One-dimensional polymeric chlorocadmate(II) systems of N-methylpiperazinium and N,N′-dimethylpiperazinium compounds: synthesis, structural and thermal properties

The chlorocadmate(II) systems of (H₂me₂pipz)[Cd₂Cl₆(H₂O)₂] (1) and (H₂mepipz)₂[Cd₃Cl₁₀(H₂O)] (2) (L = me₂pipz = N,N′-dimethylpiperazine; L′ = mepipz = N-methylpiperazine) were prepared and their structural and thermal properties investigated. Compound 1 is monoclinic, space group P2₁/c, A = 7.664(1), B = 7.472(4), C = 15.347(1) Å, β = 99.468(7)°, Z = 2, R = 0.024. The crystal structure consists of organic cations and infinite one-dimensional chains of [CdCl₃(H₂O)]_n³⁻ anions. Each Cd atom is octahedrally surrounded by bridged and terminal chlorine atoms and by a water molecule, which is in trans position with respect to the terminal chlorine atom. Inter- and intrachain hydrogen bond interactions between the terminal chlorine atoms and the water molecules contribute to the crystal packing. Compound 2 is orthorhombic, space group Cmc2₁, A = 15.286(3), B = 13.354(3), C = 13.154(3) Å, R = 0.023. The crystal structure consists of organic dications and infinite chains of [Cd₂Cl₆(CdCl₄H₂O]_n⁴⁻ units running along the [001] axis. Each unit is formed of regularly alternate six-coordinated Cd atoms, one of them linking one pentacoordinated Cd atom which completes its coordination througha water molecule. A strong hydrogen bond interaction involving the organic dication and the inorganic chain contributes to the crystal packing. Differential hydrogen bond interaction involving the organic dication and the inorganic chain contributes to the crystal packing. Differential scanning calorimetry measurements did not show the presence of any structural phase transitions. The structures are compared with those of (H₂pipz)[Cd₂Cl₆(H₂O)₂] (3), (H₂mepipz)[Cd₂Cl₆(H₂O)₂]·H₂O (4) and (H₂mepipz)[Cd₂Cl₆] (5) (L = pipz = piperazine, L′ = mepipz = N-ethylpiperazine).     

Molecular structures and some properties of tris(2-aminoethyl) amine cobalt(III) complexes with thiocarboxylato-O,S such as 3-mercaptopropionato, 2-mercaptoacetato and their derivatives

Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]⁺ (2), t-[Co(mtp)(tren)]²⁺ (1Me) and t-[Co(mta)(tren)]²⁺ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO₄ (1CIO₄): monoclinic, P2₁/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) ų, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H₂O (2Cl·3H₂O): monoclinic, P2₁/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) ų, Z = 4 and R = 0.066; (+)₄₆₅^CD-t-[Co(mtp)(tren)](ClO₄)₂ ((+)₄₆₅^CD-1Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) ų, Z = 4 and R = 0.068; (+)₄₆₅^CD-t-[Co(mta)(tren)](ClO₄)₂ ((+)₄₆₅^CD-2Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) ų, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)₄₆₅^CD-1Me is the S configuration and that in (+)₄₆₅^CD-2Me is the R one. The ¹H NMR, ¹³C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries.     

Mixed anion lanthanide(III) crown ether complexes: crystal structures of [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4-(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]

Reaction of LaCl₃·7H₂O containing small amounts of La(NO₃)₃·7H₂O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH₃CN:CH₃OH resulted in the isolation of the mixed anion complexes [LaCl₂(NO₃)(12-crown-4)]₂, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN and [LaCl₂(NO₃)(18-crown-6)]. The nine-coordinate dimer, [LaCl₂(NO₃)(12-crown-4)]₂, has all of the anions in the inner coordination sphere and La³⁺ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and D_calc = 2.08 g cm⁻³ for Z = 4. The second complex isolated from the same reaction, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P2₁ with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and D_calc = 1.80 g cm⁻³ for Z = 2. The 18-crown-6 complex, [LaCl₂(NO₃)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La³⁺ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and D_calc = 1.89 g cm⁻³ for Z = 8.     

