Studies of the oxovanadium(IV)—oxalate system: syntheses and crystal structures of binuclear (Ph4P)2[(VO)2(H2O)2(C2O4)3]·4H2O and of the one-dimensional chain material, (Ph4P)[VOCl(C2O4)]

The hydrothermal reactions of (Ph₄P)[VO₂Cl₂] and H₂C₂O₄ at 150 and 125°C yield (Ph₄P)₂[V₂O₂(H₂O)₂(C₂O₄)₃]·4H₂O (1) and (Ph₄P)[VOCl(C₂O₄)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO₆ coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph₄P⁺ cations occupying regions between [VOCl(C₂O₄)]⁻_∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H₂O, monoclinic P2₁/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) ų, Z = 2, D_calc = 1.501 g cm⁻³, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P4₃, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) ų, Z = 4, R = 0.0452.     

Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

Synthesis and problematic crystal structures of [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta, Nb or Sb)

Compounds of formula [Al(CH₃CN)₆][MCl₆]₃(CH₃CN)₃ (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl₅ and AlCl₃ in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) ų and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) ų V = 1634.8(4) ų and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) ų and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation.     

Mixed anion lanthanide(III) crown ether complexes: crystal structures of [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4-(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]

Reaction of LaCl₃·7H₂O containing small amounts of La(NO₃)₃·7H₂O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH₃CN:CH₃OH resulted in the isolation of the mixed anion complexes [LaCl₂(NO₃)(12-crown-4)]₂, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN and [LaCl₂(NO₃)(18-crown-6)]. The nine-coordinate dimer, [LaCl₂(NO₃)(12-crown-4)]₂, has all of the anions in the inner coordination sphere and La³⁺ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and D_calc = 2.08 g cm⁻³ for Z = 4. The second complex isolated from the same reaction, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P2₁ with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and D_calc = 1.80 g cm⁻³ for Z = 2. The 18-crown-6 complex, [LaCl₂(NO₃)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La³⁺ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and D_calc = 1.89 g cm⁻³ for Z = 8.     

The ReH6[P(C6H5)3]2 ion as a ligand: complexes with M(CO)3 fragments (M = Cr, Mo, W)

The reactions of [(H₅C₆)₃P]₂ReH₆⁻ with (CH₃CN)₃Cr(CO)₃, (diglyme)Mo(CO)₃ or (C₃H₇CN)₃W(CO)₃ led to the formation of [(H₅C₆)₃P]₂ReH₆M(CO)₃⁻ (M = Cr, Mo, W) complexes. These have been characterized by IR and NMR spectroscopies, as well as elemental analyses. A single crystal X-ray diffraction study has also been carried out for the M = Cr complex as a K(18-crown-6)⁺ salt. The complex crystallizes as a THF monosolvate in the monoclinic space group P2₁/n with a = 22.323(6), B = 9.523(2), C = 27.502(5) Å, β = 104.98(2)⁰ and V = 5648 ų for Z = 4. The Re---Cr separation is 2.5745(12) Å, and the two phosphine ligands are oriented unsymmetrically. Although the hydride ligands were not found, the presence of three bridging hydrides and a dodecahedral coordination geometry about rhenium could be inferred. Low temperature ¹H and ³¹P NMR spectroscopic studies did not reveal the low symmetry of the solid state structure.     

The coordination chemistry of cationic main group clusters: syntheses and structures of [Fe3(Se2)2(CO)10] and [Fe4(Se2)3(CO)12]

The reactions of the polysulfur and selenium cationic clusters S₈²⁺ and Se₈²⁺ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF₆⁻ as a counterion, the cluster [Fe₃(E₂)₂(CO)₁₀] [SbF₆]₂·SO₂ (E = S, Se) could be isolated from the reaction of E₈²⁺ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se₂ groups, with the whole fragment capped by an Fe(CO)₄ group. Crystallographic data for C₁₀O₁₂Fe₃Se₄Sb₂F₁₂S (I): space group monoclinic P2₁/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) ų, Z = 4, R = 0.0426, R_w = 0.0503. When Sb₂F₁₁⁻ is present as the counterion, or Se₄[Sb₂F₁₁]₂ is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe₄(Se₂)₃(CO)₁₂] [SbF₆]₂·3SO₂. The dication contains two Fe₂Se₂ fragments bridged by an Se₂ group. Crystallographic data for C₁₂O₁₈Fe₄Se₆Sb₂F₁₂S₃ (III): space group triclinic , b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) ų, Z = 2, R = 0.0328, R_w = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO₂ when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated.     

