共查询到20条相似文献,搜索用时 31 毫秒
1.
New mixed metal complexes SrCu2(O2CR)3(bdmap)3 (R = CF3 (1a), CH3 (1b)) and a new dinuclear bismuth complex Bi2(O2CCH3)4(bdmap)2(H2O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF2 and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi2O3 at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm−1. Crystal data for 1a: C27H51N6O9F9Cu2Sr/THF, monoclinic space group P21/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) Å3, Z = 2; for 1b: C27H60N6O9Cu2Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) Å3, Z = 8; for 2: C22H48O11N4Bi2, monoclinic space group P21/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) Å3, Z = 4. 相似文献
2.
Toshiaki Yonemura Kimi Shibuya Ken-ichi Okamoto Tomoharu Ama Hiroshi Kawaguchi Takaji Yasui 《Inorganica chimica acta》1997,260(2):m1127-128
Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]+ (2), t-[Co(mtp)(tren)]2+ (1Me) and t-[Co(mta)(tren)]2+ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO4 (1CIO4): monoclinic, P21/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) Å3, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H2O (2Cl·3H2O): monoclinic, P21/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) Å3, Z = 4 and R = 0.066; (+)465CD-t-[Co(mtp)(tren)](ClO4)2 ((+)465CD-1Me(ClO4)2): orthorhombic, P212121, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) Å3, Z = 4 and R = 0.068; (+)465CD-t-[Co(mta)(tren)](ClO4)2 ((+)465CD-2Me(ClO4)2): orthorhombic, P212121, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) Å3, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)465CD-1Me is the S configuration and that in (+)465CD-2Me is the R one. The 1H NMR, 13C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries. 相似文献
3.
Gerard A. van Albada Wilberth J.J. Smeets Anthony L. Spek Jan Reedijk 《Inorganica chimica acta》1997,260(2):164-161
Based on the new ligand bis(1-methyl-2-benzimidazolyl) propane (abbreviated as mtbz) several new copper(II) coordination compounds have been prepared and characterized structurally and spectroscopically. Two representative compounds, i.e. [Cu2(mtbz)2(CH3)2- (CF3SO3)](CF3SO3) (1) and [Cu2(mtbz)2(CH3O)2](ClO4)2 (4) were characterized structurally by X-ray diffraction. Crystal data for 1: monoclinic, space group P21/c, a=13.6585(5), B=39.981(3), C=20.919(1) Å, β=125.98(1)°, Z=8. Crystal data for 4: monoclinic, space group P21/c, a=13.115(2), B=9.523(2), C=17.908(4) Å, β=111.71(1)°, Z=2. Structures 1 and 4 each consist of a dinuclear unit with bridging methoxo groups and one ligand linked to each copper via an N atom. Structure 1 (which consists of two dinuclear, crystallographically independent, but chemically identical units) has the two copper atoms bridged by a triflate anion, providing each copper atom a square-pyramidal coordination, while the copper atoms in structure 4 have an almost a square-planar geometry. The Cu---Cu distances (Å) within the dinuclear units are: 1, 2.9775(13), 2.9751(13); 4, 2.9872(16); the Cu---O---Cu bridging angles (°) are: 1, 101.7(3), 101.7(3), 100.9(3), 102.1(3); 4, 103.2(2). The mid-IR section focused on the vibrations of the triflate anion reveals interesting results concerning the assignments of that anion related to the vas(S---O) band. Characteristic Cu---O vibrations in the far-IR section were found at 386 and 230 cm−1 for the methoxo-bridged and 454 and 332 cm−1 for the ethoxo-bridged compounds. These dinuclear species are EPR silent, and only a weak signal of monomeric impurities is observed. They also show a diamagnetic behavior below room temperature. 相似文献
4.
