共查询到20条相似文献,搜索用时 31 毫秒
1.
Stephen E. Lehman Jr. George L. Schimek John M. Cusick Joseph W. Kolis 《Inorganica chimica acta》1997,260(2):9660-181
Three new crystalline tin selenide salts have been prepared from the reactions of [PPh4]2[Sn(Se43] in supercritical solvents. The starting material pyrolyzes in supercritical acetonitrile to form [PPh4]4[Sn6Se21] (I), and it also reacts with SnSe in supercritical ammonia leading to a mixture of [PPh4]4[Sn3Se11]2 (II). and [PPh4]2[Sn(Se4)(Se6)2] (III). All three compounds have been characterized by single crystal X-ray diffraction. Crystallographic data: for I, C96H90P4Se21Sn6, space group triclinic, P-1, A = 18.763(3), B = 24.600(4), C = 13.137(1) Å, = 102.63(1), β = 93.66(1), γ = 108.72(1)°, V = 5544(1) Å3, Z = 2, R = 0.0350, RW = 0.0317: for II, C96H80P4Se22Sn6, space group monoclinic P21/c, A = 31.500(4), B = 16.572(3), C = 22.352(3) Å, β = 103.53(1)°, V = 11344(3) Å3, Z = 4, R = 0.0771, RW = 0.0664: for III, C48H40P2Se16Sn, space group monoclinic, C2/c, A = 25.381(2), B = 13.934(4), C = 19.465(3) Å, β = 121.587(8)°, V = 5867(2) Å3, Z = 4, R = 0.0807, RW = 0.0650. One of the compounds, [PPh4]2[Sn(Se4(Se62], is a molecular cluster while the other two complexes [PPh4]4[Sn3Se11]2 and [PPh4]4[Sn6Se21], are one dimensional tin selenide chains. The structures of the two chains are related and consits of tetrahedral and distorted trigonal bipyramidal tin(IV) centers bridged by Se2−, Se22− and Se32− chains. 相似文献
2.
Kinetic results are reported for intramolecular PPh3 substitution reactions of Mo(CO)2(η1-L)(PPh3)2(SO2) to form Mo(CO)2(η2-L)(PPh3)(SO2) (L = DMPE = (Me)2PC2H4P(Me)2 and dppe=Ph2PC2H4PPh2) in THF solvent, and for intermolecular SO2 substitutions in Mo(CO)3(η2-L)(η2-SO2) (L = 2,2′-bipyridine, dppe) with phosphorus ligands in CH2Cl2 solvent. Activation parameters for intramolecular PPh3 substitution reactions: ΔH≠ values are 12.3 kcal/mol for dmpe and 16.7 kcal/mol for dppe; ΔS≠ values are −30.3 cal/mol K for dmpe and −16.4 cal/mol K for dppe. These results are consistent with an intramolecular associative mechanism. Substitutions of SO2 in MO(CO)3(η2-L)(η2-SO2) complexes proceed by both dissociative and associative mechanisms. The facile associative pathways for the reactions are discussed in terms of the ability of SO2 to accept a pair of electrons from the metal, with its bonding transformations of η2-SO2 to η1-pyramidal SO2, maintaining a stable 18-e count for the complex in its reaction transition state. The structure of Mo(CO)2(dmpe)(PPh3)(SO2) was determined crystallographically: P21/c, A=9.311(1), B = 16.344(2), C = 18.830(2) Å, ß=91.04(1)°, V=2865.1(7) Å3, Z=4, R(F)=3.49%. 相似文献
3.
Paramasivan Halasyamani Michael J. Willis Charlotte L. Stern Kenneth R. Poeppelmeier 《Inorganica chimica acta》1995,240(1-2):109-115
The syntheses and structures of [Ni(H2O)6]2+[MF6]2− (M = Ti,Zr,Hf) and Ni3(py)12F6·7H2O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group
(No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) Å3 for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) Å3 for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)Å3 for Hf. The structures consist of discrete [Ni(H2O)6]2+ and [MF6]2− octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni3(py)12F6·7H2O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) Å3. The structure consists of discrete Ni(py)4F2 octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)x·pyridine/pyridine/water solution. 相似文献
4.
The reaction of ReH92− with Mo(diglyme)(CO)3 leads to the formation of the mixed metal cluster trianion, ReMo3H4(CO)123−. This species has been characterized analytically, spectroscopically and through X-ray diffraction analysis. A pseudo-tetrahedral arrangement of M(CO)3 fragments is adopted, such that each set of three carbonyl ligands eclipses the adjacent three tetrahedral edges, an apparent result of the location of the hydride ligands on the tetrahedral faces. Variable temperature NMR studies revealed a fluctional process for some of the carbonyl ligands, but not for the hydrides. Crystal data for [Me4N]3[ReMo3H4(CO)12]·THF; space group P21/n, a = 12.157(2), B = 21.480(4), C = 15.964(3) Å, β = 98.26(1)°, Z = 4, R = 0.067 and Rw = 0.076. 相似文献
5.
New mixed metal complexes SrCu2(O2CR)3(bdmap)3 (R = CF3 (1a), CH3 (1b)) and a new dinuclear bismuth complex Bi2(O2CCH3)4(bdmap)2(H2O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF2 and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi2O3 at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm−1. Crystal data for 1a: C27H51N6O9F9Cu2Sr/THF, monoclinic space group P21/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) Å3, Z = 2; for 1b: C27H60N6O9Cu2Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) Å3, Z = 8; for 2: C22H48O11N4Bi2, monoclinic space group P21/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) Å3, Z = 4. 相似文献
6.