Crystal growth in aqueous hydrofluoric acid and (HF)x · pyridine solutions: syntheses and crystal structures of [Ni(H2O)6][MF6] (M = Ti, Zr, Hf) and Ni3(py)12F6 · 7H2O

The syntheses and structures of [Ni(H₂O)₆]²⁺[MF₆]²⁻ (M = Ti,Zr,Hf) and Ni₃(py)₁₂F₆·7H₂O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group (No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) ų for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) ų for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)ų for Hf. The structures consist of discrete [Ni(H₂O)₆]²⁺ and [MF₆]²⁻ octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni₃(py)₁₂F₆·7H₂O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) ų. The structure consists of discrete Ni(py)₄F₂ octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)_x·pyridine/pyridine/water solution.     

The monofunctionalized 1,4,7-triazacyclononane derivatives 1,4,7-triazacyclononane-N-acetate (L) and N-(2-hydroxybenzyl-1,4,7-triazacyclononane (HL) and their complexes with vanadium(IV)/(V). Localized and delocalized electronic structures in compounds containing the mixed valent [OV---O---VO] core

The synthesis of the tetradentate pendant arm macrocycles 1,4,7-triazacyclononane-N-acetate (L¹) and N-(2-hydroxybenzyl)-1,4,7-triazacyclononane (HL²) and their coordination chemistry with vanadium(IV) and (V) are reported. The following mononuclear species have been prepared and characterized by UV-Vis, IR spectroscopy: [L¹V^IVO(NCS)] (1), [L¹VO₂]·H₂O (2), [L²VO(NCS)] (3), [L²VO(NCS)]Cl (4), and [L²VO₂] (5). In addition, the dinuclear, mixed valent complexes [L₂¹V₂O₃]Br (6), [L₂²V₂O₃](ClO₄)·0.5acetone (7), and the homovalent complex [L₂²V₂O₃](ClO₄)₂ (8) have been synthesized. Complexes 2, 3, 6 and 7 have been characterized by single crystal X-ray crystallography. Crystal data: 2, space group P2₁c,a=9.944(4),b=6.701(3),c=18.207(8)Å, β=102.88(3)°, V=1182.7 ų, Z=4, D_calc=1.51 g cm⁻³, R=0.049 based on 4760 reflections; 3, space group Pbca, A=11.003(6), b=14.295(7), C=20.21(1) Å, V=3178.8 ų, Z=8, D_calc=1,50 g cm⁻³, R=0.057 based on 1049 reflections; 6, space Pbcn, a=12.922(3), B=13.852(3), C=12.739(3) Å, V=2280.3 ų, Z=4, D_calc=1,75 g cm⁻³, R=0.047 based on 1172 reflections; 7, space group C2/c, A=23.553(9), B=13.497(5), C=20.951(8) Å, β=90.03(3)°, V=6660.2 ų, Z=8, D_calc=1.49 g cm⁻³, R=0.053 based on 3698 reflections. Complexes 6 and 7 are mixed valent V(IV)/(V) complexes containing the [OV---O---VO]³⁺ core. In the solid state 6 belongs to class III (delocalized) and 7 to class I (localized) according to the Robin and Day classification of mixed valent compounds. A rationale for these differing electronic structures is given.     

Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

Studies of the oxovanadium(IV)—oxalate system: syntheses and crystal structures of binuclear (Ph4P)2[(VO)2(H2O)2(C2O4)3]·4H2O and of the one-dimensional chain material, (Ph4P)[VOCl(C2O4)]

The hydrothermal reactions of (Ph₄P)[VO₂Cl₂] and H₂C₂O₄ at 150 and 125°C yield (Ph₄P)₂[V₂O₂(H₂O)₂(C₂O₄)₃]·4H₂O (1) and (Ph₄P)[VOCl(C₂O₄)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO₆ coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph₄P⁺ cations occupying regions between [VOCl(C₂O₄)]⁻_∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H₂O, monoclinic P2₁/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) ų, Z = 2, D_calc = 1.501 g cm⁻³, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P4₃, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) ų, Z = 4, R = 0.0452.     

