Chicken liver basic fatty acid-binding protein (pI = 9.0). Purification, crystallization and preliminary X-ray data

Chicken liver basic fatty acid-binding protein (pI = 9.0) has been purified with a high yield by a modification of a method originally applied to rat liver. The final product is highly homogeneous and can be used to grow crystals that belong to two different space groups. The crystals are either tetragonal, space group P4₂2₁2 with a = b = 60.2 Å and c = 138.1 Å or orthorhombic, space group P2₁2₁2₁ with a = 60.7 Å, b = 40.1 Å and c = 66.7 Å. The second form appears to be more suitable for X-ray diffraction studies, it diffracts to at least 2.8 Å resolution and it is believed to contain one protein molecule in the crystallographic asymmetric unit.     

Chemical synthesis of an artificial antigen containing the trisaccharide hapten of Mycobacterium leprae

The crystal and the molecular structure of 4,1′,6′-trichloro-4,1′,6′-trideoxy-galacto-sucrose (TGS) was determined by X-ray analysis at 294 K. Crystals of TGS are orthorhombic, space group P2₁2₁2₁, with a = 7.318(3), b = 12.027(4), c = 18.136(5) Å, V = 1596(1) ų, Z = 4; D_x = 1.655 g.cm^-3, λ(MoK) = 0.71073 Å, μ(MoK) = 5.44 cm^-1, F(000) = 816. The X-ray intensities of 2649 reflections with I 2.5σ(I) were measured with Zr-filtered MoK-radiation. The structure was solved by the Patterson procedure and refined by full-matrix least-squares to a final R-value of 0.0298. Large conformational differences between TGS and sucrose were observed, particularly in the conformation of the glycosidic linkage. These differences originate from chlorine substitution, which affects intramolecular hydrogen bonding and sweet-taste glucophores.     

Synthesis of one dimensional tin selenides in supercritical amines

Three new crystalline tin selenide salts have been prepared from the reactions of [PPh₄]₂[Sn(Se₄₃] in supercritical solvents. The starting material pyrolyzes in supercritical acetonitrile to form [PPh₄]₄[Sn₆Se₂₁] (I), and it also reacts with SnSe in supercritical ammonia leading to a mixture of [PPh₄]₄[Sn₃Se₁₁]₂ (II). and [PPh₄]₂[Sn(Se₄)(Se₆)₂] (III). All three compounds have been characterized by single crystal X-ray diffraction. Crystallographic data: for I, C₉₆H₉₀P₄Se₂₁Sn₆, space group triclinic, P-1, A = 18.763(3), B = 24.600(4), C = 13.137(1) Å, = 102.63(1), β = 93.66(1), γ = 108.72(1)°, V = 5544(1) ų, Z = 2, R = 0.0350, R_W = 0.0317: for II, C₉₆H₈₀P₄Se₂₂Sn₆, space group monoclinic P2₁/c, A = 31.500(4), B = 16.572(3), C = 22.352(3) Å, β = 103.53(1)°, V = 11344(3) ų, Z = 4, R = 0.0771, R_W = 0.0664: for III, C₄₈H₄₀P₂Se₁₆Sn, space group monoclinic, C2/c, A = 25.381(2), B = 13.934(4), C = 19.465(3) Å, β = 121.587(8)°, V = 5867(2) ų, Z = 4, R = 0.0807, R_W = 0.0650. One of the compounds, [PPh₄]₂[Sn(Se₄(Se₆₂], is a molecular cluster while the other two complexes [PPh₄]₄[Sn₃Se₁₁]₂ and [PPh₄]₄[Sn₆Se₂₁], are one dimensional tin selenide chains. The structures of the two chains are related and consits of tetrahedral and distorted trigonal bipyramidal tin(IV) centers bridged by Se²⁻, Se₂²⁻ and Se₃²⁻ chains.     

Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

Crystal growth in aqueous hydrofluoric acid and (HF)x · pyridine solutions: syntheses and crystal structures of [Ni(H2O)6][MF6] (M = Ti, Zr, Hf) and Ni3(py)12F6 · 7H2O

The syntheses and structures of [Ni(H₂O)₆]²⁺[MF₆]²⁻ (M = Ti,Zr,Hf) and Ni₃(py)₁₂F₆·7H₂O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group (No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) ų for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) ų for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)ų for Hf. The structures consist of discrete [Ni(H₂O)₆]²⁺ and [MF₆]²⁻ octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni₃(py)₁₂F₆·7H₂O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) ų. The structure consists of discrete Ni(py)₄F₂ octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)_x·pyridine/pyridine/water solution.     

Application of the hydro(solvo)thermal technique to the synthesis of metal carbonyl chalcogenide clusters Part 3. Synthesis, structural characterization, and spectroscopic studies of the clusters [{M(CO)4}n(MS4)] (M = Mo, W; N=1, 2)

The methanothermal reactions of M(CO)₆ (M = Mo, W) with Na₂S₂ gave a series of homonuclear clusters [{M(CO)₄}_n(MS₄)]²⁻ (M=Mo, W; N=1, 2), i.e. (Ph₄P)₂[(CO)₄Mo(MoS₄)] (I), (Ph₄P)₂[(CO)₄W(WS₄)] (II), (Ph₄P)₂[(CO)₄Mo(MoS₄)Mo(CO)₄] (III) and (Ph₄P)₂[(CO)₄W(WS₄)W(CO)₄] (IV). The two dimers, I and II, as well as the two trimers, III and IV, are isostructural to each other, respectively. All compounds crystallize in the triclinic space group with Z=2. The cell dimensions are: a=12.393(8), b=19.303(9), c=11.909(6) Å, =102.39(5), β=111.54(5), γ=73.61(5)°, V=2522(3) ų at T=23 °C for I; a=12.390(3), b=19.314(4), c=11.866(2) Å, =102.66(2), β=111.49(1), γ=73.40(2)°, V=2511(1) ų at T=23 °C for II; a=11.416(3), b=22.524(4), c=10.815(4) Å, =91.03(2), β=100.57(3), γ=88.96(2)°, V=2733(1) ų at T=−100 °C for III, a=11.498(1), b=22.600(4), c=10.864(3) Å, =90.92(2), β=100.85(1), γ=88.58(1)°, V=2771(2) ų at T=23 °C for IV. The dimers are each formed by the coordination of the tetrathiometalate as a bidentate chelating ligand to an M(CO)₄ fragment while addition of another M(CO)₄ fragment to the dimers results in the trimers. All compounds contain both tetrahedral and octahedral metal centers with the formal 6+ and 0 oxidation states, respectively.     

Studies of the cation complexing ability of crowns Part I. Synthesis, characterization and crystal structure of diazacrowns and their barium complexes

A number of N,N′-bis(4-substituted phenyl)-1,7-diaza-12-crown-4 and N,N′-bis(4-substituted phenyl)-1, 10-diaza-18-crown-6 (where the substituents are OCH₃, CH₃, H, Cl, respectively) have been prepared by cyclization reaction of a ditosylate with the appropriately substituted diol. These new macrocyclic ligands have been characterized by means of elemental analysis, IR, ¹H NMR and MS spectra. The crystal structures of N,N′-bis(4-chlorophenyl)-1,10-diaza-18-crown-6 (21) and its complex with barium thiocyanate Ba(SCN)₂ (22) have been determined by single crystal X-ray diffraction. The crystallographic data are as follows: 21: C₂₄H₃₂Cl₂N₂O₄, orthorhombic, P2₁2₁2₁, A=4.852(1), B=11.989(2), C=41.231(8) Å, V=2398.7(8) ų, Z=4; 22: C₂₆H₃₂Cl₂N₄O₄S₂Ba, monoclinic, P2₁/c, A=8.801(2), B=11.653(9), C=15.756(6) Å, ß=105.96(3)°, V=1553.7(14) ų, Z=2. In the complex, the Ba atom is eight-coordinate (O(1), O(2), O(1)′, O(2)′, N(1), N(1)′, N(21), N(21)′) to form a distorted D_6h geometry with the Ba atom at the center of crystallographic symmetry.     