Molecular structures of Fe(II) complexes with mono- and di-protonated ethylenediamine-N,N,N′,N′-tetraacetate (Hedta and H2edta), as determined by X-ray crystal analyses

The molecular structure of the title complexes [Fe(H₂O)₄][Fe(Hedta)(H₂O)]₂ · 4H₂O (I) and [Fe(H[₂edta)(H₂O)] · 2H₂O (II) have been determined by single-crystal X-ray analyses. The crystal data are as follows: I: monoclinic, P2₁/n, A = 11.794(2), B = 15.990(2), C = 9.206(2) Å, β = 90.33(1)°, V = 1736.1(5) ų, Z = 2 and R = 0.030; II: monoclinic, C2/c, A = 11.074(2), B = 9.856(2), C = 14.399(2) Å, β = 95.86(1)°, V = 1563.3(4) ų, Z = 4 and R = 0.025. I is found to be isomorphous with the Mn^II analog reported earlier and to contain a seven-coordinate and approximately pentagonal-bipyramidal (PB) [Fe^II(Hedta)(H₂O]⁻ unit in which Hedta acts as a hexadentate ligand. The [Fe^II(H₂edta)(H₂O)] unit in II has also a seven-coordinate PB structure with the two protonated equatorial glycine arms both remaining coordinated, and thus bears a structural resemblance to the seven-coordinate [Co^II(H₂edta)(H₂O)] reported previously.     

Synthesis, crystal structure and magnetic properties of the first structurally characterized 1,2-dithiocroconato-containing Cu(II) complex, [Cu(bpca)(H2O)]2[Cu(1,2-dtcr)2]·2H2O

The first crystal and molecular structure of a transition metal complex containing 1,2-dithiocroconate (1,2-dtcr, dianion of 1,2-dimercaptocylopent-1-ene-3,4,5-trione), [Cu(bpca)(H₂O)]₂[Cu(1,2-dtcr)₂]·2H₂O (where bpca is the bis(2-pyrdidylcarbonyl)amide anion), has been determined by single crystal X-ray diffraction methods. The compound crystallizesin the monoclinic syste, space group P2₁/c, with a = 11.661(3), b = 20.255(6), c = 8.265(3) Å, ß = 107.26(2)° and Z = 2. The structure is formally built of [Cu(1,2-dtcr)₂]²⁻ and [Cu(bpca)(H₂O)]⁺ ions and water of hydration. The copper atom of the anion is situated at a crystallographic inversion centre, bonded to four sulfur atoms in a planar, approximately square arrangement. In the cation the copper equatorial plane is formed by the three nitrogen atoms of the bpca ligand and a water oxygen atom. In addition there is a very weak axial bond to one of the sulfur atoms of a 1,2-dtcr ligand in the anion. Through these latter weak bonds each anion is connected to, and sandwiched between, two cations, resulting in neutral, trinuclear, centrosymmetric formula units. The triple-decker molecules are arranged in stacks along the crystallographic a-axis creating close contacts between the terminal copper atoms and bpca groups of the neighbouring molecules. This intermolecular interaction is, however, too weak to define the structure as a chain compound. The distance between adjacent copper atoms within the trinuclear unit is 4.189(1) Å, while the shortest intra-stack metal-metal separation between terminal copper atoms is 5.281(1) Å. Variable-temperature magnetic susceptibility measurements in the temperature r.2–140 K reveal that a Curie law is followed; with three non-interacting copper(II) ions in the formula unit.     

