Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

Molecular structures and some properties of tris(2-aminoethyl) amine cobalt(III) complexes with thiocarboxylato-O,S such as 3-mercaptopropionato, 2-mercaptoacetato and their derivatives

Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]⁺ (2), t-[Co(mtp)(tren)]²⁺ (1Me) and t-[Co(mta)(tren)]²⁺ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO₄ (1CIO₄): monoclinic, P2₁/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) ų, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H₂O (2Cl·3H₂O): monoclinic, P2₁/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) ų, Z = 4 and R = 0.066; (+)₄₆₅^CD-t-[Co(mtp)(tren)](ClO₄)₂ ((+)₄₆₅^CD-1Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) ų, Z = 4 and R = 0.068; (+)₄₆₅^CD-t-[Co(mta)(tren)](ClO₄)₂ ((+)₄₆₅^CD-2Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) ų, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)₄₆₅^CD-1Me is the S configuration and that in (+)₄₆₅^CD-2Me is the R one. The ¹H NMR, ¹³C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries.     

Synthesis, spectroscopic properties and X-ray crystal structures of two dinuclear alkoxo-bridged copper(II) compounds with the ligand bis(1-methyl-2-benzimidazolyl) propane. A unique alkoxo-bridged Cu(II) dinuclear compound with an additional bidentate bridging triflate anion

Based on the new ligand bis(1-methyl-2-benzimidazolyl) propane (abbreviated as mtbz) several new copper(II) coordination compounds have been prepared and characterized structurally and spectroscopically. Two representative compounds, i.e. [Cu₂(mtbz)₂(CH₃)₂- (CF₃SO₃)](CF₃SO₃) (1) and [Cu₂(mtbz)₂(CH₃O)₂](ClO₄)₂ (4) were characterized structurally by X-ray diffraction. Crystal data for 1: monoclinic, space group P2₁/c, a=13.6585(5), B=39.981(3), C=20.919(1) Å, β=125.98(1)°, Z=8. Crystal data for 4: monoclinic, space group P2₁/c, a=13.115(2), B=9.523(2), C=17.908(4) Å, β=111.71(1)°, Z=2. Structures 1 and 4 each consist of a dinuclear unit with bridging methoxo groups and one ligand linked to each copper via an N atom. Structure 1 (which consists of two dinuclear, crystallographically independent, but chemically identical units) has the two copper atoms bridged by a triflate anion, providing each copper atom a square-pyramidal coordination, while the copper atoms in structure 4 have an almost a square-planar geometry. The Cu---Cu distances (Å) within the dinuclear units are: 1, 2.9775(13), 2.9751(13); 4, 2.9872(16); the Cu---O---Cu bridging angles (°) are: 1, 101.7(3), 101.7(3), 100.9(3), 102.1(3); 4, 103.2(2). The mid-IR section focused on the vibrations of the triflate anion reveals interesting results concerning the assignments of that anion related to the v_as(S---O) band. Characteristic Cu---O vibrations in the far-IR section were found at 386 and 230 cm⁻¹ for the methoxo-bridged and 454 and 332 cm⁻¹ for the ethoxo-bridged compounds. These dinuclear species are EPR silent, and only a weak signal of monomeric impurities is observed. They also show a diamagnetic behavior below room temperature.     

Molecular structures of Fe(II) complexes with mono- and di-protonated ethylenediamine-N,N,N′,N′-tetraacetate (Hedta and H2edta), as determined by X-ray crystal analyses

The molecular structure of the title complexes [Fe(H₂O)₄][Fe(Hedta)(H₂O)]₂ · 4H₂O (I) and [Fe(H[₂edta)(H₂O)] · 2H₂O (II) have been determined by single-crystal X-ray analyses. The crystal data are as follows: I: monoclinic, P2₁/n, A = 11.794(2), B = 15.990(2), C = 9.206(2) Å, β = 90.33(1)°, V = 1736.1(5) ų, Z = 2 and R = 0.030; II: monoclinic, C2/c, A = 11.074(2), B = 9.856(2), C = 14.399(2) Å, β = 95.86(1)°, V = 1563.3(4) ų, Z = 4 and R = 0.025. I is found to be isomorphous with the Mn^II analog reported earlier and to contain a seven-coordinate and approximately pentagonal-bipyramidal (PB) [Fe^II(Hedta)(H₂O]⁻ unit in which Hedta acts as a hexadentate ligand. The [Fe^II(H₂edta)(H₂O)] unit in II has also a seven-coordinate PB structure with the two protonated equatorial glycine arms both remaining coordinated, and thus bears a structural resemblance to the seven-coordinate [Co^II(H₂edta)(H₂O)] reported previously.     

