Thermal and photochemical substitution reactions of CpRe(PPh3)2H2 and CpRe(PPh3)H4. Catalytic insertion of ethylene into the C-H bond of benzene

The thermal and photochemical reactions of CpRe(PPh₃)₂H₄ and CpRe(PPh₃)H₄ (Cp = η⁵-C₅H₅) with PMe₃, P(p-tolyl)₃, PMe₂Ph, DMPE, DPPE, DPPM, CO, 2,6-xylylisocyanide and ethylene have been examined. While CpRe(PPh₃)₂H₂ is thermally inert, it will undergo photochemical substitution of one or two PPh₃ ligands. With ethylene, substitution is followed by insertion of the olefin into the C-H bond of benzene, giving ethylbenzene. CpRe(PPh₃)H₄ undergoes thermal loss of PPh₃, which leads to substituted products of the type CpRe(L) H₄. Photochemically, reductive elimination of dihydrogen occurs preferentially. The complex trans-CpRe(DMPE)H₂ was structurally characterized, crystallizing in the monoclinic space group P2₁/n (No. 14) with a = 6.249(6), b = 16.671(8), c = 13.867(7) Å, β = 92.11(6)°, V = 1443.7(2.9) Å and Z = 4. The complex trans-CpRe(PMe₂Ph)₂H₂ was structurally characterized, crystallizing in the monoclinic space group P2₁/n (No. 14) with a = 7.467(3), b = 23.874(14), c = 11.798(6) Å, β = 100.16(4)°, V = 2070.2(3.4) ų and Z = 4.     

The propensity of alkoxide and aryloxide derivatives of tungsten carbonyls to aggregate in solution. Synthesis and X-ray structures of dinuclear, trinuclear and tetranuclear complexes derived from the MeOW(CO)5 anion

The complex [Et₄N][W(CO)₅OMe] (1) has been prepared from the reaction of the photochemically generated W(CO)₅THF adduct and [Et₄N][OH] in methanol. Complex 1 was shown to undergo rapid CO dissociation in THF to quantitatively provide the dimeric dianion, [W(CO)₄OMe]₂²⁻. The resulting THF insoluble salt [Et₄N]₂[W(CO)₄OMe]₂ (2) has been structurally characterized by X-ray crystallography, with the doubly bridging methoxide ligands being in an anti configuration. Complex 2 was found to subsequently react with excess methoxide ligand in a THF slurry to afford the face-sharing octahedron complex [Et₄N]₃[W₂(CO)₆(OMe)₃] (3) which contains three doubly bridging methoxide groups. In the absence of excess methoxide ligand complex 2 cleanly yields the tetrameric complex [Et₄N]₄[W(CO)₃OMe]₄ (4) which has been structurally characterized as a cubane-like arrangement with triply bridging μ³-methoxide groups and W(CO)₃ units. Although complex 3 was not characterized in the solid state, the closely related glycolate derivative [Et₄N]₃[W₂(CO)₆(OCH₂CH₂OH)₃] (5) was synthesized and its structure determined by X-ray crystallography. The trianions of complex 5 are linked in the crystal lattice by strong intermolecular hydrogen bonds. Crystal data for 2: space group P2₁/n, a = 7.696(2), b = 22.019(4), c = 9.714(2) Å, β = 92.22(3)°, Z = 4, R = 6.43%. Crystal data for 4: space group Fddd, a = 12.433(9), b = 24.01(2), c = 39.29(3) Å, Z = 8, R = 8.13%. Crystal data for 5: space group P2₁2₁2₁, a = 11.43(2), b = 12.91(1), c = 29.85(6) Å, Z = 8, R = 8.29%. Finally, the rate of CO ligand dissociation in the closely related aryloxide derivatives [Et₄N][W(CO)₅OR] (R = C₆H₅ and 3,5-F₂C₆H₃) were measured to be 2.15 × 10⁻² and 1.31 × 10⁻³ s⁻¹, respectively, in THF solution at 5°C. Hence, the value of the rate constant of 2.15 × 10⁻² s⁻¹ establishes a lower limit for the first-order rate constant for CO loss in the W(CO)₅OMe⁻ anion, since the methoxide ligand is a better π-donating group than phenoxide.     

Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

The coordination chemistry of cationic main group clusters: syntheses and structures of [Fe3(Se2)2(CO)10] and [Fe4(Se2)3(CO)12]

The reactions of the polysulfur and selenium cationic clusters S₈²⁺ and Se₈²⁺ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF₆⁻ as a counterion, the cluster [Fe₃(E₂)₂(CO)₁₀] [SbF₆]₂·SO₂ (E = S, Se) could be isolated from the reaction of E₈²⁺ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se₂ groups, with the whole fragment capped by an Fe(CO)₄ group. Crystallographic data for C₁₀O₁₂Fe₃Se₄Sb₂F₁₂S (I): space group monoclinic P2₁/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) ų, Z = 4, R = 0.0426, R_w = 0.0503. When Sb₂F₁₁⁻ is present as the counterion, or Se₄[Sb₂F₁₁]₂ is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe₄(Se₂)₃(CO)₁₂] [SbF₆]₂·3SO₂. The dication contains two Fe₂Se₂ fragments bridged by an Se₂ group. Crystallographic data for C₁₂O₁₈Fe₄Se₆Sb₂F₁₂S₃ (III): space group triclinic , b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) ų, Z = 2, R = 0.0328, R_w = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO₂ when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated.     

Nitrogen atom transfer and redox chemistry of terpyridyl phosphoraniminato complexes of osmium (IV)

Rapid reactions occur between [Os^VI(tpy)(Cl)₂(N)]X (X = PF₆⁻, Cl⁻, tpy = 2,2′:6′,2″-terpyridine) and aryl or alkyl phosphi nes (PPh₃, PPh₂Me, PPhMe₂, PMe₃ and PEt₃) in CH₂Cl₂ or CH₃CN to give [Os^IV(tpy)(Cl)₂(NPPh₃)]⁺ and its analogs. The reaction between trans-[Os^VI(tpy)(Cl)₂(N)]⁺ and PPh₃ in CH₃CN occurs with a 1:1 stoichiometry and a rate law first order in both PPh₃ and Os^VI with k(CH₃CN, 25°C) = 1.36 ± 0.08 × 10⁴ M⁻ s⁻¹. The products are best formulated as paramagnetic d⁴ phosphoraniminato complexes of Os^IV based on a room temperature magnetic moment of 1.8 μ_B for trans-[Os^IV(tpy)(Cl)₂(NPPh₃)](PF₆), contact shifted ¹H NMR spectra and UV-Vis and near-IR spectra. In the crystal structures of trans-[Os^IV(tpy)(Cl)₂( NPPh₃)](PF₆)·CH₃CN (monoclinic, P2₁/n with a = 13.384(5) Å, b = 15.222(7) Å, c = 17.717(6) Å, β = 103.10(3)°, V = 3516(2) ų, Z = 4, R_w = 3.40, R_w = 3.50) and cis-[Os^IV(tpy)(Cl)₂(NPPh₂Me)]-(PF₆)·CH₃CN (monoclinic, P2₁/c, with a = 10.6348(2) Å, b = 15.146(9) ÅA, c = 20.876(6) Å, β = 97.47(1)°, V = 3334(2) ų, Z = 4, R = 4.00, R_w = 4.90), the long Os-N(P) bond lengths (2.093(5) and 2.061(6) Å), acute Os-N-P angles (132.4(3) and 132.2(4)°), and absence of a significant structural trans effect rule out significant Os-N multiple bonding. From cyclic voltammetric measurements, chemically reversible Os^V/IV and Os^IV/III couples occur for trans-[Os^IV(tpy)(Cl)₂(NPPh₃)](PF₆) in CH₃CN at +0.92 V (Os^V/IV) and −0.27 V (Os^IV/III) versus SSCE. Chemical or electrochemical reduction of trans-[Os^IV(tpy)(Cl)₂(NPPh₃)](PF₆) gives isolable trans-Os^III(tpy)(Cl)₂(NPPh₃). One-electron oxidation to Os^V followed by intermolecular disproportionation and PPh₃ group transfer gives [Os^VI(tpy)Cl₂(N)]⁺, [OS^III(tpy)(Cl)₂(CH₃CN)]⁺ and [Ph₃=N=PPh₃]⁺ (PPN⁺). trans-[Os^IV(tpy)(Cl)₂(NPPh₃)](PF₆) undergoes reaction with a second phosphine under reflux to give PPN⁺ derivatives and Os^II(tpy)(Cl)₂(CH₃CN) in CH₃CN or Os^II(tpy)(Cl)₂(PR₃) in CH₂Cl₂. This demonstrates that the Os^VI nitrido complex can undergo a net four-electron change by a combination of atom and group transfers.     