The molecular structure of the title complexes [Fe(H2O)4][Fe(Hedta)(H2O)]2 · 4H2O (I) and [Fe(H[2edta)(H2O)] · 2H2O (II) have been determined by single-crystal X-ray analyses. The crystal data are as follows: I: monoclinic, P21/n, A = 11.794(2), B = 15.990(2), C = 9.206(2) Å, β = 90.33(1)°, V = 1736.1(5) Å3, Z = 2 and R = 0.030; II: monoclinic, C2/c, A = 11.074(2), B = 9.856(2), C = 14.399(2) Å, β = 95.86(1)°, V = 1563.3(4) Å3, Z = 4 and R = 0.025. I is found to be isomorphous with the MnII analog reported earlier and to contain a seven-coordinate and approximately pentagonal-bipyramidal (PB) [FeII(Hedta)(H2O]− unit in which Hedta acts as a hexadentate ligand. The [FeII(H2edta)(H2O)] unit in II has also a seven-coordinate PB structure with the two protonated equatorial glycine arms both remaining coordinated, and thus bears a structural resemblance to the seven-coordinate [CoII(H2edta)(H2O)] reported previously. 相似文献
5.
Daniela Schulz Thomas Weyhermü ller Karl Wieghardt Bernhard Nuber 《Inorganica chimica acta》1995,240(1-2):217-229
The synthesis of the tetradentate pendant arm macrocycles 1,4,7-triazacyclononane-N-acetate (L1) and N-(2-hydroxybenzyl)-1,4,7-triazacyclononane (HL2) and their coordination chemistry with vanadium(IV) and (V) are reported. The following mononuclear species have been prepared and characterized by UV-Vis, IR spectroscopy: [L1VIVO(NCS)] (1), [L1VO2]·H2O (2), [L2VO(NCS)] (3), [L2VO(NCS)]Cl (4), and [L2VO2] (5). In addition, the dinuclear, mixed valent complexes [L21V2O3]Br (6), [L22V2O3](ClO4)·0.5acetone (7), and the homovalent complex [L22V2O3](ClO4)2 (8) have been synthesized. Complexes 2, 3, 6 and 7 have been characterized by single crystal X-ray crystallography. Crystal data: 2, space group P21c,a=9.944(4),b=6.701(3),c=18.207(8)Å, β=102.88(3)°, V=1182.7 Å3, Z=4, Dcalc=1.51 g cm−3, R=0.049 based on 4760 reflections; 3, space group Pbca, A=11.003(6), b=14.295(7), C=20.21(1) Å, V=3178.8 Å3, Z=8, Dcalc=1,50 g cm−3, R=0.057 based on 1049 reflections; 6, space Pbcn, a=12.922(3), B=13.852(3), C=12.739(3) Å, V=2280.3 Å3, Z=4, Dcalc=1,75 g cm−3, R=0.047 based on 1172 reflections; 7, space group C2/c, A=23.553(9), B=13.497(5), C=20.951(8) Å, β=90.03(3)°, V=6660.2 Å3, Z=8, Dcalc=1.49 g cm−3, R=0.053 based on 3698 reflections. Complexes 6 and 7 are mixed valent V(IV)/(V) complexes containing the [OV---O---VO]3+ core. In the solid state 6 belongs to class III (delocalized) and 7 to class I (localized) according to the Robin and Day classification of mixed valent compounds. A rationale for these differing electronic structures is given. 相似文献
6.
Elizabeth Babian-Kibala Hong Chen F. Albert Cotton Lee M. Daniels Larry R. Falvello Günter Schmid Zhengui Yao 《Inorganica chimica acta》1996,250(1-2):359-364
Compounds of formula [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl5 and AlCl3 in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) Å3 and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) Å3 V = 1634.8(4) Å3 and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) Å3 and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation. 相似文献
7.
The hydrothermal reactions of (Ph4P)[VO2Cl2] and H2C2O4 at 150 and 125°C yield (Ph4P)2[V2O2(H2O)2(C2O4)3]·4H2O (1) and (Ph4P)[VOCl(C2O4)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO6 coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph4P+ cations occupying regions between [VOCl(C2O4)]−∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H2O, monoclinic P21/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) Å3, Z = 2, Dcalc = 1.501 g cm−3, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P43, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) Å3, Z = 4, R = 0.0452. 相似文献
8.