The monofunctionalized 1,4,7-triazacyclononane derivatives 1,4,7-triazacyclononane-N-acetate (L) and N-(2-hydroxybenzyl-1,4,7-triazacyclononane (HL) and their complexes with vanadium(IV)/(V). Localized and delocalized electronic structures in compounds containing the mixed valent [OV---O---VO] core

The synthesis of the tetradentate pendant arm macrocycles 1,4,7-triazacyclononane-N-acetate (L¹) and N-(2-hydroxybenzyl)-1,4,7-triazacyclononane (HL²) and their coordination chemistry with vanadium(IV) and (V) are reported. The following mononuclear species have been prepared and characterized by UV-Vis, IR spectroscopy: [L¹V^IVO(NCS)] (1), [L¹VO₂]·H₂O (2), [L²VO(NCS)] (3), [L²VO(NCS)]Cl (4), and [L²VO₂] (5). In addition, the dinuclear, mixed valent complexes [L₂¹V₂O₃]Br (6), [L₂²V₂O₃](ClO₄)·0.5acetone (7), and the homovalent complex [L₂²V₂O₃](ClO₄)₂ (8) have been synthesized. Complexes 2, 3, 6 and 7 have been characterized by single crystal X-ray crystallography. Crystal data: 2, space group P2₁c,a=9.944(4),b=6.701(3),c=18.207(8)Å, β=102.88(3)°, V=1182.7 ų, Z=4, D_calc=1.51 g cm⁻³, R=0.049 based on 4760 reflections; 3, space group Pbca, A=11.003(6), b=14.295(7), C=20.21(1) Å, V=3178.8 ų, Z=8, D_calc=1,50 g cm⁻³, R=0.057 based on 1049 reflections; 6, space Pbcn, a=12.922(3), B=13.852(3), C=12.739(3) Å, V=2280.3 ų, Z=4, D_calc=1,75 g cm⁻³, R=0.047 based on 1172 reflections; 7, space group C2/c, A=23.553(9), B=13.497(5), C=20.951(8) Å, β=90.03(3)°, V=6660.2 ų, Z=8, D_calc=1.49 g cm⁻³, R=0.053 based on 3698 reflections. Complexes 6 and 7 are mixed valent V(IV)/(V) complexes containing the [OV---O---VO]³⁺ core. In the solid state 6 belongs to class III (delocalized) and 7 to class I (localized) according to the Robin and Day classification of mixed valent compounds. A rationale for these differing electronic structures is given.     

Synthesis and problematic crystal structures of [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta, Nb or Sb)

Compounds of formula [Al(CH₃CN)₆][MCl₆]₃(CH₃CN)₃ (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl₅ and AlCl₃ in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) ų and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) ų V = 1634.8(4) ų and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) ų and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation.     

Studies of the oxovanadium(IV)—oxalate system: syntheses and crystal structures of binuclear (Ph4P)2[(VO)2(H2O)2(C2O4)3]·4H2O and of the one-dimensional chain material, (Ph4P)[VOCl(C2O4)]

The hydrothermal reactions of (Ph₄P)[VO₂Cl₂] and H₂C₂O₄ at 150 and 125°C yield (Ph₄P)₂[V₂O₂(H₂O)₂(C₂O₄)₃]·4H₂O (1) and (Ph₄P)[VOCl(C₂O₄)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO₆ coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph₄P⁺ cations occupying regions between [VOCl(C₂O₄)]⁻_∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H₂O, monoclinic P2₁/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) ų, Z = 2, D_calc = 1.501 g cm⁻³, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P4₃, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) ų, Z = 4, R = 0.0452.     

Mixed anion lanthanide(III) crown ether complexes: crystal structures of [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4-(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]

Reaction of LaCl₃·7H₂O containing small amounts of La(NO₃)₃·7H₂O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH₃CN:CH₃OH resulted in the isolation of the mixed anion complexes [LaCl₂(NO₃)(12-crown-4)]₂, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN and [LaCl₂(NO₃)(18-crown-6)]. The nine-coordinate dimer, [LaCl₂(NO₃)(12-crown-4)]₂, has all of the anions in the inner coordination sphere and La³⁺ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and D_calc = 2.08 g cm⁻³ for Z = 4. The second complex isolated from the same reaction, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P2₁ with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and D_calc = 1.80 g cm⁻³ for Z = 2. The 18-crown-6 complex, [LaCl₂(NO₃)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La³⁺ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and D_calc = 1.89 g cm⁻³ for Z = 8.     