Synthesis and characterization of organomolybdenum and organotungsten halides containing the η-pentabenzylcyyclopentadienyl ligand η-Bz5C5M(CO)3X (M = Mo, W; X = Cl, Br, I). The X-ray molecular structure of η-Bz5C5Mo(CO)3I

An improved synthetic procedure for pentabenzylcyclopentadiene Bz₅C₅H was developed. Six new organomolybdenum and organotungsten halides η⁵-Bz₅C₅M(CO)₃X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η⁵-Bz₅C₅M(CO)₃Li (derived from Bz₅C₅H, n-BuLi and M(CO)₆) with PCl₃, PBr₃ or I₂ and characterized by elemental analysis, IR and ¹H NMR spectroscopy. The structure of η⁵-Bz₅C₅Mo(CO)₃I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) ų, Z = 4 and D_x = 1.50 g cm⁻³. The final R value was 0.035 for 4564 observed reflections.     

Syntheses and structures of palladium(II) and platinum(II) complexes with tridentate (Ph2PCH2CH2CH2)2S and its arsenic analogue

A series of square-planar complexes [MLCl]ClO₄ (M = Pd(II), Pt(II); L = bis(3-(diphenylphosphino)propyl)sulfide (psp), bis(3-(diphenylarsino)propyl)sulfide (asa)) have been prepared and characterized. The X-ray crystal structures of two of them have been determined: [Pd(psp)Cl]ClO₄, P2₁/c, A = 12.519(2), B = 15.766(2), C = 16.501(2) Å, β = 105.22(1)°, Z = 4; and [Pt(asa)Cl]ClO₄, P2₁/c, a = 12.583(5), B = 16.007(6), C = 16.549(6) Å, β = 104.89(3)°, Z = 4. In both structures, there is a conformational disorder between the chair and skew-boat orientation in one of the two six-membered chelate rings. The C---H…O hydrogen bond between the hybrid ligand and the perchlorate counter ion that induces the conformational disorder is discussed.     

Preparation of trimethylsilyl alkyne complexes of bis(pentamethylcyclopentadienyl)zirconium, (η-C5Me5)2Zr(RC≡CSiMe3), and their regioselective reactions with nitrous oxide

Benzene solutions of Cp^*₂ZrCl₂ (1) (Cp^* = η⁵-C₅Me₅) react with the alkynes Me₃SiC≡CPh, Me₃SiC≡C(c-C₅H₉) and Me₃SiC≡CCMe₃ in the presence of Na/Hg amalgam to afford high yields of the respective alkyne complexes Cp^*₂Zr(Me₃SiC≡CPh) (2), Cp^*₂Zr{Me₃SiC≡C(c-C₅H₉)} (3) and Cp^*₂Zr(Me₃SiC≡CCMe₃) (4) as crystalline compounds. Complex 2 crystallizes in the triclinic space group with a = 9.791(6), b = 10.466(6), c = 15.756(12) Å, = 86.09 (5), β = 72.09(5), γ = 72.06(4)° and Z = 2. The least-squares refinement converged to R(F) = 0.0604 and R(wF) = 0.0628 for the 3655 unique data with F_o > 4σ (F_o). Salient metrical parameters of the bound alkyne include the following: C(30)-C(31) = 1.340(9) Å; Zr-C(30) = 2.178(6) Å; Zr-C(31) = 2.219(5) Å; C(30)-C(31)-Si = 141.0(5)°; C(31)-C(30)-C(26) = 135.5(5)°. Nitrous oxide reacts with 2 or 3 to afford ((5) R = Ph; (6) R = c-C₅H₉) and 1 equiv. of N₂ via an intermediate, , which is unstable with respect to loss of dinitrogen to give the oxametallacyclobutene derivatives 5 and 6. The oxygen-atom insertion is regiospecific for the Zr-C bond that is attached to the carbyl (Ph or c-C₅H₉) substituent. Under similar conditions, complex 4, in which the alkyne is particularly labile, gives a myriad of products in its reaction with N₂O.     

