the title complexes [Fe(H₂O)₄][Fe(Hedta)(H₂O)]₂ · 4H₂O (I) and [Fe(H[₂edta)(H₂O)] · 2H₂O (II) have been determined by single-crystal X-ray analyses. The crystal data are as follows: I: monoclinic, P2₁/n, A = 11.794(2), B = 15.990(2), C = 9.206(2) Å, β = 90.33(1)°, V = 1736.1(5) ų, Z = 2 and R = 0.030; II: monoclinic, C2/c, A = 11.074(2), B = 9.856(2), C = 14.399(2) Å, β = 95.86(1)°, V = 1563.3(4) ų, Z = 4 and R = 0.025. I is found to be isomorphous with the Mn^II analog reported earlier and to contain a seven-coordinate and approximately pentagonal-bipyramidal (PB) [Fe^II(Hedta)(H₂O]⁻ unit in which Hedta acts as a hexadentate ligand. The [Fe^II(H₂edta)(H₂O)] unit in II has also a seven-coordinate PB structure with the two protonated equatorial glycine arms both remaining coordinated, and thus bears a structural resemblance to the seven-coordinate [Co^II(H₂edta)(H₂O)] reported previously.     

The synthesis, fluctionality and structural characterization of ReMo3H4(CO)12

The reaction of ReH₉²⁻ with Mo(diglyme)(CO)₃ leads to the formation of the mixed metal cluster trianion, ReMo₃H₄(CO)₁₂³⁻. This species has been characterized analytically, spectroscopically and through X-ray diffraction analysis. A pseudo-tetrahedral arrangement of M(CO)₃ fragments is adopted, such that each set of three carbonyl ligands eclipses the adjacent three tetrahedral edges, an apparent result of the location of the hydride ligands on the tetrahedral faces. Variable temperature NMR studies revealed a fluctional process for some of the carbonyl ligands, but not for the hydrides. Crystal data for [Me₄N]₃[ReMo₃H₄(CO)₁₂]·THF; space group P2₁/n, a = 12.157(2), B = 21.480(4), C = 15.964(3) Å, β = 98.26(1)°, Z = 4, R = 0.067 and R_w = 0.076.     

The monofunctionalized 1,4,7-triazacyclononane derivatives 1,4,7-triazacyclononane-N-acetate (L) and N-(2-hydroxybenzyl-1,4,7-triazacyclononane (HL) and their complexes with vanadium(IV)/(V). Localized and delocalized electronic structures in compounds containing the mixed valent [OV---O---VO] core

The synthesis of the tetradentate pendant arm macrocycles 1,4,7-triazacyclononane-N-acetate (L¹) and N-(2-hydroxybenzyl)-1,4,7-triazacyclononane (HL²) and their coordination chemistry with vanadium(IV) and (V) are reported. The following mononuclear species have been prepared and characterized by UV-Vis, IR spectroscopy: [L¹V^IVO(NCS)] (1), [L¹VO₂]·H₂O (2), [L²VO(NCS)] (3), [L²VO(NCS)]Cl (4), and [L²VO₂] (5). In addition, the dinuclear, mixed valent complexes [L₂¹V₂O₃]Br (6), [L₂²V₂O₃](ClO₄)·0.5acetone (7), and the homovalent complex [L₂²V₂O₃](ClO₄)₂ (8) have been synthesized. Complexes 2, 3, 6 and 7 have been characterized by single crystal X-ray crystallography. Crystal data: 2, space group P2₁c,a=9.944(4),b=6.701(3),c=18.207(8)Å, β=102.88(3)°, V=1182.7 ų, Z=4, D_calc=1.51 g cm⁻³, R=0.049 based on 4760 reflections; 3, space group Pbca, A=11.003(6), b=14.295(7), C=20.21(1) Å, V=3178.8 ų, Z=8, D_calc=1,50 g cm⁻³, R=0.057 based on 1049 reflections; 6, space Pbcn, a=12.922(3), B=13.852(3), C=12.739(3) Å, V=2280.3 ų, Z=4, D_calc=1,75 g cm⁻³, R=0.047 based on 1172 reflections; 7, space group C2/c, A=23.553(9), B=13.497(5), C=20.951(8) Å, β=90.03(3)°, V=6660.2 ų, Z=8, D_calc=1.49 g cm⁻³, R=0.053 based on 3698 reflections. Complexes 6 and 7 are mixed valent V(IV)/(V) complexes containing the [OV---O---VO]³⁺ core. In the solid state 6 belongs to class III (delocalized) and 7 to class I (localized) according to the Robin and Day classification of mixed valent compounds. A rationale for these differing electronic structures is given.     