Pyrazolonato complexes of lead. Crystal structures of bis(1-phenyl-3-methyl-4-acetyl pyrazolonato)lead(II) and bis(1-phenyl-3-methyl-4-butanoylpyrazolonato)lead(II)

The structures of the complexes [PbL₂], L = 1-phenyl-3-methyl-4-acylpyrazolonato, RCOC₁₀H₈N₂O, R = Me (2) or Pr (3), have been determined by X-ray diffraction studies. Compound 2 is monoclinic, space group P2₁, A = 11.285(4), B = 14.727(4), C = 20.749(5) Å, β = 95.83(3)°, R = 0.039 for 4486 reflections, and 3 is monoclinic, space group C2/c, A = 27.528(11), B = 7.245(11), C = 14.264(7) Å, β = 113.6(3)°, R = 0.021 for 2118 reflections. There are three different lead environments in 2 but only one in 3. In each case the lead atom makes four strong bonds to oxygen and two weaker bonds to either oxygen or nitrogen in adjacent molecules.     

Synthesis and characterization of organomolybdenum and organotungsten halides containing the η-pentabenzylcyyclopentadienyl ligand η-Bz5C5M(CO)3X (M = Mo, W; X = Cl, Br, I). The X-ray molecular structure of η-Bz5C5Mo(CO)3I

An improved synthetic procedure for pentabenzylcyclopentadiene Bz₅C₅H was developed. Six new organomolybdenum and organotungsten halides η⁵-Bz₅C₅M(CO)₃X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η⁵-Bz₅C₅M(CO)₃Li (derived from Bz₅C₅H, n-BuLi and M(CO)₆) with PCl₃, PBr₃ or I₂ and characterized by elemental analysis, IR and ¹H NMR spectroscopy. The structure of η⁵-Bz₅C₅Mo(CO)₃I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) ų, Z = 4 and D_x = 1.50 g cm⁻³. The final R value was 0.035 for 4564 observed reflections.     

Synthesis of one dimensional tin selenides in supercritical amines

Three new crystalline tin selenide salts have been prepared from the reactions of [PPh₄]₂[Sn(Se₄₃] in supercritical solvents. The starting material pyrolyzes in supercritical acetonitrile to form [PPh₄]₄[Sn₆Se₂₁] (I), and it also reacts with SnSe in supercritical ammonia leading to a mixture of [PPh₄]₄[Sn₃Se₁₁]₂ (II). and [PPh₄]₂[Sn(Se₄)(Se₆)₂] (III). All three compounds have been characterized by single crystal X-ray diffraction. Crystallographic data: for I, C₉₆H₉₀P₄Se₂₁Sn₆, space group triclinic, P-1, A = 18.763(3), B = 24.600(4), C = 13.137(1) Å, = 102.63(1), β = 93.66(1), γ = 108.72(1)°, V = 5544(1) ų, Z = 2, R = 0.0350, R_W = 0.0317: for II, C₉₆H₈₀P₄Se₂₂Sn₆, space group monoclinic P2₁/c, A = 31.500(4), B = 16.572(3), C = 22.352(3) Å, β = 103.53(1)°, V = 11344(3) ų, Z = 4, R = 0.0771, R_W = 0.0664: for III, C₄₈H₄₀P₂Se₁₆Sn, space group monoclinic, C2/c, A = 25.381(2), B = 13.934(4), C = 19.465(3) Å, β = 121.587(8)°, V = 5867(2) ų, Z = 4, R = 0.0807, R_W = 0.0650. One of the compounds, [PPh₄]₂[Sn(Se₄(Se₆₂], is a molecular cluster while the other two complexes [PPh₄]₄[Sn₃Se₁₁]₂ and [PPh₄]₄[Sn₆Se₂₁], are one dimensional tin selenide chains. The structures of the two chains are related and consits of tetrahedral and distorted trigonal bipyramidal tin(IV) centers bridged by Se²⁻, Se₂²⁻ and Se₃²⁻ chains.     

Crystal growth in aqueous hydrofluoric acid and (HF)x · pyridine solutions: syntheses and crystal structures of [Ni(H2O)6][MF6] (M = Ti, Zr, Hf) and Ni3(py)12F6 · 7H2O

The syntheses and structures of [Ni(H₂O)₆]²⁺[MF₆]²⁻ (M = Ti,Zr,Hf) and Ni₃(py)₁₂F₆·7H₂O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group (No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) ų for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) ų for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)ų for Hf. The structures consist of discrete [Ni(H₂O)₆]²⁺ and [MF₆]²⁻ octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni₃(py)₁₂F₆·7H₂O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) ų. The structure consists of discrete Ni(py)₄F₂ octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)_x·pyridine/pyridine/water solution.     