A ferrocene-perfluoroarene molecular complex

Perfluorophenanthrene and decamethylferrocene cocrystallize as a molecular adduct in monoclinic space group P2₁/c with a = 8.842(2), b = 11.262(1), c = 30.695(8) Å, β = 95.89(2)°, V = 3040.3(8) ų, Z = 4. The structure was refined to R = 0.0537 for 1567 observed reflections. The perfluoroarene is twisted and chiral; the crystal is a racemate, however.     

Polynuclear copper(II) complexes with μ2-1,1-azide bridges. Structural and magnetic properties

Two novel, weakly antiferromagnetically coupled, tetranuclear copper(II) complexes [Cu₄(PAP)₂(μ₂-1,1-N₃)₂(μ₂-1,3-N₃)₂(μ₂-CH₃OH)₂(N₃)₄ (1) (PAP = 1,4-bis-(2′-pyridylamino)phthalazine) and [Cu₄(PAP3Me)₂ (μ₂-1,1-N₃)₂(μ₂-1,3-N₃)₂(H₂O)₂(NO₂)₂]- (NO₃)₂ (2) (PAP3Me = 1,4-bis-(3′-methyl-2′-pyridyl)aminophthalazine) contain a unique structural with two μ₂-1,1-azide intramolecular bridges, and two μ₂-1,3-azide intermolecular bridges linking pairs of copper(II) centers. Four terminal azide groups complete the five-coordinate structures in 1, while two terminal waters and two nitrates complete the coordination spheres in 2. The dinuclear complexes [Cu₂(PPD)(μ₂-1,1-N₃)(N₃)₂(CF₃SO₃)]CH₃OH) (3) and [Cu₂(PPD)(μ₂-1,1-N₃)(N₃)₂(H₂O)(ClO₄)] (4) (PPD = 3,6-bis-(1′-pyrazolyl)pyridazine) contain pairs of copper centers with intramolecular μ₂-1,1-azid and pyridazine bridges, and exhibit strong antiferromagnetic coupling. A one-dimensional chain structure in 3 occurs through intermolecular μ₂-1,1-azide bridging interactions. Intramolecular Cu-N₃-Cu bridge angles in 1 and 2 are small (107.9 and 109.4°, respectively), but very large in 3 and 4 (122.5 and 123.2°, respectively), in keeping with the magnetic properties. 2 crystallizes in the monoclinic system, space group C2/c with a = 26.71(1), b = 13.51(3), c = 16.84(1) Å, β = 117.35(3)° and R = 0.070, R_w = 0.050. 3 crystallizes in the monoclinic system, space group P2₁/c with a = 8.42(1), b = 20.808(9), c = 12.615(4) Å, β = 102.95(5)° and R = 0.045, R_w = 0.039. 4crystallizes in the triclinic system, space group P1, with a = 10.253(3), b = 12.338(5), c = 8.072(4) Å, = 100.65(4), β = 101.93(3), γ = 87.82(3)° and R = 0.038, R_w = 0.036 . The magnetic properties of 1 and 2 indicate the presence of weak net antiferromagnetic exchange, as indicated by the presence of a low temperature maximum in χ_m (80 K (1), 65 K (2)), but the data do not fit the Bleaney-Bowers equation unless the exchange integral is treated as a temperature dependent term. A similar situation has been observed for other related compounds, and various approaches to the problem will be discussed. Magnetically 3 and 4 are well described by the Bleaney-Bowers equation, exhibiting very strong antiferromagnetic exchange (− 2J = 768(24) cm⁻¹ (3); − 2J = 829(11) cm⁻¹ (4)).     