Bis[dihydrobis(1-pyrazolyl)borate]cadmium(II): a monomeric, severely distorted tetrahedral complex of cadmium(II)

The crystal structure of the complex [H₂B(pz)₂]₂Cd has been determined: orthorhombic, Pbca, A = 16.052(3), B = 13.935(3), C = 14.974(4) Å, V = 3349.4(13) ų, Z = 8, R(F) = 3.61%. It is the first structurally characterized non-porphyrin CdN₄ complex. It is monomeric in the solid state with a pseudotetrahedral geometry about the cadmium atom. The N---Cd---N angles are distorted by the approximate 93° bite angle of the ligand; the interligand N---Cd---N angles also are distorted, ranging from 106.9 to 131.7°. These distortions are the result of intermolecular packing forces and are facilitated by the spherical set of valence orbitals for Cd²⁺.     

A dicopper complex of N,N′-bis[2,2-dimethyl-4-(2-hydroxyphenyl)-3-aza-3-buten] oxamide. Structure and magnetic behaviour of the mono hydrated form

The ligand N, N′-bis[2,2-dimethyl-4-(2-hydroxyphenyl)-3-aza-3-buten] oxamide with two identical coordination sites reacts with copper ions in its tetradeprotonated form to yield the dinuclear complex [Cu₂(C₂₄H₂₆N₄O₄)]·H₂O. The structure of this compound has been determined by the X-ray diffraction method. The crystals are orthorhombic with a = 11.744(1), B = 16.369(2), C = 26.340(3) Å, V = 5064(1) ų, Z = 8, space group Pbca. The oxamide is in a trans conformation with two different environments for the copper centres, a (4 + 1) coordination mode for the first one and a square planar environment for the other one. The water molecule is not directly bound to a copper centre, but involved in hydrogen bonding with the two oxygen atoms of an N₂O₂ coordination site. Indeed, extra coordination comes from a phenolic oxygen atom belonging to an adjacent dinuclear unit. Static susceptibility measurements point to a strong intrapair antiferromagnetic exchange interaction of 2J = −520(±4) cm⁻¹ and possibly an interpair ferromagnetic exchange interaction of 10(±5) cm⁻¹.     

Synthesis of one dimensional tin selenides in supercritical amines

Three new crystalline tin selenide salts have been prepared from the reactions of [PPh₄]₂[Sn(Se₄₃] in supercritical solvents. The starting material pyrolyzes in supercritical acetonitrile to form [PPh₄]₄[Sn₆Se₂₁] (I), and it also reacts with SnSe in supercritical ammonia leading to a mixture of [PPh₄]₄[Sn₃Se₁₁]₂ (II). and [PPh₄]₂[Sn(Se₄)(Se₆)₂] (III). All three compounds have been characterized by single crystal X-ray diffraction. Crystallographic data: for I, C₉₆H₉₀P₄Se₂₁Sn₆, space group triclinic, P-1, A = 18.763(3), B = 24.600(4), C = 13.137(1) Å, = 102.63(1), β = 93.66(1), γ = 108.72(1)°, V = 5544(1) ų, Z = 2, R = 0.0350, R_W = 0.0317: for II, C₉₆H₈₀P₄Se₂₂Sn₆, space group monoclinic P2₁/c, A = 31.500(4), B = 16.572(3), C = 22.352(3) Å, β = 103.53(1)°, V = 11344(3) ų, Z = 4, R = 0.0771, R_W = 0.0664: for III, C₄₈H₄₀P₂Se₁₆Sn, space group monoclinic, C2/c, A = 25.381(2), B = 13.934(4), C = 19.465(3) Å, β = 121.587(8)°, V = 5867(2) ų, Z = 4, R = 0.0807, R_W = 0.0650. One of the compounds, [PPh₄]₂[Sn(Se₄(Se₆₂], is a molecular cluster while the other two complexes [PPh₄]₄[Sn₃Se₁₁]₂ and [PPh₄]₄[Sn₆Se₂₁], are one dimensional tin selenide chains. The structures of the two chains are related and consits of tetrahedral and distorted trigonal bipyramidal tin(IV) centers bridged by Se²⁻, Se₂²⁻ and Se₃²⁻ chains.     

Synthesis and problematic crystal structures of [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta, Nb or Sb)

Compounds of formula [Al(CH₃CN)₆][MCl₆]₃(CH₃CN)₃ (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl₅ and AlCl₃ in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) ų and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) ų V = 1634.8(4) ų and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) ų and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation.     