Detailed refinement of the crystal structure of tri-O-ethylamylose (TEA 1)

The crystal structure of tri-O-ethylamylose has been solved by stereochemical conformation and packing analysis and by X-ray fibre diagram analysis. The unit cell is orthorhombic, space group P2₁2₁2₁, with = 16.13 (± 0.04) Å, b = 11.66 (± 0.02) Å, and c (fibre repeat) = 15.48 (± 0.02) Å. Density measurements, together with the observation of only a fourth-order meridional reflection, indicated that portions of two four-fold helices pass through the unit cell. The actual chain conformation is that of a 4₃ helix with the EtO-6 group in the tg (trans to O-5, and gauche to C-4) position. The tri-O-ethylamylose structure is compared with those of other amylose derivatives.     

Molecular structures and some properties of tris(2-aminoethyl) amine cobalt(III) complexes with thiocarboxylato-O,S such as 3-mercaptopropionato, 2-mercaptoacetato and their derivatives

Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]⁺ (2), t-[Co(mtp)(tren)]²⁺ (1Me) and t-[Co(mta)(tren)]²⁺ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO₄ (1CIO₄): monoclinic, P2₁/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) ų, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H₂O (2Cl·3H₂O): monoclinic, P2₁/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) ų, Z = 4 and R = 0.066; (+)₄₆₅^CD-t-[Co(mtp)(tren)](ClO₄)₂ ((+)₄₆₅^CD-1Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) ų, Z = 4 and R = 0.068; (+)₄₆₅^CD-t-[Co(mta)(tren)](ClO₄)₂ ((+)₄₆₅^CD-2Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) ų, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)₄₆₅^CD-1Me is the S configuration and that in (+)₄₆₅^CD-2Me is the R one. The ¹H NMR, ¹³C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries.     

Synthesis and problematic crystal structures of [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta, Nb or Sb)

Compounds of formula [Al(CH₃CN)₆][MCl₆]₃(CH₃CN)₃ (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl₅ and AlCl₃ in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) ų and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) ų V = 1634.8(4) ų and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) ų and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation.     

The ReH6[P(C6H5)3]2 ion as a ligand: complexes with M(CO)3 fragments (M = Cr, Mo, W)

The reactions of [(H₅C₆)₃P]₂ReH₆⁻ with (CH₃CN)₃Cr(CO)₃, (diglyme)Mo(CO)₃ or (C₃H₇CN)₃W(CO)₃ led to the formation of [(H₅C₆)₃P]₂ReH₆M(CO)₃⁻ (M = Cr, Mo, W) complexes. These have been characterized by IR and NMR spectroscopies, as well as elemental analyses. A single crystal X-ray diffraction study has also been carried out for the M = Cr complex as a K(18-crown-6)⁺ salt. The complex crystallizes as a THF monosolvate in the monoclinic space group P2₁/n with a = 22.323(6), B = 9.523(2), C = 27.502(5) Å, β = 104.98(2)⁰ and V = 5648 ų for Z = 4. The Re---Cr separation is 2.5745(12) Å, and the two phosphine ligands are oriented unsymmetrically. Although the hydride ligands were not found, the presence of three bridging hydrides and a dodecahedral coordination geometry about rhenium could be inferred. Low temperature ¹H and ³¹P NMR spectroscopic studies did not reveal the low symmetry of the solid state structure.     

The synthesis and reactions of A-ring aromatic steroid complexes of manganese tricarbonyl