Reaction of LaCl3·7H2O containing small amounts of La(NO3)3·7H2O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH3CN:CH3OH resulted in the isolation of the mixed anion complexes [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]. The nine-coordinate dimer, [LaCl2(NO3)(12-crown-4)]2, has all of the anions in the inner coordination sphere and La3+ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and Dcalc = 2.08 g cm−3 for Z = 4. The second complex isolated from the same reaction, [La(NO3)(OH2)4(12-crown-4)]Cl2·CH3CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P21 with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and Dcalc = 1.80 g cm−3 for Z = 2. The 18-crown-6 complex, [LaCl2(NO3)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La3+ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and Dcalc = 1.89 g cm−3 for Z = 8. 相似文献
9.
B. Augustus Uzoukwu P. U. Adiukwu Salih S. Al-Juaid Peter B. Hitchcock J. David Smith 《Inorganica chimica acta》1996,250(1-2):173-176
The structures of the complexes [PbL2], L = 1-phenyl-3-methyl-4-acylpyrazolonato, RCOC10H8N2O, R = Me (2) or Pr (3), have been determined by X-ray diffraction studies. Compound 2 is monoclinic, space group P21, A = 11.285(4), B = 14.727(4), C = 20.749(5) Å, β = 95.83(3)°, R = 0.039 for 4486 reflections, and 3 is monoclinic, space group C2/c, A = 27.528(11), B = 7.245(11), C = 14.264(7) Å, β = 113.6(3)°, R = 0.021 for 2118 reflections. There are three different lead environments in 2 but only one in 3. In each case the lead atom makes four strong bonds to oxygen and two weaker bonds to either oxygen or nitrogen in adjacent molecules. 相似文献
10.
Li-Cheng Song Lu-Yan Zhang Qing-Mei Hu Xiao-Ying Huang 《Inorganica chimica acta》1995,230(1-2):127-131
An improved synthetic procedure for pentabenzylcyclopentadiene Bz5C5H was developed. Six new organomolybdenum and organotungsten halides η5-Bz5C5M(CO)3X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η5-Bz5C5M(CO)3Li (derived from Bz5C5H, n-BuLi and M(CO)6) with PCl3, PBr3 or I2 and characterized by elemental analysis, IR and 1H NMR spectroscopy. The structure of η5-Bz5C5Mo(CO)3I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) Å3, Z = 4 and Dx = 1.50 g cm−3. The final R value was 0.035 for 4564 observed reflections. 相似文献
11.
Stephen E. Lehman Jr. George L. Schimek John M. Cusick Joseph W. Kolis 《Inorganica chimica acta》1997,260(2):9660-181
Three new crystalline tin selenide salts have been prepared from the reactions of [PPh4]2[Sn(Se43] in supercritical solvents. The starting material pyrolyzes in supercritical acetonitrile to form [PPh4]4[Sn6Se21] (I), and it also reacts with SnSe in supercritical ammonia leading to a mixture of [PPh4]4[Sn3Se11]2 (II). and [PPh4]2[Sn(Se4)(Se6)2] (III). All three compounds have been characterized by single crystal X-ray diffraction. Crystallographic data: for I, C96H90P4Se21Sn6, space group triclinic, P-1, A = 18.763(3), B = 24.600(4), C = 13.137(1) Å, = 102.63(1), β = 93.66(1), γ = 108.72(1)°, V = 5544(1) Å3, Z = 2, R = 0.0350, RW = 0.0317: for II, C96H80P4Se22Sn6, space group monoclinic P21/c, A = 31.500(4), B = 16.572(3), C = 22.352(3) Å, β = 103.53(1)°, V = 11344(3) Å3, Z = 4, R = 0.0771, RW = 0.0664: for III, C48H40P2Se16Sn, space group monoclinic, C2/c, A = 25.381(2), B = 13.934(4), C = 19.465(3) Å, β = 121.587(8)°, V = 5867(2) Å3, Z = 4, R = 0.0807, RW = 0.0650. One of the compounds, [PPh4]2[Sn(Se4(Se62], is a molecular cluster while the other two complexes [PPh4]4[Sn3Se11]2 and [PPh4]4[Sn6Se21], are one dimensional tin selenide chains. The structures of the two chains are related and consits of tetrahedral and distorted trigonal bipyramidal tin(IV) centers bridged by Se2−, Se22− and Se32− chains. 相似文献
12.