Correlation of structure and emission in solid state copper(I) complexes; [Cu4I4(CH3CN)2(L)2], L = aniline derivative

Four complexes of the type [Cu₄I₄(CH₃CN)₂(L)₂], L = aniline derivative: Cu₄I₄(CH₃CN)₂(2,6-dimethylaniline)₂ (I), triclinic, , a = 12.449(3), B = 14.108(6), C = 10.606(4) Å, = 73.46(3), β = 95.00(2), γ = 73.42(3)°, V = 1682.3(10) ų; Cu₄I₄(CH₃CN)₂(o-ethylaniline)₂ (II), triclinic,

Full-size image

, V = 1734.0(8) ų; Cu₄I₄(CH₃CN)₂(6-ethyl-o-toluidine)₂ (III), orthorhombic, Pnam, a = 14.976(6), b = 21.187(6), C = 12.545(2) Å, V = 3980.7(2) ų; Cu₄I₄(CH₃CN)₂(p-anisidine)₂ (IV), monoclinic, A2/a, A = 20.032(10), B = 7.863(1), C = 18.715(9) Å, β = 101.56(4)°, V = 2888.0(2) ų; were examined by single crystal X-ray diffraction. Complexes I and II have no internal symmetry elements, III has an internal mirror and IV has a two-fold axis. Ab initio calculations based on the atomic positional parameters of complexes containing the three types of symmetry elements reveal HOMO orbitals to be dominated by the p orbitals of the iodine atoms whereas the LUMO orbitals contain major contributions from copper based p orbitals.     

Peroxo aminopolycarboxylato vanadate(V) of an unusually low toxicity: synthesis and structure of the very stable K2[VO(O2)(C6H6NO6)]·2H2O

The synthesis and structure of a monoperoxo vanadate(V) of the formula K₂[VO(O₂)NTA]·2H[₂O, where NTA = C₆H₆NO₆ ³⁻, the nitrilotriacetate, is described. This stable compound crystallizes in the orthorhombic system (space group Pna2₁): a = 7.621(1), B = 13.002(3), C = 13.155(1) Å. A tetradentate NTA encloses vanadium in a distorted pentagonal bipyramid with an apical V = O group. Cis to it, in the pentagonal plane, a non-symmetrically coordinated peroxo group is located with an (O---O) bond length of 1.438(4) Å. Complex IR spectra display rich absorption due to coordinated NTA, in addition to the characteristic V = O and (O---O) stretching vibrations. Aqueous solutions of the complex show a (peroxo → V(V)) charge transfer band at γ_max = 425 nm.     

Molecular structures and some properties of tris(2-aminoethyl) amine cobalt(III) complexes with thiocarboxylato-O,S such as 3-mercaptopropionato, 2-mercaptoacetato and their derivatives

Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]⁺ (2), t-[Co(mtp)(tren)]²⁺ (1Me) and t-[Co(mta)(tren)]²⁺ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO₄ (1CIO₄): monoclinic, P2₁/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) ų, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H₂O (2Cl·3H₂O): monoclinic, P2₁/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) ų, Z = 4 and R = 0.066; (+)₄₆₅^CD-t-[Co(mtp)(tren)](ClO₄)₂ ((+)₄₆₅^CD-1Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) ų, Z = 4 and R = 0.068; (+)₄₆₅^CD-t-[Co(mta)(tren)](ClO₄)₂ ((+)₄₆₅^CD-2Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) ų, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)₄₆₅^CD-1Me is the S configuration and that in (+)₄₆₅^CD-2Me is the R one. The ¹H NMR, ¹³C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries.     

Synthesis and characterization of organomolybdenum and organotungsten halides containing the η-pentabenzylcyyclopentadienyl ligand η-Bz5C5M(CO)3X (M = Mo, W; X = Cl, Br, I). The X-ray molecular structure of η-Bz5C5Mo(CO)3I

An improved synthetic procedure for pentabenzylcyclopentadiene Bz₅C₅H was developed. Six new organomolybdenum and organotungsten halides η⁵-Bz₅C₅M(CO)₃X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η⁵-Bz₅C₅M(CO)₃Li (derived from Bz₅C₅H, n-BuLi and M(CO)₆) with PCl₃, PBr₃ or I₂ and characterized by elemental analysis, IR and ¹H NMR spectroscopy. The structure of η⁵-Bz₅C₅Mo(CO)₃I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) ų, Z = 4 and D_x = 1.50 g cm⁻³. The final R value was 0.035 for 4564 observed reflections.     