Treatment of the A-ring aromatic steroids estrone 3-methyl ether and β-estradiol 3, 17-dimethyl ether with Mn(CO)₅⁺BF₄⁻ in CH₂Cl₂ yields the corresponding [(steroid)Mn(CO)₃]BF₄ salts 1 and 2 as mixtures of and β isomers. The X-ray structure of [(estrone 3-methyl ether)Mn(CO)₃]BF₄ · CH₂Cl₂ (1) having the Mn(CO)₃ moiety on the side of the steroid is reported: space group P2₁ with a=10.3958(9), b=10.9020(6), c=12.6848(9) Å, β=111.857(6)°, Z=2, V=1334.3(2) ų, _calc=.481 cm⁻³, R=0.0508, and wR=0.0635. The molecule has the traditional ‘piano stool’ structure with a planar arene ring and linear Mn---C---O linkages. The nucleophiles NaBH₄ and LiCH₂C(O)CMe₃ add to [(β-estradiol 3,17-dimethyl ether)Mn(CO)₃]BF₄ (2) in high yield to give the corresponding - and β-cyclohexadienyl manganese tricarbonyl complexes (3). The nucleophiles add meta to the arene -OMe substituent and exo to the metal. The and β isomers of 3 were separated by fractional crystallization and the X-ray structure of the β isomer with an exo-CH₂C(O)CMe₃ substituent is reported (complex 4): space group P2₁2₁2₁ with a=7.5154(8), b=15.160(2), c=25.230(3) Å, Z=4, V=2874.4(5) ų, _calc=1.244 g cm⁻³, R=0.0529 and wR2=0.1176. The molecule 4 has a planar set of dienyl carbon atoms with the saturated C(1) carbon being 0.592 Å out of the plane away from the metal. The results suggest that the manganese-mediated functionalization of aromatic steroids is a viable synthetic procedure with a range of nucleophiles of varying strengths.     

Dirhodium(II) tetrakis[N,N-dimethyl-2-pyrrolidone-5(S)-carboxamide]. Structural effects on enantioselection in metal carbene transformations

The preparation and structural characterization of dirhodium(II) tetrakis[N,N-dimethyl-2-pyrrolidone-5(S)-carb- oxamide], Rh₂(5S-DMAP)₄, a new sterically-demanding catalyst for enantioselective metal carbene transformations, is described. The pyrrolidone ligands are arrayed around the dirhodium(II) core with two oxygen and two nitrogen donor atoms, each oriented cis, bound to each octahedral rhodium. The crystal structure of this compound has been determined to be that of Rh₂(5S-DMAP)₄(CH₃CN)₂·CH₃CN·6H₂O: space group P2₁2₁2₁ with cell constants a= 12.685(4), b=15.050(3), c=24.035(4) Å; V=4588.5(1.9) ų, Z=4, R=0.0316, Rh---Rh DISTANCE =2 4538(5) Å. Decreased activity for diazodecomposition catalyzed by Rh₂(5S-DMAP)₄ is observed, and enantiocontrol for cyclopropanation and carbon-hydrogen insertion is lower than expected by analogy to the corresponding di- rhodium(II) tetrakis[methyl 2-pyrrolidone-5(S)-carboxylate], Rh₂(5S-MEPY)₄ Electronic stabilization of the in- termediate metal carbene is absent in reactions catalyzed by Rh₂(5S-DMAP)₄.     

The synthesis and structural characterization of carborane oligomers connected by carbon-carbon and carbon-boron bonds between icosahedra

The reaction of dilithiated o-carborane (closo-1,2-Li₂-1,2-C₂B₁₀H₁₀) with CuCl₂ gives 1,1′-bis(o-carborane) (1), 1,3′-bis(o-carborane) (2) and 1,4′-bis(o-carborane) (3). Compound 2 (C₄B₂₀H₂₂) crystallizes in the monoclinic space group P2₁/n with A = 6.9275(6), B = 9.7655(8), C = 12.356(1) Å, β = 90.028(2)° and Z = 2. The structure was solved by direct methods and refined to R = 0.048 and R_w = 0.074. Compound 3 (C₄B₂₀H₂₂) crystallizes in the orthorhombic space group P2₁2₁2₁ with A = 6.8854(5), B = 12.523(1), C = 19.847(1) Å and Z = 4. The structure was solved by direct methods and refined to R = 0.078 and R_w = 0.091. The coupling reaction of dilithiated m-carborane (closo-1,7-Li₂-1,7-C₂B₁₀H₁₀) with CuCl₂ results in the formation of 1,1′-bis(m-carborane) (4) and tetra(m-carborane) (5).     