Crystal growth in aqueous hydrofluoric acid and (HF)x · pyridine solutions: syntheses and crystal structures of [Ni(H2O)6][MF6] (M = Ti, Zr, Hf) and Ni3(py)12F6 · 7H2O

The syntheses and structures of [Ni(H₂O)₆]²⁺[MF₆]²⁻ (M = Ti,Zr,Hf) and Ni₃(py)₁₂F₆·7H₂O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group (No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) ų for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) ų for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)ų for Hf. The structures consist of discrete [Ni(H₂O)₆]²⁺ and [MF₆]²⁻ octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni₃(py)₁₂F₆·7H₂O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) ų. The structure consists of discrete Ni(py)₄F₂ octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)_x·pyridine/pyridine/water solution.     

Molecular structures and some properties of tris(2-aminoethyl) amine cobalt(III) complexes with thiocarboxylato-O,S such as 3-mercaptopropionato, 2-mercaptoacetato and their derivatives

Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]⁺ (2), t-[Co(mtp)(tren)]²⁺ (1Me) and t-[Co(mta)(tren)]²⁺ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO₄ (1CIO₄): monoclinic, P2₁/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) ų, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H₂O (2Cl·3H₂O): monoclinic, P2₁/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) ų, Z = 4 and R = 0.066; (+)₄₆₅^CD-t-[Co(mtp)(tren)](ClO₄)₂ ((+)₄₆₅^CD-1Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) ų, Z = 4 and R = 0.068; (+)₄₆₅^CD-t-[Co(mta)(tren)](ClO₄)₂ ((+)₄₆₅^CD-2Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) ų, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)₄₆₅^CD-1Me is the S configuration and that in (+)₄₆₅^CD-2Me is the R one. The ¹H NMR, ¹³C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries.     

Synthesis and problematic crystal structures of [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta, Nb or Sb)

Compounds of formula [Al(CH₃CN)₆][MCl₆]₃(CH₃CN)₃ (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl₅ and AlCl₃ in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) ų and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) ų V = 1634.8(4) ų and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) ų and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation.     

Reactions of the haloalcohols HO(CH2)nCl (n = 2, 3) with platinum(II) - alkynyl and -alkyne complexes. X-ray crystal structure of trans-[Pt(Me) {C(OCH2CH2Cl) (CH2Ph)} (PPh3)2] [BF4]

The chloro complexes trans-[Pt(Me)(Cl)(PPh₃)₂], after treatment with AgBF₄, react with 1-alkynes HC---C---R in the presence of NEt₃ to afford the corresponding acetylide derivatives trans-[Pt(Me) (C---C---R) (PPh₃)₂] (R = p-tolyl (1), Ph (2), C(CH₃)₃ (3)). These complexes, with the exception of the t-butylacetylide complex, react with the chloroalcohols HO(CH₂)_nCl (n = 2, 3) in the presence of 1 equiv. of HBF₄ to afford the alkyl(chloroalkoxy)carbene complexes trans-[Pt(Me) {C[O(CH₂)_nCl](CH₂R) } (PPh₃)₂][BF₄] (R = p-tolyl, N = 2 (4), N = 3 (5); R=Ph, N = 2 (6)). A similar reaction of the bis(acetylide) complex trans-[Pt(C---C---Ph)₂(PMe₂Ph)₂] with 2 equiv. HBF₄ and 3-chloro-1-propanol affords trans-[Pt(C---CPh) {C(OCH₂CH₂CH₂Cl)(CH₂Ph) } (PMe₂Ph)₂][BF₄] (7). T alkyl(chloroalkoxy)-carbene complex trans-[Pt(Me) {C(OCH₂CH₂Cl)(CH₂Ph) } (PPh₃)₂][BF₄] (8) is formed by reaction of trans-[Pt(Me)(Cl)(PPh₃)₂], after treatment with AgBF₄ in HOCH₂CH₂Cl, with phenylacetylene in the presence of 1 equiv. of n-BuLi. The reaction of the dimer [Pt(Cl)(μ-Cl)(PMe₂Ph)]₂ with p-tolylacetylene and 3-chloro-1-propanol yields cis-[PtCl₂{C(OCH₂CH₂CH₂Cl)(CH₂C₆H₄-p-Me}(PMe₂Ph)] (9). The X-ray molecular structure of (8) has been determined. It crystallizes in the orthorhombic system, space group Pna2₁, with a = 11.785(2), B = 29.418(4), C = 15.409(3) Å, V = 4889(1) ų and Z = 4. The carbene ligand is perpendicular to the Pt(II) coordination plane; the PtC(carbene) bond distance is 2.01(1) Å and the short C(carbene)-O bond distance of 1.30(1) Å suggests extensive electronic delocalization within the Pt---C(carbene)---O moietry.     