The monofunctionalized 1,4,7-triazacyclononane derivatives 1,4,7-triazacyclononane-N-acetate (L) and N-(2-hydroxybenzyl-1,4,7-triazacyclononane (HL) and their complexes with vanadium(IV)/(V). Localized and delocalized electronic structures in compounds containing the mixed valent [OV---O---VO] core

The synthesis of the tetradentate pendant arm macrocycles 1,4,7-triazacyclononane-N-acetate (L¹) and N-(2-hydroxybenzyl)-1,4,7-triazacyclononane (HL²) and their coordination chemistry with vanadium(IV) and (V) are reported. The following mononuclear species have been prepared and characterized by UV-Vis, IR spectroscopy: [L¹V^IVO(NCS)] (1), [L¹VO₂]·H₂O (2), [L²VO(NCS)] (3), [L²VO(NCS)]Cl (4), and [L²VO₂] (5). In addition, the dinuclear, mixed valent complexes [L₂¹V₂O₃]Br (6), [L₂²V₂O₃](ClO₄)·0.5acetone (7), and the homovalent complex [L₂²V₂O₃](ClO₄)₂ (8) have been synthesized. Complexes 2, 3, 6 and 7 have been characterized by single crystal X-ray crystallography. Crystal data: 2, space group P2₁c,a=9.944(4),b=6.701(3),c=18.207(8)Å, β=102.88(3)°, V=1182.7 ų, Z=4, D_calc=1.51 g cm⁻³, R=0.049 based on 4760 reflections; 3, space group Pbca, A=11.003(6), b=14.295(7), C=20.21(1) Å, V=3178.8 ų, Z=8, D_calc=1,50 g cm⁻³, R=0.057 based on 1049 reflections; 6, space Pbcn, a=12.922(3), B=13.852(3), C=12.739(3) Å, V=2280.3 ų, Z=4, D_calc=1,75 g cm⁻³, R=0.047 based on 1172 reflections; 7, space group C2/c, A=23.553(9), B=13.497(5), C=20.951(8) Å, β=90.03(3)°, V=6660.2 ų, Z=8, D_calc=1.49 g cm⁻³, R=0.053 based on 3698 reflections. Complexes 6 and 7 are mixed valent V(IV)/(V) complexes containing the [OV---O---VO]³⁺ core. In the solid state 6 belongs to class III (delocalized) and 7 to class I (localized) according to the Robin and Day classification of mixed valent compounds. A rationale for these differing electronic structures is given.     

The crystal and molecular structures of lithium trimethylenediaminetetraacetatoferrate(III) trihydrate Li[Fe(trdta)]·3H2O and sodium ethylenediamine-N,N′-diacetato-N,N′-di-3-propionatoferrate(II) pentahydrate Na[Fe(eddda)]·5H2O

The crystal structures of Li[Fe(trtda)]·3H₂O and Na[Fe(eddda)]·5H₂O (trtda = trimethylenediaminetetraacetate and eddda = ethylenediamine-N,N′-diacetate-N,N′-di-3-propionate) have been determined by single crystal X-ray diffraction techniques. The former crystal was monoclinic with the space group P2₁/n,a = 17.775(3),b = 10.261(1),c = 8.883(2)Å, β = 95.86(4)° and Z = 4. The latter was also monoclinic with the space group P2₁/n,a = 6.894(2),b = 20.710(6),c = 13.966(3)Å, β = 101.44(2)° and Z = 4. Both complex anions were found to adopt an octahedral six-coordinated structure with all of six ligand atoms of trdta⁴⁻ or eddda⁴⁻ coordinated to the Fe(III) ion, unlike the corresponding edta⁴⁻ complex which is usually seven-coordinate with the seventh coordination site occupied by H₂O. Of the three geometrical isomers possible for the eddda complex, the trans(O₅) isomer was actually found in the latter crystal. Factors determining the structural types of metal–edta complexes are discussed in detail.     

Interactions between thiamine and large anions. Crystal structures of (H-thiamine)[Pt(SCN)4] · 3H2O and (H-thiamine)[Pt(SCN)6] · H2O

The reaction of thiamine with K₂Pt^IICl₄ and with Pt^IVCl₄ in the presence of excess NaSCN in aqueous solution gave thiamine salts, (H-thiamine)[Pt(SCN)₄] · 3H₂O (1) and (H-thiamine)[Pt(SCN)₆] · H₂O (2), respectively, structures of which have been determined by X-ray diffraction. The thiamine molecule adopts the usual F conformation in each salt. In 1, [Pt(SCN)₄]²⁻ ions act as large planar spacers in the crystal lattice and interact scarcely with thiamine, except for a hydrogen bonding with the terminal hydroxy O(5γ). Instead, water molecules form two types of host–guest-like interactions with the pyrimidine and the thiazolium moieties of a thiamine molecule, one being a C(2)–Hwaterpyrimidine bridge and the other being an N(4′)–Hwaterthiazolium bridge. In 2, despite the much larger ion size, octahedral [Pt(SCN)₆]²⁻ ions form a C(2)–Hanionpyrimidine bridge and an N(4′)–Hanionthiazolium bridge. An additional hydrogen bonding between the anion and the terminal O(5γ) of thiamine creates a hydrogen-bonded macrocyclic ring {thiaminium–[Pt(SCN)₆]²⁻}₂, a supramolecule.     