Eight-coordinate chelate complexes of zirconium(IV) and niobium(IV): X-ray diffractometric and EPR investigations

The N,N-diethylcarbamato derivative of zirconium(IV), Zr(O₂CNEt₂)₄ has been studied by X-ray crystallography. Crystal data: C₂₀H₄₀Na₄O₈Zr, monoclinic, space group C2/c, a = 14.057(1), b = 12.168(1), c = 16.746(2) Å, β = 108.071(4)°, Z = 4, D_c = 1.356, F(000) = 1168, T = 213 K. The compound is isotypic with the corresponding niobium(IV) derivative with a dodecahedral coordination at the zirconium atom. By reaction of NbCl₄(THF)₂ with Tl(hfacac), the hexafluoroacetylacetonato derivative of niobium (IV), Nb(hfacac)₄, has been prepared and structurally characterized. The compound crystallizes in the orthorhombic space group Pna2₁ with the following cell constants: a = 10.399(4), b = 15.852(9), c = 119.073(1) Å. It is not isotypic with the corresponding zirconium(IV) derivative, Zr(hfacac)₄. Crystal data: C₂₀H₄F₂₄O₈Zr, monoclinic, space group P2₁/n, a = 11.974(4), b = 20.451(6), c = 13.140(3) Å, β = 104.487(11)°, Z = 4, D_c = 1.960, F(000) = 1776, T = 223 K. Although in both compounds the central metal atom shows a square antiprismatic coordination, the coordination mode of the ligands is different and slight deviations from the D₄(llll) and C₂(llss) ideal geometries have been observed in the case of niobium and zirconium, respectively. An EPR study has been performed on the Nb(IV) derivatives as diluted solid solutions in frozen organic solvents or in the diamagnetic matrix of the corresponding zirconium(IV) compound. The EPR spectra have confirmed the presence of non-interacting paramagnets in the solid solutions and, in the case of Nb(O₂CNEt₂)₄, the point symmetry of the paramagnetic centre has been found to be in agreement with the results of the X-ray investigation. An EPR spectrum of rhombic symmetry has been observed for the hexafluoroacetylacetonato derivative of Nb(IV) when diluted in frozen THF solution or in Zr(hfacac)₄.     

Hydride complexes of platinum(II) containing unsymmetrical di(phosphine) ligands: synthesis, characterization and evidence for pairwise addition of hydrogen based on parahydrogen induced polarization

Unsymmetrical di(phosphine) ligands (dpp)₂Rop (1a, b = bis(diphenylphosphino)-2-alkyl-3-oxapropane (alkyl = methyl and ethyl)) and (dpp)₂oCy (1c = trans-2-diphenylphosphinocyclohexyl diphenylphosphinite) and their Pt(II) dichloride complexes, PtCl₂((dpp)₂mop) (2a), PtCl₂((dpp)₂eop) (2b) and PtCl₂((dpp)₂oCy) (2c), have been synthesized and characterized by NMR spectroscopy. The crystal structures of 2b and 2c show that the geometry about the platinum centers is square planar. In 2b, the metal and di(phosphine) ligand chelate ring are in a chair conformation, whereas in 2c, the chelate ring conformation is a skewed boat. Initial reaction of sodium borohydride with 2a, b, c yields the monohydride monochloride complexes PtHCl((dpp)₂mop) (5a), PtHCl((dpp)₂eop) (5b) and PtHCl((dpp)₂oCy) (5c). At longer reaction times, fluxional dimeric species are obtained, [PtH((dpp)₂mop)]₂ (4a), [PtH((dpp)₂eop)]₂ (4b) and [PtH((dpp)₂oCy)]₂ (4c),and in the case of 4c two different isomers exist. The dihydride complexes PtH₂((dpp)₂mop) (3a), PtH₂((dpp)₂eop) (3b) and PtH₂((dpp)₂oCy) (3c), are prepared by further reaction of NaBH₄ and 2. Hydrogen cycling is facile in the dihydride complexes 3a, b, c, and oxidative addition of H₂ proceeds in a pairwise manner as determined by the observation of parahydrogen induced polarization (PHIP) in the ¹H NMR spectra. The reductive elimination of H₂ is also shown to be concerted by reaction of dihydride complexes with D₂. Crystal data: 2b (C₃₀H₃₂Cl₆OP₂Pt), monoclinic, space group P2₁/c (No. 14), a = 13.7040(1), b = 11.3430(7), c = 21.3880(9) Å, β = 97.923(9)°, V = 3292.9(2) ų and Z = 4; 2c (C₃₀H₃₀Cl₂OP₂Pt), monoclinic, space group P2₁ (No. 4), a = 11.7360(2), b = 8.4311(2), c = 14.2789(2) Å, β = 101.290(1)°, V = 1385.52(4) ų and Z = 2.     