Preparation and crystal structure of trans-dihydroxo-[tetrakis(2,6-dichlorophenyl)porphinato]ruthenium(IV)·2toluene

Trans-dihydroxo-[tetrakis(2,6-dichlorophenyl)porphinato]ruthenium(IV) ([Ru(OH)₂(TDCPP)]) was prepared by meta-chloroperbenzoic acid oxidation of [Ru(CO)(TDCPP)] in dichloromethane-toluene, and its crystal structure is reported. Crystal data for [Ru(OH)₂(TDCPP)]·2toluene:C₄₄H₂₂N₄O₂Cl₈Ru·2C₇H₈, orthorhombic, space group Pbca a = 13.149(1), B = 19.893(2), C = 21.093(2)Å, U = 55.17.3(2) ų, Z = 4. The short axial Ru---O bond distance, 1.790(7) Å, is in the range expected for a double Ru(IV)-oxygen bond. Both hydroxo ligands are approximately located in the mean plane of two opposite dichlorophenyl groups. Full-matrix least-squares refinement of positional and thermal parameters, using 2368 unique reflections with F > 2.5 σ (F) led to R(F) = 0.063; R_w = 0.066.     

Pyrazolonato complexes of lead. Crystal structures of bis(1-phenyl-3-methyl-4-acetyl pyrazolonato)lead(II) and bis(1-phenyl-3-methyl-4-butanoylpyrazolonato)lead(II)

The structures of the complexes [PbL₂], L = 1-phenyl-3-methyl-4-acylpyrazolonato, RCOC₁₀H₈N₂O, R = Me (2) or Pr (3), have been determined by X-ray diffraction studies. Compound 2 is monoclinic, space group P2₁, A = 11.285(4), B = 14.727(4), C = 20.749(5) Å, β = 95.83(3)°, R = 0.039 for 4486 reflections, and 3 is monoclinic, space group C2/c, A = 27.528(11), B = 7.245(11), C = 14.264(7) Å, β = 113.6(3)°, R = 0.021 for 2118 reflections. There are three different lead environments in 2 but only one in 3. In each case the lead atom makes four strong bonds to oxygen and two weaker bonds to either oxygen or nitrogen in adjacent molecules.     

Studies of the oxovanadium(IV)—oxalate system: syntheses and crystal structures of binuclear (Ph4P)2[(VO)2(H2O)2(C2O4)3]·4H2O and of the one-dimensional chain material, (Ph4P)[VOCl(C2O4)]

The hydrothermal reactions of (Ph₄P)[VO₂Cl₂] and H₂C₂O₄ at 150 and 125°C yield (Ph₄P)₂[V₂O₂(H₂O)₂(C₂O₄)₃]·4H₂O (1) and (Ph₄P)[VOCl(C₂O₄)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO₆ coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph₄P⁺ cations occupying regions between [VOCl(C₂O₄)]⁻_∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H₂O, monoclinic P2₁/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) ų, Z = 2, D_calc = 1.501 g cm⁻³, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P4₃, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) ų, Z = 4, R = 0.0452.     