Convenient preparation of [CuX(PCy3)2](X = Br, I, SCN, N3) complexes. X-ray crystal structure of [Cu(N3)(PCy3)2] (Cy = cyclo-C6H11)

The labile cations [Cu(F-BF₃)(PCy₃)₂] and [Cu(OTf)(PCy₃)₂] are versatile precursors for the formation of [Cu(X)(PCy₃)₂] (X = Br, I, SCN, N₃) complexes by metathesis with NaX. The azide [Cu(N₃)(PCy₃)₂] is triclinic, space group , a = 9.755(4), B = 22.78(1), C = 9.284(6) Å, = 96.76(3), β = 115.36(3), γ = 94.20(5)°, Z = 2.     

The synthesis, fluctionality and structural characterization of ReMo3H4(CO)12

The reaction of ReH₉²⁻ with Mo(diglyme)(CO)₃ leads to the formation of the mixed metal cluster trianion, ReMo₃H₄(CO)₁₂³⁻. This species has been characterized analytically, spectroscopically and through X-ray diffraction analysis. A pseudo-tetrahedral arrangement of M(CO)₃ fragments is adopted, such that each set of three carbonyl ligands eclipses the adjacent three tetrahedral edges, an apparent result of the location of the hydride ligands on the tetrahedral faces. Variable temperature NMR studies revealed a fluctional process for some of the carbonyl ligands, but not for the hydrides. Crystal data for [Me₄N]₃[ReMo₃H₄(CO)₁₂]·THF; space group P2₁/n, a = 12.157(2), B = 21.480(4), C = 15.964(3) Å, β = 98.26(1)°, Z = 4, R = 0.067 and R_w = 0.076.     

The coordination chemistry of cationic main group clusters: syntheses and structures of [Fe3(Se2)2(CO)10] and [Fe4(Se2)3(CO)12]

The reactions of the polysulfur and selenium cationic clusters S₈²⁺ and Se₈²⁺ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF₆⁻ as a counterion, the cluster [Fe₃(E₂)₂(CO)₁₀] [SbF₆]₂·SO₂ (E = S, Se) could be isolated from the reaction of E₈²⁺ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se₂ groups, with the whole fragment capped by an Fe(CO)₄ group. Crystallographic data for C₁₀O₁₂Fe₃Se₄Sb₂F₁₂S (I): space group monoclinic P2₁/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) ų, Z = 4, R = 0.0426, R_w = 0.0503. When Sb₂F₁₁⁻ is present as the counterion, or Se₄[Sb₂F₁₁]₂ is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe₄(Se₂)₃(CO)₁₂] [SbF₆]₂·3SO₂. The dication contains two Fe₂Se₂ fragments bridged by an Se₂ group. Crystallographic data for C₁₂O₁₈Fe₄Se₆Sb₂F₁₂S₃ (III): space group triclinic , b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) ų, Z = 2, R = 0.0328, R_w = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO₂ when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated.     

Coordination modes of the novel bifunctional nitrogen ligands 8-(2-pyridyl)quinoline and 8-(6-methyl-2-pyridyl)quinoline towards palladium and platinum. X-ray crystal structures of (8-(2-pyridyl)quinoline)Pd(Me)Cl, (8-(2-pyridyl)quinoline)-Pd(C(O)Me)Cl and (8-(2-pyridyl)quinoline)Pd(PEt3)Cl2

The coordination chemistry of the new bidentate nitrogen ligands 8-(2-pyridyl)quinoline (8-PQ) and 8-(6-methyl-2-pyridyl)quinoline (Me-8-PQ) towards palladium and platinum has been studied. Several (NN)Pd(R)Cl and (NN)Pd(alkene) complexes have been synthesized. The complex (8-PQ)Pd(Me)Cl has been characterised by a single crystal X-ray determination (crystal data triclinic space group