Paramasivan Halasyamani Michael J. Willis Charlotte L. Stern Kenneth R. Poeppelmeier 《Inorganica chimica acta》1995,240(1-2):109-115
The syntheses and structures of [Ni(H2O)6]2+[MF6]2− (M = Ti,Zr,Hf) and Ni3(py)12F6·7H2O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group
(No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) Å3 for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) Å3 for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)Å3 for Hf. The structures consist of discrete [Ni(H2O)6]2+ and [MF6]2− octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni3(py)12F6·7H2O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) Å3. The structure consists of discrete Ni(py)4F2 octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)x·pyridine/pyridine/water solution. 相似文献
13.
The labile cations [Cu(F-BF3)(PCy3)2] and [Cu(OTf)(PCy3)2] are versatile precursors for the formation of [Cu(X)(PCy3)2] (X = Br, I, SCN, N3) complexes by metathesis with NaX. The azide [Cu(N3)(PCy3)2] is triclinic, space group
, a = 9.755(4), B = 22.78(1), C = 9.284(6) Å, = 96.76(3), β = 115.36(3), γ = 94.20(5)°, Z = 2. 相似文献
14.
The reaction of ReH92− with Mo(diglyme)(CO)3 leads to the formation of the mixed metal cluster trianion, ReMo3H4(CO)123−. This species has been characterized analytically, spectroscopically and through X-ray diffraction analysis. A pseudo-tetrahedral arrangement of M(CO)3 fragments is adopted, such that each set of three carbonyl ligands eclipses the adjacent three tetrahedral edges, an apparent result of the location of the hydride ligands on the tetrahedral faces. Variable temperature NMR studies revealed a fluctional process for some of the carbonyl ligands, but not for the hydrides. Crystal data for [Me4N]3[ReMo3H4(CO)12]·THF; space group P21/n, a = 12.157(2), B = 21.480(4), C = 15.964(3) Å, β = 98.26(1)°, Z = 4, R = 0.067 and Rw = 0.076. 相似文献
15.
The reactions of the polysulfur and selenium cationic clusters S82+ and Se82+ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF6− as a counterion, the cluster [Fe3(E2)2(CO)10] [SbF6]2·SO2 (E = S, Se) could be isolated from the reaction of E82+ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se2 groups, with the whole fragment capped by an Fe(CO)4 group. Crystallographic data for C10O12Fe3Se4Sb2F12S (I): space group monoclinic P21/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) Å3, Z = 4, R = 0.0426, Rw = 0.0503. When Sb2F11− is present as the counterion, or Se4[Sb2F11]2 is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe4(Se2)3(CO)12] [SbF6]2·3SO2. The dication contains two Fe2Se2 fragments bridged by an Se2 group. Crystallographic data for C12O18Fe4Se6Sb2F12S3 (III): space group triclinic
, b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) Å3, Z = 2, R = 0.0328, Rw = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO2 when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated. 相似文献
16.
Johannes G. P. Delis Marco Rep Richard E. Rülke Piet W. N. M. van Leeuwen Kees Vrieze Jan Fraanje Kees Goubitz 《Inorganica chimica acta》1996,250(1-2):87-103
The coordination chemistry of the new bidentate nitrogen ligands 8-(2-pyridyl)quinoline (8-PQ) and 8-(6-methyl-2-pyridyl)quinoline (Me-8-PQ) towards palladium and platinum has been studied. Several (NN)Pd(R)Cl and (NN)Pd(alkene) complexes have been synthesized. The complex (8-PQ)Pd(Me)Cl has been characterised by a single crystal X-ray determination (crystal data triclinic space group ). A fast CO insertion occurs into the palladium-carbon bond of the complexes (NN)Pd(Me)Cl providing the (NN)Pd(C(O)Me)Cl complexes. For (8-PQ)Pd(C(O)Me)Cl an X-ray structure determination has been carried out (crystal data: monoclinic space group P21/c with a=9.084(4), B=10.179(3), C=16.400(3) Å, β=95.59(2)°, V=1509.2(9) Å3, R=0.043, Z=4). Unexpected in both molecular structures is the large dihedral angle between the plane of the bidentate nitrogen ligand and the coordination plane of the palladium. Both bidentate coordinating ligands 8-PQ and Me-8-PQ show a relatively large bite angle. A monodentate coordination mode has been observed for the complexes (NN)M(PEt3)Cl2 (M=Pd, Pt), as the pyridyl group of the ligand is coordinated to the metal while the quinoline group is dissociated from the metal, which is shown in the X-ray structure determination for the complex (8-PQ)Pd(PEt3)Cl2 (crystal data: monoclinic space group P21/a with A=15.736(2), B=7.782(1), C=18.255(3) Å, β=102.98(1)°, V=2178.3(6) Å3, R=0.062, Z=4). 相似文献
17.