Heterobimetallic aggregates of copper(I) with thiotungstates and thiomolybdates. Synthesis and characterization of polymeric (NEt4)3[Cu4(NCS)5WS4], (NEt4)2[(CuNCS)3WS4] and (NEt4)2[(CuNCS)4WS4], M = Mo, W

Reaction of (NEt₄)₂MS₄ (M = Mo, W) with CuCl and KSCN (or NH₄SCN) in acetone or acetonitrile affords a new set of mixed metal–sulfur compounds: infinite anionic chains Cu₄(NCS)₅MS_4³⁻ (1,2), (CuNCS)₃WS_4²⁻ (3) and two dimensional polymeric dianions (CuNCS)₄MS_4²⁻ (4,5). Crystal of 1 (M = W) and 3 are triclinic, space group P1(1:a = 10.356(2),b = 15.039(1),c = 17.356(2)Å, = 78.27(1)°, β = 88.89(2)° and γ = 88.60(1)°,Z = 2,R = 0.04 for 3915 independent data;3:a = 8.449(2),b = 14.622(4),c = 15.809(8)Å, = 61.84(3)°, β = 73.67(3)° and γ = 78.23(2)°,Z = 2,R = 0.029 for 6585 independent data). Crystals of 4 (M = W) and 5 (M = Mo) are monoclinic, space group P2₁/m,Z = 2 (4:a = 12.296(4),b = 14.794(4),c = 10.260(3)Åand β = 101.88(3)°,R = 0.034 for 4450 independent data;5:a = 12.306(2),b = 14.809(3),c = 10.257(2)Åand β = 101.99(3)°,R = 0.043 for 3078 independent data). The crystal structure determinations of 4 and 5 show that four edges of the tetrahedral MS_4²⁻ core are coordinated by copper atoms forming WS₄Cu₄ aggregates linked by eight-membered Cu(NCS)₂Cu rings. A two-dimensional network is thus formed in the diagonal (101) plane. The space between the anionic two-dimensional networks is filled with the NEt_4⁺ cations. Additional NCS groups lead to the [Cu₄(NCS)₅WS₄]³⁻ (1) trianion connected by NCS bridges forming pseudo-dimers. These latter are held together by weak CuS(NCS) interactions giving rise to infinite chains along a direction parallel to [100]. In contrast complex3 develops infinite chains from WS₄Cu₃ aggregates with the same Cu(NCS)₂Cu bridges as in 4 and 5. These chains are running along a direction parallel to [010]. The structural data of the different types of polymeric compounds containing MS_4²⁻ and CuNCS have been used to interpret vibrational spectroscopic data of the thiocyanate groups.     

Structural studies on [Mo3S4] and [Mo3S4Cu] complexes with tripodal ligands providing various NxOy (x + Y = 3) donor sets

The interaction of 1,3,5-triamino-1,3,5-trideoxy-cis-inositol (taci) and its N-methylated derivative 1,3,5-trideoxy-1,3,5-tris(dimethylamino)-cis-inositol (tdci) with the incomplete [Mo₃S₄]⁴⁺ cube and the heterometallic [Mo₃S₄Cu]⁴⁺ cube have been investigated by X-ray analysis. The crystal structures of [Mo₃S₄(taci+ rmC₃H₆O-H₂O)₃-4H]·2OH₂O (1a, rhombohedral, space group R32, A = 15.964(3), C = 40.59(1) Å, Z = 6), [Mo₃S₄(tdci)₃]Br₄·9.5EtOH·5H₂O (2a, triclinic, space group