Thermal and photochemical substitution reactions of CpRe(PPh3)2H2 and CpRe(PPh3)H4. Catalytic insertion of ethylene into the C-H bond of benzene

The thermal and photochemical reactions of CpRe(PPh₃)₂H₄ and CpRe(PPh₃)H₄ (Cp = η⁵-C₅H₅) with PMe₃, P(p-tolyl)₃, PMe₂Ph, DMPE, DPPE, DPPM, CO, 2,6-xylylisocyanide and ethylene have been examined. While CpRe(PPh₃)₂H₂ is thermally inert, it will undergo photochemical substitution of one or two PPh₃ ligands. With ethylene, substitution is followed by insertion of the olefin into the C-H bond of benzene, giving ethylbenzene. CpRe(PPh₃)H₄ undergoes thermal loss of PPh₃, which leads to substituted products of the type CpRe(L) H₄. Photochemically, reductive elimination of dihydrogen occurs preferentially. The complex trans-CpRe(DMPE)H₂ was structurally characterized, crystallizing in the monoclinic space group P2₁/n (No. 14) with a = 6.249(6), b = 16.671(8), c = 13.867(7) Å, β = 92.11(6)°, V = 1443.7(2.9) Å and Z = 4. The complex trans-CpRe(PMe₂Ph)₂H₂ was structurally characterized, crystallizing in the monoclinic space group P2₁/n (No. 14) with a = 7.467(3), b = 23.874(14), c = 11.798(6) Å, β = 100.16(4)°, V = 2070.2(3.4) ų and Z = 4.     

Dirhodium(II) tetrakis[N,N-dimethyl-2-pyrrolidone-5(S)-carboxamide]. Structural effects on enantioselection in metal carbene transformations

The preparation and structural characterization of dirhodium(II) tetrakis[N,N-dimethyl-2-pyrrolidone-5(S)-carb- oxamide], Rh₂(5S-DMAP)₄, a new sterically-demanding catalyst for enantioselective metal carbene transformations, is described. The pyrrolidone ligands are arrayed around the dirhodium(II) core with two oxygen and two nitrogen donor atoms, each oriented cis, bound to each octahedral rhodium. The crystal structure of this compound has been determined to be that of Rh₂(5S-DMAP)₄(CH₃CN)₂·CH₃CN·6H₂O: space group P2₁2₁2₁ with cell constants a= 12.685(4), b=15.050(3), c=24.035(4) Å; V=4588.5(1.9) ų, Z=4, R=0.0316, Rh---Rh DISTANCE =2 4538(5) Å. Decreased activity for diazodecomposition catalyzed by Rh₂(5S-DMAP)₄ is observed, and enantiocontrol for cyclopropanation and carbon-hydrogen insertion is lower than expected by analogy to the corresponding di- rhodium(II) tetrakis[methyl 2-pyrrolidone-5(S)-carboxylate], Rh₂(5S-MEPY)₄ Electronic stabilization of the in- termediate metal carbene is absent in reactions catalyzed by Rh₂(5S-DMAP)₄.     

