Isolation and characterization of an ornithine-containing lipid from Desulfovibrio gigas. |
| |
Authors: | R A Makula and W R Finnerty |
| |
Abstract: | The isolation and characterization of an ornithine-containing lipid obtained from Desulfovibrio gigas are reported. The general structure for this aminolipid is represented by NH2-CH2-(CH)2-CHNH(CO-CH2CH(O-COR2)-R1)-COOH, where R1 represents 3-hydroxy palmitate linked through an amide bond to the alpha-amino group of ornithine, and R2 represents a complex variety of fatty acids esterified to the hydroxyl group of 3-hydroxy palmitate. Fatty acids characterized were n-C14:0 (21%), iso-C14:0 (14%) anteiso-C15:0 (43%), n-C16:0 (2%), n-C18:0 (8%), and n-C 18:1 (11%). The quantitative relationships between aminolipid and phospholipids showed the aminolipid to represent the major polar lipid. Isolation of the cytoplasmic and outer membranes of D. gigas showed the aminolipid to be evenly distributed between both membrane fractions, suggesting a compensatory role in phospholipid-deficient membranes. |
| |
Keywords: | |
|
|