Full-size image

and [CuBrMo₃S₄(tdci)₃]Br₃·11 H₂O·EtOH (3a, monoclinic, space group P2,/n, A = 14.887(3), B = 22.570(4), C = 21.974(5) Å, β = 98.54(2)°, Z = 4) revealed andN-N-O and an N-O-O coordination mode for taci and tdci, respectively. In 1a, taci is coordinated as an anion with deprotonated oxygen and nitrogen donors. In addition, the non-coordinating amino group reacted with one equivalent; of acetone, forming a Schiff base condensation product. For 2a, short Mo---O bonds and high pK_a values (compared to the aqua ion [Mo₃S₄(H₂O)₉]⁴⁺) indicate the formation of a zwitterionic form of the tdci ligand with coordinated alkoxo groups and peripheral dimethylammonium groups. No significant differences were found for the structural properties of the Mo-tdci fragment in 2a and 3a. The coordination modes of taci and tdci, as observed in the solid state, are in agreement with the previously reported solution structures, established by NMR spectroscopy. They are attributed to the specific steric requirements of the two ligands and to a pronounced preference of the [Mo₃(μS)₃(μ₃S)]⁴⁺ core to coordinate a nitrogen donor trans to μ₃S.     

Convenient preparation of [CuX(PCy3)2](X = Br, I, SCN, N3) complexes. X-ray crystal structure of [Cu(N3)(PCy3)2] (Cy = cyclo-C6H11)

The labile cations [Cu(F-BF₃)(PCy₃)₂] and [Cu(OTf)(PCy₃)₂] are versatile precursors for the formation of [Cu(X)(PCy₃)₂] (X = Br, I, SCN, N₃) complexes by metathesis with NaX. The azide [Cu(N₃)(PCy₃)₂] is triclinic, space group , a = 9.755(4), B = 22.78(1), C = 9.284(6) Å, = 96.76(3), β = 115.36(3), γ = 94.20(5)°, Z = 2.     

The ReH6[P(C6H5)3]2 ion as a ligand: complexes with M(CO)3 fragments (M = Cr, Mo, W)

The reactions of [(H₅C₆)₃P]₂ReH₆⁻ with (CH₃CN)₃Cr(CO)₃, (diglyme)Mo(CO)₃ or (C₃H₇CN)₃W(CO)₃ led to the formation of [(H₅C₆)₃P]₂ReH₆M(CO)₃⁻ (M = Cr, Mo, W) complexes. These have been characterized by IR and NMR spectroscopies, as well as elemental analyses. A single crystal X-ray diffraction study has also been carried out for the M = Cr complex as a K(18-crown-6)⁺ salt. The complex crystallizes as a THF monosolvate in the monoclinic space group P2₁/n with a = 22.323(6), B = 9.523(2), C = 27.502(5) Å, β = 104.98(2)⁰ and V = 5648 ų for Z = 4. The Re---Cr separation is 2.5745(12) Å, and the two phosphine ligands are oriented unsymmetrically. Although the hydride ligands were not found, the presence of three bridging hydrides and a dodecahedral coordination geometry about rhenium could be inferred. Low temperature ¹H and ³¹P NMR spectroscopic studies did not reveal the low symmetry of the solid state structure.     

Mechanistic details for metathetical exchange between XCO (X = O and RN) and the tin(II) dimer, {Sn[N(SiMe3)2] (μ-OBu)}2

Metathetical exchange between carbon dioxide and the tin(II) dimer, {Sn[N(SiMe₃)₂](μ-OBu¹)}₂ (3) has been observed to cleanly produce the two new heteroleptic tin(II) dimers, Sn[N(SiMe₃)₂](μ-OBu^t)₂Sn(OSiMe₃) (6) and [Sn(OSiMe₃)](μ-OBu^t)]₂ (7]). In addition, reaction of 3 with I equiv, of tert-butylisocyanate (8), at 25°C, quantitatively provides 6, and with 2 equiv., quantitatively provides 7. Likewise 6 reacts with 1 equiv, of 8 to quantitatively provide 7. The mechanism for these latter processes has been investigated by low temperature ¹H NMR spectroscopy which reveals that metathetical exchange does not involve the tri-coordinate tin(II) centers of the dimeric structures, but rather, it occurs, in each case, via the transient monomeric tin(II) species, Sn[N(SiMe₃)₂](μ-OBu^t) (4), that undergoes metathesis to produce, initially the open dimer intermediate, Sn(OCNBu^t)(OSiMe₃)(μ-OBu^t)Sn(OBu^t) (OSiMe₃) (12), that is observed at −10°C. Subsequent redistribution reactions then generate the final products that are observed. Together, these mechanistic details provide additional support for the ‘monomeric tin(II)’ hypothesis proposed earlier for metathetical exchange between XCO and Sn[N (SiMe₃)₂]₂ (1).     