One-dimensional polymeric chlorocadmate(II) systems of N-methylpiperazinium and N,N′-dimethylpiperazinium compounds: synthesis, structural and thermal properties

The chlorocadmate(II) systems of (H₂me₂pipz)[Cd₂Cl₆(H₂O)₂] (1) and (H₂mepipz)₂[Cd₃Cl₁₀(H₂O)] (2) (L = me₂pipz = N,N′-dimethylpiperazine; L′ = mepipz = N-methylpiperazine) were prepared and their structural and thermal properties investigated. Compound 1 is monoclinic, space group P2₁/c, A = 7.664(1), B = 7.472(4), C = 15.347(1) Å, β = 99.468(7)°, Z = 2, R = 0.024. The crystal structure consists of organic cations and infinite one-dimensional chains of [CdCl₃(H₂O)]_n³⁻ anions. Each Cd atom is octahedrally surrounded by bridged and terminal chlorine atoms and by a water molecule, which is in trans position with respect to the terminal chlorine atom. Inter- and intrachain hydrogen bond interactions between the terminal chlorine atoms and the water molecules contribute to the crystal packing. Compound 2 is orthorhombic, space group Cmc2₁, A = 15.286(3), B = 13.354(3), C = 13.154(3) Å, R = 0.023. The crystal structure consists of organic dications and infinite chains of [Cd₂Cl₆(CdCl₄H₂O]_n⁴⁻ units running along the [001] axis. Each unit is formed of regularly alternate six-coordinated Cd atoms, one of them linking one pentacoordinated Cd atom which completes its coordination througha water molecule. A strong hydrogen bond interaction involving the organic dication and the inorganic chain contributes to the crystal packing. Differential hydrogen bond interaction involving the organic dication and the inorganic chain contributes to the crystal packing. Differential scanning calorimetry measurements did not show the presence of any structural phase transitions. The structures are compared with those of (H₂pipz)[Cd₂Cl₆(H₂O)₂] (3), (H₂mepipz)[Cd₂Cl₆(H₂O)₂]·H₂O (4) and (H₂mepipz)[Cd₂Cl₆] (5) (L = pipz = piperazine, L′ = mepipz = N-ethylpiperazine).     

Kinetics and mechanisms of ligand substitution reactions of molybdenum SO2 complexes. Synthesis and X-ray structure of trans-Mo(CO)2 (dmpe) (PPh3) (SO2)

Kinetic results are reported for intramolecular PPh₃ substitution reactions of Mo(CO)₂(η¹-L)(PPh₃)₂(SO₂) to form Mo(CO)₂(η²-L)(PPh₃)(SO₂) (L = DMPE = (Me)₂PC₂H₄P(Me)₂ and dppe=Ph₂PC₂H₄PPh₂) in THF solvent, and for intermolecular SO₂ substitutions in Mo(CO)₃(η²-L)(η²-SO₂) (L = 2,2′-bipyridine, dppe) with phosphorus ligands in CH₂Cl₂ solvent. Activation parameters for intramolecular PPh₃ substitution reactions: ΔH^≠ values are 12.3 kcal/mol for dmpe and 16.7 kcal/mol for dppe; ΔS^≠ values are −30.3 cal/mol K for dmpe and −16.4 cal/mol K for dppe. These results are consistent with an intramolecular associative mechanism. Substitutions of SO₂ in MO(CO)₃(η²-L)(η²-SO₂) complexes proceed by both dissociative and associative mechanisms. The facile associative pathways for the reactions are discussed in terms of the ability of SO₂ to accept a pair of electrons from the metal, with its bonding transformations of η²-SO₂ to η¹-pyramidal SO₂, maintaining a stable 18-e count for the complex in its reaction transition state. The structure of Mo(CO)₂(dmpe)(PPh₃)(SO₂) was determined crystallographically: P2₁/c, A=9.311(1), B = 16.344(2), C = 18.830(2) Å, ß=91.04(1)°, V=2865.1(7) ų, Z=4, R(F)=3.49%.     