The crystal and molecular structures of lithium trimethylenediaminetetraacetatoferrate(III) trihydrate Li[Fe(trdta)]·3H2O and sodium ethylenediamine-N,N′-diacetato-N,N′-di-3-propionatoferrate(II) pentahydrate Na[Fe(eddda)]·5H2O

The crystal structures of Li[Fe(trtda)]·3H₂O and Na[Fe(eddda)]·5H₂O (trtda = trimethylenediaminetetraacetate and eddda = ethylenediamine-N,N′-diacetate-N,N′-di-3-propionate) have been determined by single crystal X-ray diffraction techniques. The former crystal was monoclinic with the space group P2₁/n,a = 17.775(3),b = 10.261(1),c = 8.883(2)Å, β = 95.86(4)° and Z = 4. The latter was also monoclinic with the space group P2₁/n,a = 6.894(2),b = 20.710(6),c = 13.966(3)Å, β = 101.44(2)° and Z = 4. Both complex anions were found to adopt an octahedral six-coordinated structure with all of six ligand atoms of trdta⁴⁻ or eddda⁴⁻ coordinated to the Fe(III) ion, unlike the corresponding edta⁴⁻ complex which is usually seven-coordinate with the seventh coordination site occupied by H₂O. Of the three geometrical isomers possible for the eddda complex, the trans(O₅) isomer was actually found in the latter crystal. Factors determining the structural types of metal–edta complexes are discussed in detail.     

The use of the borocaptate anion as a ligand. Synthesis and X-ray crystal structure of pentaammine (1-thiolato-closo-undecahydrododecaborane)ruthenium(III) dihydrate

The complex [Ru(SB₁₂H₁₁)(NH₃)₅]·2H₂O has been prepared by the reaction of Cs₂B₁₂H₁₁SH with [RuCl(NH₃)₅]Cl₂ in aqueous solution. The complex represents the first reported example of the borocaptate anion acting as a ligand. The structure of the complex has been determined by single crystal X-ray diffraction analysis. The crystal parameters are monoclinic, space group P2₁/c, A = 8.056(1), B = 14.240(2), C = 15.172(2) Å, β=98.48° and Z = 4. The ruthenium atom has a distorted octahedral coordination. The distortion is probably due to the high (3⁻) charge and the large bulk of the borocaptate ligand. These features can also be observed in the spectroscopic properties of the complex.     

Structural studies on [Mo3S4] and [Mo3S4Cu] complexes with tripodal ligands providing various NxOy (x + Y = 3) donor sets

The interaction of 1,3,5-triamino-1,3,5-trideoxy-cis-inositol (taci) and its N-methylated derivative 1,3,5-trideoxy-1,3,5-tris(dimethylamino)-cis-inositol (tdci) with the incomplete [Mo₃S₄]⁴⁺ cube and the heterometallic [Mo₃S₄Cu]⁴⁺ cube have been investigated by X-ray analysis. The crystal structures of [Mo₃S₄(taci+ rmC₃H₆O-H₂O)₃-4H]·2OH₂O (1a, rhombohedral, space group R32, A = 15.964(3), C = 40.59(1) Å, Z = 6), [Mo₃S₄(tdci)₃]Br₄·9.5EtOH·5H₂O (2a, triclinic, space group

Full-size image

and [CuBrMo₃S₄(tdci)₃]Br₃·11 H₂O·EtOH (3a, monoclinic, space group P2,/n, A = 14.887(3), B = 22.570(4), C = 21.974(5) Å, β = 98.54(2)°, Z = 4) revealed andN-N-O and an N-O-O coordination mode for taci and tdci, respectively. In 1a, taci is coordinated as an anion with deprotonated oxygen and nitrogen donors. In addition, the non-coordinating amino group reacted with one equivalent; of acetone, forming a Schiff base condensation product. For 2a, short Mo---O bonds and high pK_a values (compared to the aqua ion [Mo₃S₄(H₂O)₉]⁴⁺) indicate the formation of a zwitterionic form of the tdci ligand with coordinated alkoxo groups and peripheral dimethylammonium groups. No significant differences were found for the structural properties of the Mo-tdci fragment in 2a and 3a. The coordination modes of taci and tdci, as observed in the solid state, are in agreement with the previously reported solution structures, established by NMR spectroscopy. They are attributed to the specific steric requirements of the two ligands and to a pronounced preference of the [Mo₃(μS)₃(μ₃S)]⁴⁺ core to coordinate a nitrogen donor trans to μ₃S.     