Correlation of structure and emission in solid state copper(I) complexes; [Cu4I4(CH3CN)2(L)2], L = aniline derivative

Four complexes of the type [Cu₄I₄(CH₃CN)₂(L)₂], L = aniline derivative: Cu₄I₄(CH₃CN)₂(2,6-dimethylaniline)₂ (I), triclinic, , a = 12.449(3), B = 14.108(6), C = 10.606(4) Å, = 73.46(3), β = 95.00(2), γ = 73.42(3)°, V = 1682.3(10) ų; Cu₄I₄(CH₃CN)₂(o-ethylaniline)₂ (II), triclinic,

Full-size image

, V = 1734.0(8) ų; Cu₄I₄(CH₃CN)₂(6-ethyl-o-toluidine)₂ (III), orthorhombic, Pnam, a = 14.976(6), b = 21.187(6), C = 12.545(2) Å, V = 3980.7(2) ų; Cu₄I₄(CH₃CN)₂(p-anisidine)₂ (IV), monoclinic, A2/a, A = 20.032(10), B = 7.863(1), C = 18.715(9) Å, β = 101.56(4)°, V = 2888.0(2) ų; were examined by single crystal X-ray diffraction. Complexes I and II have no internal symmetry elements, III has an internal mirror and IV has a two-fold axis. Ab initio calculations based on the atomic positional parameters of complexes containing the three types of symmetry elements reveal HOMO orbitals to be dominated by the p orbitals of the iodine atoms whereas the LUMO orbitals contain major contributions from copper based p orbitals.     

Heterobimetallic aggregates of copper(I) with thiotungstates and thiomolybdates. Synthesis and characterization of polymeric (NEt4)3[Cu4(NCS)5WS4], (NEt4)2[(CuNCS)3WS4] and (NEt4)2[(CuNCS)4WS4], M = Mo, W

Reaction of (NEt₄)₂MS₄ (M = Mo, W) with CuCl and KSCN (or NH₄SCN) in acetone or acetonitrile affords a new set of mixed metal–sulfur compounds: infinite anionic chains Cu₄(NCS)₅MS_4³⁻ (1,2), (CuNCS)₃WS_4²⁻ (3) and two dimensional polymeric dianions (CuNCS)₄MS_4²⁻ (4,5). Crystal of 1 (M = W) and 3 are triclinic, space group P1(1:a = 10.356(2),b = 15.039(1),c = 17.356(2)Å, = 78.27(1)°, β = 88.89(2)° and γ = 88.60(1)°,Z = 2,R = 0.04 for 3915 independent data;3:a = 8.449(2),b = 14.622(4),c = 15.809(8)Å, = 61.84(3)°, β = 73.67(3)° and γ = 78.23(2)°,Z = 2,R = 0.029 for 6585 independent data). Crystals of 4 (M = W) and 5 (M = Mo) are monoclinic, space group P2₁/m,Z = 2 (4:a = 12.296(4),b = 14.794(4),c = 10.260(3)Åand β = 101.88(3)°,R = 0.034 for 4450 independent data;5:a = 12.306(2),b = 14.809(3),c = 10.257(2)Åand β = 101.99(3)°,R = 0.043 for 3078 independent data). The crystal structure determinations of 4 and 5 show that four edges of the tetrahedral MS_4²⁻ core are coordinated by copper atoms forming WS₄Cu₄ aggregates linked by eight-membered Cu(NCS)₂Cu rings. A two-dimensional network is thus formed in the diagonal (101) plane. The space between the anionic two-dimensional networks is filled with the NEt_4⁺ cations. Additional NCS groups lead to the [Cu₄(NCS)₅WS₄]³⁻ (1) trianion connected by NCS bridges forming pseudo-dimers. These latter are held together by weak CuS(NCS) interactions giving rise to infinite chains along a direction parallel to [100]. In contrast complex3 develops infinite chains from WS₄Cu₃ aggregates with the same Cu(NCS)₂Cu bridges as in 4 and 5. These chains are running along a direction parallel to [010]. The structural data of the different types of polymeric compounds containing MS_4²⁻ and CuNCS have been used to interpret vibrational spectroscopic data of the thiocyanate groups.     