Full-size image

). A fast CO insertion occurs into the palladium-carbon bond of the complexes (NN)Pd(Me)Cl providing the (NN)Pd(C(O)Me)Cl complexes. For (8-PQ)Pd(C(O)Me)Cl an X-ray structure determination has been carried out (crystal data: monoclinic space group P2₁/c with a=9.084(4), B=10.179(3), C=16.400(3) Å, β=95.59(2)°, V=1509.2(9) ų, R=0.043, Z=4). Unexpected in both molecular structures is the large dihedral angle between the plane of the bidentate nitrogen ligand and the coordination plane of the palladium. Both bidentate coordinating ligands 8-PQ and Me-8-PQ show a relatively large bite angle. A monodentate coordination mode has been observed for the complexes (NN)M(PEt₃)Cl₂ (M=Pd, Pt), as the pyridyl group of the ligand is coordinated to the metal while the quinoline group is dissociated from the metal, which is shown in the X-ray structure determination for the complex (8-PQ)Pd(PEt₃)Cl₂ (crystal data: monoclinic space group P2₁/a with A=15.736(2), B=7.782(1), C=18.255(3) Å, β=102.98(1)°, V=2178.3(6) ų, R=0.062, Z=4).     

Studies of the cation complexing ability of crowns Part I. Synthesis, characterization and crystal structure of diazacrowns and their barium complexes

A number of N,N′-bis(4-substituted phenyl)-1,7-diaza-12-crown-4 and N,N′-bis(4-substituted phenyl)-1, 10-diaza-18-crown-6 (where the substituents are OCH₃, CH₃, H, Cl, respectively) have been prepared by cyclization reaction of a ditosylate with the appropriately substituted diol. These new macrocyclic ligands have been characterized by means of elemental analysis, IR, ¹H NMR and MS spectra. The crystal structures of N,N′-bis(4-chlorophenyl)-1,10-diaza-18-crown-6 (21) and its complex with barium thiocyanate Ba(SCN)₂ (22) have been determined by single crystal X-ray diffraction. The crystallographic data are as follows: 21: C₂₄H₃₂Cl₂N₂O₄, orthorhombic, P2₁2₁2₁, A=4.852(1), B=11.989(2), C=41.231(8) Å, V=2398.7(8) ų, Z=4; 22: C₂₆H₃₂Cl₂N₄O₄S₂Ba, monoclinic, P2₁/c, A=8.801(2), B=11.653(9), C=15.756(6) Å, ß=105.96(3)°, V=1553.7(14) ų, Z=2. In the complex, the Ba atom is eight-coordinate (O(1), O(2), O(1)′, O(2)′, N(1), N(1)′, N(21), N(21)′) to form a distorted D_6h geometry with the Ba atom at the center of crystallographic symmetry.     

Heterobimetallic aggregates of copper(I) with thiotungstates and thiomolybdates. Synthesis and characterization of polymeric (NEt4)3[Cu4(NCS)5WS4], (NEt4)2[(CuNCS)3WS4] and (NEt4)2[(CuNCS)4WS4], M = Mo, W

Reaction of (NEt₄)₂MS₄ (M = Mo, W) with CuCl and KSCN (or NH₄SCN) in acetone or acetonitrile affords a new set of mixed metal–sulfur compounds: infinite anionic chains Cu₄(NCS)₅MS_4³⁻ (1,2), (CuNCS)₃WS_4²⁻ (3) and two dimensional polymeric dianions (CuNCS)₄MS_4²⁻ (4,5). Crystal of 1 (M = W) and 3 are triclinic, space group P1(1:a = 10.356(2),b = 15.039(1),c = 17.356(2)Å, = 78.27(1)°, β = 88.89(2)° and γ = 88.60(1)°,Z = 2,R = 0.04 for 3915 independent data;3:a = 8.449(2),b = 14.622(4),c = 15.809(8)Å, = 61.84(3)°, β = 73.67(3)° and γ = 78.23(2)°,Z = 2,R = 0.029 for 6585 independent data). Crystals of 4 (M = W) and 5 (M = Mo) are monoclinic, space group P2₁/m,Z = 2 (4:a = 12.296(4),b = 14.794(4),c = 10.260(3)Åand β = 101.88(3)°,R = 0.034 for 4450 independent data;5:a = 12.306(2),b = 14.809(3),c = 10.257(2)Åand β = 101.99(3)°,R = 0.043 for 3078 independent data). The crystal structure determinations of 4 and 5 show that four edges of the tetrahedral MS_4²⁻ core are coordinated by copper atoms forming WS₄Cu₄ aggregates linked by eight-membered Cu(NCS)₂Cu rings. A two-dimensional network is thus formed in the diagonal (101) plane. The space between the anionic two-dimensional networks is filled with the NEt_4⁺ cations. Additional NCS groups lead to the [Cu₄(NCS)₅WS₄]³⁻ (1) trianion connected by NCS bridges forming pseudo-dimers. These latter are held together by weak CuS(NCS) interactions giving rise to infinite chains along a direction parallel to [100]. In contrast complex3 develops infinite chains from WS₄Cu₃ aggregates with the same Cu(NCS)₂Cu bridges as in 4 and 5. These chains are running along a direction parallel to [010]. The structural data of the different types of polymeric compounds containing MS_4²⁻ and CuNCS have been used to interpret vibrational spectroscopic data of the thiocyanate groups.     