X-ray crystal structure of Cu2(medpco-2H)Cl2, (medpco = N,N′-bis(2-N,N-dimethylaminoethyl)pyridine-2,6-dicarboxamide 1-oxide. Copper(II) complexes of a deprotonated binucleating pyridine N-oxide ligand

The X-ray structure is reported for the complex Cu₂(medpco-2H)Cl₂, (medpco = N,N′-bis-N,N-dimethylaminoethyl)pyridine-2,6-dicarboxamide 1-oxide. The complex is triclinic, , a=8.313(4), B=11.403(5), C=11.611(3) Å, =91.66(3), β=108.99(4), γ=109.60(3)° and Z=2. The deprotonated ligand (medpco-2H)²⁻ acts as a binulceating ligand, producing an N-oxide-bridged complex. Each copper in Cu₂(medpco-2H)Cl₂ is five-coordinate, being coordinated by a bridging N-oxide oxygen, a deprotonated amide nitrogen, a tertiary amine nitrogen and two bridging chlorides. The complex does not exhibit significant magnetic interaction, and this may be the result of distortion of the bridging geometry from planarity. A range of other, apparently N-oxide-bridged, complexes of the type Cu₂(medpco-2H)X₂ is reported. The complex Cu₂(medpco-2H)Br₂·H₂O is strongly antiferromagnetic, with magnetic data closely fitting the expected binuclear structure.     

A reversible NO complex of Fe(TIM): an S = 1/2FeNO nitrosyl

[Fe(TIM)(CH₃CN)₂](PF₆)₂ (1) (TIM = 2,3,9,10-tetramethyl-1,4,8,11-tetraazacyclodeca-1,3,8,10-tetraene) forms a complex with NO reversibly in CH₃CN (53±1% converted to the NO complex) or 60% CH₃OH/40% CH₃CN (81±1% conversion). Quantitative NO complexation occurs in H₂O or CH₃OH solvents. The EPR spectrum of [Fe(TIM)(solvent)NO]²⁺ in frozen 60/40 CH₃OH/CH₃CN at 77 K shows a three line feature at g=2.01, 1.99 and 1.97 of an S=1/2FeNO⁷ ground state. The middle line exhibits a three-line N-shf coupling of 24 G indicating a six-coordinate complex with either CH₃OH or CH₃CN as a ligand trans to NO. In H₂O [Fe(TIM)(H₂O)₂]²⁺ undergoes a slow decomposition, liberating 2,3-butanedione, as detected by ¹H NMR in D₂O, unless a π-acceptor axial ligand, L=CO, CH₃CN or NO is present. An equilibrium of 1 in water containing CH₃CN forms [Fe(TIM)(CH₃CN)(H₂O)]²⁺ which has a formation constant K_CH3CN=320 M⁻¹. In water K_NOK_CH3CN since NO completely displaces CH₃CN. [Fe(TIM)(CH₃CN)₂]²⁺ binds either CO or NO in CH₃CN with K_NO/K_CO=0.46, sigificantly lower than the ratio for [Fe^II(hemes)] of 1100 in various media. A steric influence due to bumping of β-CH₂ protons of the TIM macrocycle with a bent S=1/2 nitrosyl as opposed to much lessened steric factors for the linear Fe---CO unit is proposed to explain the lower K_NO/K_CO ratio for the [Fe(TIM)(CH₃CN)]²⁺ adducts of NO or CO. Estimates for formation constants with [Fe(TIM)]²⁺ in CH₃CN of K_NO=80.1 M⁻¹ and K_CO=173 M⁻ are much lower than to hemoglobin (where K_NO=2.5×10¹⁰ M⁻¹ and K_CO=2.3×10⁷) due to a reversal of steric factors and stronger π-backdonation from [Fe^II(heme)] than from [Fe^II(TIM)(CH₃CN)]²⁺.     