Mixed anion lanthanide(III) crown ether complexes: crystal structures of [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4-(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]

Reaction of LaCl₃·7H₂O containing small amounts of La(NO₃)₃·7H₂O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH₃CN:CH₃OH resulted in the isolation of the mixed anion complexes [LaCl₂(NO₃)(12-crown-4)]₂, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN and [LaCl₂(NO₃)(18-crown-6)]. The nine-coordinate dimer, [LaCl₂(NO₃)(12-crown-4)]₂, has all of the anions in the inner coordination sphere and La³⁺ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and D_calc = 2.08 g cm⁻³ for Z = 4. The second complex isolated from the same reaction, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P2₁ with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and D_calc = 1.80 g cm⁻³ for Z = 2. The 18-crown-6 complex, [LaCl₂(NO₃)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La³⁺ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and D_calc = 1.89 g cm⁻³ for Z = 8.     

Crystal and molecular structure of μ-oxo-bis((5,10,15,20)tetrakispentafluorophenyl)porphinatoiron(III)

In this paper, we report the crystal and molecular structure of μ-oxo-bis(5,10,15,20)tetrakispentafluorophenyl)porphinatoiron(III) [(TPP(F₅)Fe)₂O]. The crystals belong to the tetragonal system, space group I4₁/a, with a =b = 26.362(7),c = 30.886(8)Å,V = 21465ų,Z = 8 and D_calc = 1.496. Discrepancy indices are R₁ = 0.084 and R₂ = 0.104 for 3320 reflections having I3σ(I). The FeN_p average distance, 2.088(11)Å, is at the long end of the range of high-spin ferric porphyrin while the FeO distances (1.775(1)Å) are similar to those of the non-halogenated analog (TPPFe)₂O. The FeOFe angle of 178.4(5)° shows an essentially linear oxo bridge. The 0.673(2)Ådisplacement of the iron atom from the porphyrin mean plane is unusually large. The facing porphyrin rings are twisted 47° with respect of each other giving the molecule nearly exact D_4d symmetry.     

Preparation and crystal structure of trans-dihydroxo-[tetrakis(2,6-dichlorophenyl)porphinato]ruthenium(IV)·2toluene

Trans-dihydroxo-[tetrakis(2,6-dichlorophenyl)porphinato]ruthenium(IV) ([Ru(OH)₂(TDCPP)]) was prepared by meta-chloroperbenzoic acid oxidation of [Ru(CO)(TDCPP)] in dichloromethane-toluene, and its crystal structure is reported. Crystal data for [Ru(OH)₂(TDCPP)]·2toluene:C₄₄H₂₂N₄O₂Cl₈Ru·2C₇H₈, orthorhombic, space group Pbca a = 13.149(1), B = 19.893(2), C = 21.093(2)Å, U = 55.17.3(2) ų, Z = 4. The short axial Ru---O bond distance, 1.790(7) Å, is in the range expected for a double Ru(IV)-oxygen bond. Both hydroxo ligands are approximately located in the mean plane of two opposite dichlorophenyl groups. Full-matrix least-squares refinement of positional and thermal parameters, using 2368 unique reflections with F > 2.5 σ (F) led to R(F) = 0.063; R_w = 0.066.     

Synthesis and characterization of organomolybdenum and organotungsten halides containing the η-pentabenzylcyyclopentadienyl ligand η-Bz5C5M(CO)3X (M = Mo, W; X = Cl, Br, I). The X-ray molecular structure of η-Bz5C5Mo(CO)3I

An improved synthetic procedure for pentabenzylcyclopentadiene Bz₅C₅H was developed. Six new organomolybdenum and organotungsten halides η⁵-Bz₅C₅M(CO)₃X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η⁵-Bz₅C₅M(CO)₃Li (derived from Bz₅C₅H, n-BuLi and M(CO)₆) with PCl₃, PBr₃ or I₂ and characterized by elemental analysis, IR and ¹H NMR spectroscopy. The structure of η⁵-Bz₅C₅Mo(CO)₃I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) ų, Z = 4 and D_x = 1.50 g cm⁻³. The final R value was 0.035 for 4564 observed reflections.