Application of the hydro(solvo)thermal technique to the synthesis of metal carbonyl chalcogenide clusters Part 3. Synthesis, structural characterization, and spectroscopic studies of the clusters [{M(CO)4}n(MS4)] (M = Mo, W; N=1, 2)

The methanothermal reactions of M(CO)₆ (M = Mo, W) with Na₂S₂ gave a series of homonuclear clusters [{M(CO)₄}_n(MS₄)]²⁻ (M=Mo, W; N=1, 2), i.e. (Ph₄P)₂[(CO)₄Mo(MoS₄)] (I), (Ph₄P)₂[(CO)₄W(WS₄)] (II), (Ph₄P)₂[(CO)₄Mo(MoS₄)Mo(CO)₄] (III) and (Ph₄P)₂[(CO)₄W(WS₄)W(CO)₄] (IV). The two dimers, I and II, as well as the two trimers, III and IV, are isostructural to each other, respectively. All compounds crystallize in the triclinic space group with Z=2. The cell dimensions are: a=12.393(8), b=19.303(9), c=11.909(6) Å, =102.39(5), β=111.54(5), γ=73.61(5)°, V=2522(3) ų at T=23 °C for I; a=12.390(3), b=19.314(4), c=11.866(2) Å, =102.66(2), β=111.49(1), γ=73.40(2)°, V=2511(1) ų at T=23 °C for II; a=11.416(3), b=22.524(4), c=10.815(4) Å, =91.03(2), β=100.57(3), γ=88.96(2)°, V=2733(1) ų at T=−100 °C for III, a=11.498(1), b=22.600(4), c=10.864(3) Å, =90.92(2), β=100.85(1), γ=88.58(1)°, V=2771(2) ų at T=23 °C for IV. The dimers are each formed by the coordination of the tetrathiometalate as a bidentate chelating ligand to an M(CO)₄ fragment while addition of another M(CO)₄ fragment to the dimers results in the trimers. All compounds contain both tetrahedral and octahedral metal centers with the formal 6+ and 0 oxidation states, respectively.     

Electrochemical synthesis and crystal structure of (3-trimethylsilylpyridine-2-thiolato) copper(I), [Cu4(3-Me3Sipyt)4]

(3-Trimethylsilyl-pyridine-2-thiolato-S,N)copper(I), [Cu(3-Me₃Sipyt)], was obtained by electrochemical oxidation of copper metal in an acetonitrile solution of the neutral ligand. The compound is tetrameric and the four copper atoms are arranged with distorted tetrahedral geometry, each copper atom being trigonally coordinated to one nitrogen and two sulfur atoms of three different ligands. Crystal data: 14₁/a, a=14.608(2), C=19.366(4) Å, V=4133(2), Å, Z=4, D_calc=1.581 g cm⁻³, R=0.0397 for 848 reflections.     

Structural studies on [Mo3S4] and [Mo3S4Cu] complexes with tripodal ligands providing various NxOy (x + Y = 3) donor sets

The interaction of 1,3,5-triamino-1,3,5-trideoxy-cis-inositol (taci) and its N-methylated derivative 1,3,5-trideoxy-1,3,5-tris(dimethylamino)-cis-inositol (tdci) with the incomplete [Mo₃S₄]⁴⁺ cube and the heterometallic [Mo₃S₄Cu]⁴⁺ cube have been investigated by X-ray analysis. The crystal structures of [Mo₃S₄(taci+ rmC₃H₆O-H₂O)₃-4H]·2OH₂O (1a, rhombohedral, space group R32, A = 15.964(3), C = 40.59(1) Å, Z = 6), [Mo₃S₄(tdci)₃]Br₄·9.5EtOH·5H₂O (2a, triclinic, space group

Full-size image

and [CuBrMo₃S₄(tdci)₃]Br₃·11 H₂O·EtOH (3a, monoclinic, space group P2,/n, A = 14.887(3), B = 22.570(4), C = 21.974(5) Å, β = 98.54(2)°, Z = 4) revealed andN-N-O and an N-O-O coordination mode for taci and tdci, respectively. In 1a, taci is coordinated as an anion with deprotonated oxygen and nitrogen donors. In addition, the non-coordinating amino group reacted with one equivalent; of acetone, forming a Schiff base condensation product. For 2a, short Mo---O bonds and high pK_a values (compared to the aqua ion [Mo₃S₄(H₂O)₉]⁴⁺) indicate the formation of a zwitterionic form of the tdci ligand with coordinated alkoxo groups and peripheral dimethylammonium groups. No significant differences were found for the structural properties of the Mo-tdci fragment in 2a and 3a. The coordination modes of taci and tdci, as observed in the solid state, are in agreement with the previously reported solution structures, established by NMR spectroscopy. They are attributed to the specific steric requirements of the two ligands and to a pronounced preference of the [Mo₃(μS)₃(μ₃S)]⁴⁺ core to coordinate a nitrogen donor trans to μ₃S.