Studies of the cation complexing ability of crowns Part I. Synthesis, characterization and crystal structure of diazacrowns and their barium complexes

A number of N,N′-bis(4-substituted phenyl)-1,7-diaza-12-crown-4 and N,N′-bis(4-substituted phenyl)-1, 10-diaza-18-crown-6 (where the substituents are OCH₃, CH₃, H, Cl, respectively) have been prepared by cyclization reaction of a ditosylate with the appropriately substituted diol. These new macrocyclic ligands have been characterized by means of elemental analysis, IR, ¹H NMR and MS spectra. The crystal structures of N,N′-bis(4-chlorophenyl)-1,10-diaza-18-crown-6 (21) and its complex with barium thiocyanate Ba(SCN)₂ (22) have been determined by single crystal X-ray diffraction. The crystallographic data are as follows: 21: C₂₄H₃₂Cl₂N₂O₄, orthorhombic, P2₁2₁2₁, A=4.852(1), B=11.989(2), C=41.231(8) Å, V=2398.7(8) ų, Z=4; 22: C₂₆H₃₂Cl₂N₄O₄S₂Ba, monoclinic, P2₁/c, A=8.801(2), B=11.653(9), C=15.756(6) Å, ß=105.96(3)°, V=1553.7(14) ų, Z=2. In the complex, the Ba atom is eight-coordinate (O(1), O(2), O(1)′, O(2)′, N(1), N(1)′, N(21), N(21)′) to form a distorted D_6h geometry with the Ba atom at the center of crystallographic symmetry.     

Syntheses and structures of palladium(II) and platinum(II) complexes with tridentate (Ph2PCH2CH2CH2)2S and its arsenic analogue

A series of square-planar complexes [MLCl]ClO₄ (M = Pd(II), Pt(II); L = bis(3-(diphenylphosphino)propyl)sulfide (psp), bis(3-(diphenylarsino)propyl)sulfide (asa)) have been prepared and characterized. The X-ray crystal structures of two of them have been determined: [Pd(psp)Cl]ClO₄, P2₁/c, A = 12.519(2), B = 15.766(2), C = 16.501(2) Å, β = 105.22(1)°, Z = 4; and [Pt(asa)Cl]ClO₄, P2₁/c, a = 12.583(5), B = 16.007(6), C = 16.549(6) Å, β = 104.89(3)°, Z = 4. In both structures, there is a conformational disorder between the chair and skew-boat orientation in one of the two six-membered chelate rings. The C---H…O hydrogen bond between the hybrid ligand and the perchlorate counter ion that induces the conformational disorder is discussed.     

Convenient preparation of [CuX(PCy3)2](X = Br, I, SCN, N3) complexes. X-ray crystal structure of [Cu(N3)(PCy3)2] (Cy = cyclo-C6H11)

The labile cations [Cu(F-BF₃)(PCy₃)₂] and [Cu(OTf)(PCy₃)₂] are versatile precursors for the formation of [Cu(X)(PCy₃)₂] (X = Br, I, SCN, N₃) complexes by metathesis with NaX. The azide [Cu(N₃)(PCy₃)₂] is triclinic, space group , a = 9.755(4), B = 22.78(1), C = 9.284(6) Å, = 96.76(3), β = 115.36(3), γ = 94.20(5)°, Z = 2.     

Pyrazolonato complexes of lead. Crystal structures of bis(1-phenyl-3-methyl-4-acetyl pyrazolonato)lead(II) and bis(1-phenyl-3-methyl-4-butanoylpyrazolonato)lead(II)

The structures of the complexes [PbL₂], L = 1-phenyl-3-methyl-4-acylpyrazolonato, RCOC₁₀H₈N₂O, R = Me (2) or Pr (3), have been determined by X-ray diffraction studies. Compound 2 is monoclinic, space group P2₁, A = 11.285(4), B = 14.727(4), C = 20.749(5) Å, β = 95.83(3)°, R = 0.039 for 4486 reflections, and 3 is monoclinic, space group C2/c, A = 27.528(11), B = 7.245(11), C = 14.264(7) Å, β = 113.6(3)°, R = 0.021 for 2118 reflections. There are three different lead environments in 2 but only one in 3. In each case the lead atom makes four strong bonds to oxygen and two weaker bonds to either oxygen or nitrogen in adjacent molecules.