Bis[dihydrobis(1-pyrazolyl)borate]cadmium(II): a monomeric, severely distorted tetrahedral complex of cadmium(II)

The crystal structure of the complex [H₂B(pz)₂]₂Cd has been determined: orthorhombic, Pbca, A = 16.052(3), B = 13.935(3), C = 14.974(4) Å, V = 3349.4(13) ų, Z = 8, R(F) = 3.61%. It is the first structurally characterized non-porphyrin CdN₄ complex. It is monomeric in the solid state with a pseudotetrahedral geometry about the cadmium atom. The N---Cd---N angles are distorted by the approximate 93° bite angle of the ligand; the interligand N---Cd---N angles also are distorted, ranging from 106.9 to 131.7°. These distortions are the result of intermolecular packing forces and are facilitated by the spherical set of valence orbitals for Cd²⁺.     

Tricarbonyl(1,10-phenanthroline) (imidazole) rhenium(I): a powerful photooxidant for investigations of electron tunneling in proteins

The structure of [Re(CO)₃(phen)(im)]₂SO₄·4H₂O has been determined by X-ray crystallography. The yellow crystals are orthorhombic, space group Pccn (No. 56), with a=17.456(6), B=18.194(5), C=12.646(4) Å, R=0.063 for F_o²>0, R=0.032 for F_o²>3σ. The compound, which also has been characterized by IR, ¹H NMR, and UV---Vis spectroscopies, exhibits room temperature luminescence in aqueous solution (τ=120 ns) as well as reversible oxidation and reduction in acetonitrile solution (1.85 and −1.30 V versus SCE). The redox properties of the excited state of the complex (E⁰(Re^+*/0 = 1.2; E⁰(Re^2+/+*) = −0.7 V) are being exploited in studies of laser-induced electron tunneling in Re(CO)₃(phen)(histidine)-modified proteins.     

Mixed anion lanthanide(III) crown ether complexes: crystal structures of [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4-(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]

Reaction of LaCl₃·7H₂O containing small amounts of La(NO₃)₃·7H₂O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH₃CN:CH₃OH resulted in the isolation of the mixed anion complexes [LaCl₂(NO₃)(12-crown-4)]₂, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN and [LaCl₂(NO₃)(18-crown-6)]. The nine-coordinate dimer, [LaCl₂(NO₃)(12-crown-4)]₂, has all of the anions in the inner coordination sphere and La³⁺ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and D_calc = 2.08 g cm⁻³ for Z = 4. The second complex isolated from the same reaction, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P2₁ with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and D_calc = 1.80 g cm⁻³ for Z = 2. The 18-crown-6 complex, [LaCl₂(NO₃)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La³⁺ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and D_calc = 1.89 g cm⁻³ for Z = 8.     

Convenient preparation of [CuX(PCy3)2](X = Br, I, SCN, N3) complexes. X-ray crystal structure of [Cu(N3)(PCy3)2] (Cy = cyclo-C6H11)

The labile cations [Cu(F-BF₃)(PCy₃)₂] and [Cu(OTf)(PCy₃)₂] are versatile precursors for the formation of [Cu(X)(PCy₃)₂] (X = Br, I, SCN, N₃) complexes by metathesis with NaX. The azide [Cu(N₃)(PCy₃)₂] is triclinic, space group , a = 9.755(4), B = 22.78(1), C = 9.284(6) Å, = 96.76(3), β = 115.36(3), γ = 94.20(5)°, Z = 2.     

Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

Synthesis and characterization of organomolybdenum and organotungsten halides containing the η-pentabenzylcyyclopentadienyl ligand η-Bz5C5M(CO)3X (M = Mo, W; X = Cl, Br, I). The X-ray molecular structure of η-Bz5C5Mo(CO)3I

An improved synthetic procedure for pentabenzylcyclopentadiene Bz₅C₅H was developed. Six new organomolybdenum and organotungsten halides η⁵-Bz₅C₅M(CO)₃X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η⁵-Bz₅C₅M(CO)₃Li (derived from Bz₅C₅H, n-BuLi and M(CO)₆) with PCl₃, PBr₃ or I₂ and characterized by elemental analysis, IR and ¹H NMR spectroscopy. The structure of η⁵-Bz₅C₅Mo(CO)₃I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) ų, Z = 4 and D_x = 1.50 g cm⁻³. The final R value was 0.035 for 4564 observed reflections.