Li-Juan Zhang Hua-Kuan Lin Xian-He Bu Yun-Ti Chen Xiao-Lan Liu Fang-Ming Miao 《Inorganica chimica acta》1995,240(1-2):257-262
A number of N,N′-bis(4-substituted phenyl)-1,7-diaza-12-crown-4 and N,N′-bis(4-substituted phenyl)-1, 10-diaza-18-crown-6 (where the substituents are OCH3, CH3, H, Cl, respectively) have been prepared by cyclization reaction of a ditosylate with the appropriately substituted diol. These new macrocyclic ligands have been characterized by means of elemental analysis, IR, 1H NMR and MS spectra. The crystal structures of N,N′-bis(4-chlorophenyl)-1,10-diaza-18-crown-6 (21) and its complex with barium thiocyanate Ba(SCN)2 (22) have been determined by single crystal X-ray diffraction. The crystallographic data are as follows: 21: C24H32Cl2N2O4, orthorhombic, P212121, A=4.852(1), B=11.989(2), C=41.231(8) Å, V=2398.7(8) Å3, Z=4; 22: C26H32Cl2N4O4S2Ba, monoclinic, P21/c, A=8.801(2), B=11.653(9), C=15.756(6) Å, ß=105.96(3)°, V=1553.7(14) Å3, Z=2. In the complex, the Ba atom is eight-coordinate (O(1), O(2), O(1)′, O(2)′, N(1), N(1)′, N(21), N(21)′) to form a distorted D6h geometry with the Ba atom at the center of crystallographic symmetry. 相似文献
18.
Reaction of (NEt4)2MS4 (M = Mo, W) with CuCl and KSCN (or NH4SCN) in acetone or acetonitrile affords a new set of mixed metal–sulfur compounds: infinite anionic chains Cu4(NCS)5MS43− (1,2), (CuNCS)3WS42− (3) and two dimensional polymeric dianions (CuNCS)4MS42− (4,5). Crystal of 1 (M = W) and 3 are triclinic, space group P1(1:a = 10.356(2),b = 15.039(1),c = 17.356(2)Å, = 78.27(1)°, β = 88.89(2)° and γ = 88.60(1)°,Z = 2,R = 0.04 for 3915 independent data;3:a = 8.449(2),b = 14.622(4),c = 15.809(8)Å, = 61.84(3)°, β = 73.67(3)° and γ = 78.23(2)°,Z = 2,R = 0.029 for 6585 independent data). Crystals of 4 (M = W) and 5 (M = Mo) are monoclinic, space group P21/m,Z = 2 (4:a = 12.296(4),b = 14.794(4),c = 10.260(3)Åand β = 101.88(3)°,R = 0.034 for 4450 independent data;5:a = 12.306(2),b = 14.809(3),c = 10.257(2)Åand β = 101.99(3)°,R = 0.043 for 3078 independent data). The crystal structure determinations of 4 and 5 show that four edges of the tetrahedral MS42− core are coordinated by copper atoms forming WS4Cu4 aggregates linked by eight-membered Cu(NCS)2Cu rings. A two-dimensional network is thus formed in the diagonal (101) plane. The space between the anionic two-dimensional networks is filled with the NEt4+ cations. Additional NCS groups lead to the [Cu4(NCS)5WS4]3− (1) trianion connected by NCS bridges forming pseudo-dimers. These latter are held together by weak CuS(NCS) interactions giving rise to infinite chains along a direction parallel to [100]. In contrast complex3 develops infinite chains from WS4Cu3 aggregates with the same Cu(NCS)2Cu bridges as in 4 and 5. These chains are running along a direction parallel to [010]. The structural data of the different types of polymeric compounds containing MS42− and CuNCS have been used to interpret vibrational spectroscopic data of the thiocyanate groups. 相似文献
19.