Bis[dihydrobis(1-pyrazolyl)borate]cadmium(II): a monomeric, severely distorted tetrahedral complex of cadmium(II)

The crystal structure of the complex [H₂B(pz)₂]₂Cd has been determined: orthorhombic, Pbca, A = 16.052(3), B = 13.935(3), C = 14.974(4) Å, V = 3349.4(13) ų, Z = 8, R(F) = 3.61%. It is the first structurally characterized non-porphyrin CdN₄ complex. It is monomeric in the solid state with a pseudotetrahedral geometry about the cadmium atom. The N---Cd---N angles are distorted by the approximate 93° bite angle of the ligand; the interligand N---Cd---N angles also are distorted, ranging from 106.9 to 131.7°. These distortions are the result of intermolecular packing forces and are facilitated by the spherical set of valence orbitals for Cd²⁺.     

Polynuclear copper(II) complexes with μ2-1,1-azide bridges. Structural and magnetic properties

Two novel, weakly antiferromagnetically coupled, tetranuclear copper(II) complexes [Cu₄(PAP)₂(μ₂-1,1-N₃)₂(μ₂-1,3-N₃)₂(μ₂-CH₃OH)₂(N₃)₄ (1) (PAP = 1,4-bis-(2′-pyridylamino)phthalazine) and [Cu₄(PAP3Me)₂ (μ₂-1,1-N₃)₂(μ₂-1,3-N₃)₂(H₂O)₂(NO₂)₂]- (NO₃)₂ (2) (PAP3Me = 1,4-bis-(3′-methyl-2′-pyridyl)aminophthalazine) contain a unique structural with two μ₂-1,1-azide intramolecular bridges, and two μ₂-1,3-azide intermolecular bridges linking pairs of copper(II) centers. Four terminal azide groups complete the five-coordinate structures in 1, while two terminal waters and two nitrates complete the coordination spheres in 2. The dinuclear complexes [Cu₂(PPD)(μ₂-1,1-N₃)(N₃)₂(CF₃SO₃)]CH₃OH) (3) and [Cu₂(PPD)(μ₂-1,1-N₃)(N₃)₂(H₂O)(ClO₄)] (4) (PPD = 3,6-bis-(1′-pyrazolyl)pyridazine) contain pairs of copper centers with intramolecular μ₂-1,1-azid and pyridazine bridges, and exhibit strong antiferromagnetic coupling. A one-dimensional chain structure in 3 occurs through intermolecular μ₂-1,1-azide bridging interactions. Intramolecular Cu-N₃-Cu bridge angles in 1 and 2 are small (107.9 and 109.4°, respectively), but very large in 3 and 4 (122.5 and 123.2°, respectively), in keeping with the magnetic properties. 2 crystallizes in the monoclinic system, space group C2/c with a = 26.71(1), b = 13.51(3), c = 16.84(1) Å, β = 117.35(3)° and R = 0.070, R_w = 0.050. 3 crystallizes in the monoclinic system, space group P2₁/c with a = 8.42(1), b = 20.808(9), c = 12.615(4) Å, β = 102.95(5)° and R = 0.045, R_w = 0.039. 4crystallizes in the triclinic system, space group P1, with a = 10.253(3), b = 12.338(5), c = 8.072(4) Å, = 100.65(4), β = 101.93(3), γ = 87.82(3)° and R = 0.038, R_w = 0.036 . The magnetic properties of 1 and 2 indicate the presence of weak net antiferromagnetic exchange, as indicated by the presence of a low temperature maximum in χ_m (80 K (1), 65 K (2)), but the data do not fit the Bleaney-Bowers equation unless the exchange integral is treated as a temperature dependent term. A similar situation has been observed for other related compounds, and various approaches to the problem will be discussed. Magnetically 3 and 4 are well described by the Bleaney-Bowers equation, exhibiting very strong antiferromagnetic exchange (− 2J = 768(24) cm⁻¹ (3); − 2J = 829(11) cm⁻¹ (4)).