Studies of the oxovanadium(IV)—oxalate system: syntheses and crystal structures of binuclear (Ph4P)2[(VO)2(H2O)2(C2O4)3]·4H2O and of the one-dimensional chain material, (Ph4P)[VOCl(C2O4)]

The hydrothermal reactions of (Ph₄P)[VO₂Cl₂] and H₂C₂O₄ at 150 and 125°C yield (Ph₄P)₂[V₂O₂(H₂O)₂(C₂O₄)₃]·4H₂O (1) and (Ph₄P)[VOCl(C₂O₄)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO₆ coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph₄P⁺ cations occupying regions between [VOCl(C₂O₄)]⁻_∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H₂O, monoclinic P2₁/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) ų, Z = 2, D_calc = 1.501 g cm⁻³, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P4₃, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) ų, Z = 4, R = 0.0452.     

Application of the hydro(solvo)thermal technique to the synthesis of metal carbonyl chalcogenide clusters Part 3. Synthesis, structural characterization, and spectroscopic studies of the clusters [{M(CO)4}n(MS4)] (M = Mo, W; N=1, 2)

The methanothermal reactions of M(CO)₆ (M = Mo, W) with Na₂S₂ gave a series of homonuclear clusters [{M(CO)₄}_n(MS₄)]²⁻ (M=Mo, W; N=1, 2), i.e. (Ph₄P)₂[(CO)₄Mo(MoS₄)] (I), (Ph₄P)₂[(CO)₄W(WS₄)] (II), (Ph₄P)₂[(CO)₄Mo(MoS₄)Mo(CO)₄] (III) and (Ph₄P)₂[(CO)₄W(WS₄)W(CO)₄] (IV). The two dimers, I and II, as well as the two trimers, III and IV, are isostructural to each other, respectively. All compounds crystallize in the triclinic space group with Z=2. The cell dimensions are: a=12.393(8), b=19.303(9), c=11.909(6) Å, =102.39(5), β=111.54(5), γ=73.61(5)°, V=2522(3) ų at T=23 °C for I; a=12.390(3), b=19.314(4), c=11.866(2) Å, =102.66(2), β=111.49(1), γ=73.40(2)°, V=2511(1) ų at T=23 °C for II; a=11.416(3), b=22.524(4), c=10.815(4) Å, =91.03(2), β=100.57(3), γ=88.96(2)°, V=2733(1) ų at T=−100 °C for III, a=11.498(1), b=22.600(4), c=10.864(3) Å, =90.92(2), β=100.85(1), γ=88.58(1)°, V=2771(2) ų at T=23 °C for IV. The dimers are each formed by the coordination of the tetrathiometalate as a bidentate chelating ligand to an M(CO)₄ fragment while addition of another M(CO)₄ fragment to the dimers results in the trimers. All compounds contain both tetrahedral and octahedral metal centers with the formal 6+ and 0 oxidation states, respectively.     

The synthesis, fluctionality and structural characterization of ReMo3H4(CO)12

The reaction of ReH₉²⁻ with Mo(diglyme)(CO)₃ leads to the formation of the mixed metal cluster trianion, ReMo₃H₄(CO)₁₂³⁻. This species has been characterized analytically, spectroscopically and through X-ray diffraction analysis. A pseudo-tetrahedral arrangement of M(CO)₃ fragments is adopted, such that each set of three carbonyl ligands eclipses the adjacent three tetrahedral edges, an apparent result of the location of the hydride ligands on the tetrahedral faces. Variable temperature NMR studies revealed a fluctional process for some of the carbonyl ligands, but not for the hydrides. Crystal data for [Me₄N]₃[ReMo₃H₄(CO)₁₂]·THF; space group P2₁/n, a = 12.157(2), B = 21.480(4), C = 15.964(3) Å, β = 98.26(1)°, Z = 4, R = 0.067 and R_w = 0.076.