The crystal structure of the complex [H2B(pz)2]2Cd has been determined: orthorhombic, Pbca, A = 16.052(3), B = 13.935(3), C = 14.974(4) Å, V = 3349.4(13) Å3, Z = 8, R(F) = 3.61%. It is the first structurally characterized non-porphyrin CdN4 complex. It is monomeric in the solid state with a pseudotetrahedral geometry about the cadmium atom. The N---Cd---N angles are distorted by the approximate 93° bite angle of the ligand; the interligand N---Cd---N angles also are distorted, ranging from 106.9 to 131.7°. These distortions are the result of intermolecular packing forces and are facilitated by the spherical set of valence orbitals for Cd2+. 相似文献
20.
Christopher L. Sheppard Santokh S. Tandon Laurence K. Thompson John N. Bridson David O. Miller Makoto Handa Francesc Lloret 《Inorganica chimica acta》1996,250(1-2):227-239
Two novel, weakly antiferromagnetically coupled, tetranuclear copper(II) complexes [Cu4(PAP)2(μ2-1,1-N3)2(μ2-1,3-N3)2(μ2-CH3OH)2(N3)4 (1) (PAP = 1,4-bis-(2′-pyridylamino)phthalazine) and [Cu4(PAP3Me)2 (μ2-1,1-N3)2(μ2-1,3-N3)2(H2O)2(NO2)2]- (NO3)2 (2) (PAP3Me = 1,4-bis-(3′-methyl-2′-pyridyl)aminophthalazine) contain a unique structural with two μ2-1,1-azide intramolecular bridges, and two μ2-1,3-azide intermolecular bridges linking pairs of copper(II) centers. Four terminal azide groups complete the five-coordinate structures in 1, while two terminal waters and two nitrates complete the coordination spheres in 2. The dinuclear complexes [Cu2(PPD)(μ2-1,1-N3)(N3)2(CF3SO3)]CH3OH) (3) and [Cu2(PPD)(μ2-1,1-N3)(N3)2(H2O)(ClO4)] (4) (PPD = 3,6-bis-(1′-pyrazolyl)pyridazine) contain pairs of copper centers with intramolecular μ2-1,1-azid and pyridazine bridges, and exhibit strong antiferromagnetic coupling. A one-dimensional chain structure in 3 occurs through intermolecular μ2-1,1-azide bridging interactions. Intramolecular Cu-N3-Cu bridge angles in 1 and 2 are small (107.9 and 109.4°, respectively), but very large in 3 and 4 (122.5 and 123.2°, respectively), in keeping with the magnetic properties. 2 crystallizes in the monoclinic system, space group C2/c with a = 26.71(1), b = 13.51(3), c = 16.84(1) Å, β = 117.35(3)° and R = 0.070, Rw = 0.050. 3 crystallizes in the monoclinic system, space group P21/c with a = 8.42(1), b = 20.808(9), c = 12.615(4) Å, β = 102.95(5)° and R = 0.045, Rw = 0.039. 4crystallizes in the triclinic system, space group P1, with a = 10.253(3), b = 12.338(5), c = 8.072(4) Å, = 100.65(4), β = 101.93(3), γ = 87.82(3)° and R = 0.038, Rw = 0.036 . The magnetic properties of 1 and 2 indicate the presence of weak net antiferromagnetic exchange, as indicated by the presence of a low temperature maximum in χm (80 K (1), 65 K (2)), but the data do not fit the Bleaney-Bowers equation unless the exchange integral is treated as a temperature dependent term. A similar situation has been observed for other related compounds, and various approaches to the problem will be discussed. Magnetically 3 and 4 are well described by the Bleaney-Bowers equation, exhibiting very strong antiferromagnetic exchange (− 2J = 768(24) cm−1 (3); − 2J = 829(11) cm−1 (4)). 相似文献