Elizabeth Babian-Kibala Hong Chen F. Albert Cotton Lee M. Daniels Larry R. Falvello Günter Schmid Zhengui Yao 《Inorganica chimica acta》1996,250(1-2):359-364
Compounds of formula [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl5 and AlCl3 in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) Å3 and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) Å3 V = 1634.8(4) Å3 and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) Å3 and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation. 相似文献
7.
The hydrothermal reactions of (Ph4P)[VO2Cl2] and H2C2O4 at 150 and 125°C yield (Ph4P)2[V2O2(H2O)2(C2O4)3]·4H2O (1) and (Ph4P)[VOCl(C2O4)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO6 coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph4P+ cations occupying regions between [VOCl(C2O4)]−∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H2O, monoclinic P21/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) Å3, Z = 2, Dcalc = 1.501 g cm−3, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P43, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) Å3, Z = 4, R = 0.0452. 相似文献
8.
The reactions of [(H5C6)3P]2ReH6− with (CH3CN)3Cr(CO)3, (diglyme)Mo(CO)3 or (C3H7CN)3W(CO)3 led to the formation of [(H5C6)3P]2ReH6M(CO)3− (M = Cr, Mo, W) complexes. These have been characterized by IR and NMR spectroscopies, as well as elemental analyses. A single crystal X-ray diffraction study has also been carried out for the M = Cr complex as a K(18-crown-6)+ salt. The complex crystallizes as a THF monosolvate in the monoclinic space group P21/n with a = 22.323(6), B = 9.523(2), C = 27.502(5) Å, β = 104.98(2)0 and V = 5648 Å3 for Z = 4. The Re---Cr separation is 2.5745(12) Å, and the two phosphine ligands are oriented unsymmetrically. Although the hydride ligands were not found, the presence of three bridging hydrides and a dodecahedral coordination geometry about rhenium could be inferred. Low temperature 1H and 31P NMR spectroscopic studies did not reveal the low symmetry of the solid state structure. 相似文献
9.
[NBun4]2[W(C3Se5)3] (C3Se52− = 1,3-diselenole-2-selone-4,5- diselenolate(2−)) was prepared by the reaction of Na2[C3Se5] with WCl6 in ethanol, followed by addition of [NBun4]Br. The cyclic voltammogram in dichloromethane exhibits two oxidation peaks at −0.04 and +0.03 V (versus SCE). The complex reacted with [Fe(C5Me5)2][BF4], iodine or [TTF]3[BF4]2 (TTF·+ = the tetrathiafulvalenium radical cation) in acetonitrile to afford the oxidized complexes [Fe(C5Me5)2]0.5[W(C3Se5)3], [NBun4]0.1[W(C3Se5)3] and [TTF]0.5[W(C3Se5)3], respectively. Current-controlled electrochemical oxidation of the complex in acetonitrile gave [NBun4]0.6[W(C3Se5)3]. The oxidized complexes exhibit electrical conductivities of 4.7×10 −5−1.5×10−3 S cm−1 at room temperature measured for compacted pellets. Electronic absorption, IR and ESR spectra of these complexes are discussed. 相似文献
10.
Reaction of (NEt4)2MS4 (M = Mo, W) with CuCl and KSCN (or NH4SCN) in acetone or acetonitrile affords a new set of mixed metal–sulfur compounds: infinite anionic chains Cu4(NCS)5MS43− (1,2), (CuNCS)3WS42− (3) and two dimensional polymeric dianions (CuNCS)4MS42− (4,5). Crystal of 1 (M = W) and 3 are triclinic, space group P1(1:a = 10.356(2),b = 15.039(1),c = 17.356(2)Å, = 78.27(1)°, β = 88.89(2)° and γ = 88.60(1)°,Z = 2,R = 0.04 for 3915 independent data;3:a = 8.449(2),b = 14.622(4),c = 15.809(8)Å, = 61.84(3)°, β = 73.67(3)° and γ = 78.23(2)°,Z = 2,R = 0.029 for 6585 independent data). Crystals of 4 (M = W) and 5 (M = Mo) are monoclinic, space group P21/m,Z = 2 (4:a = 12.296(4),b = 14.794(4),c = 10.260(3)Åand β = 101.88(3)°,R = 0.034 for 4450 independent data;5:a = 12.306(2),b = 14.809(3),c = 10.257(2)Åand β = 101.99(3)°,R = 0.043 for 3078 independent data). The crystal structure determinations of 4 and 5 show that four edges of the tetrahedral MS42− core are coordinated by copper atoms forming WS4Cu4 aggregates linked by eight-membered Cu(NCS)2Cu rings. A two-dimensional network is thus formed in the diagonal (101) plane. The space between the anionic two-dimensional networks is filled with the NEt4+ cations. Additional NCS groups lead to the [Cu4(NCS)5WS4]3− (1) trianion connected by NCS bridges forming pseudo-dimers. These latter are held together by weak CuS(NCS) interactions giving rise to infinite chains along a direction parallel to [100]. In contrast complex3 develops infinite chains from WS4Cu3 aggregates with the same Cu(NCS)2Cu bridges as in 4 and 5. These chains are running along a direction parallel to [010]. The structural data of the different types of polymeric compounds containing MS42− and CuNCS have been used to interpret vibrational spectroscopic data of the thiocyanate groups. 相似文献
11.
A series of cuboidal iron-sulfur clusters [Fe4S3(NO)4(PR3)3]0,1+ (R = Et, Pri, Cy) were synthesized by two routes: reductive desulfurization of [Fe4S4(NO)4] by tertiary phosphines, and substitution of triphenylphosphine in [Fe44S3(NO)4(PPh3)3] by a more basic phosphine. The structures of 3[Fe4S3(NO)4(PEt3)3] · 0.5Et2O, [Fe4S3(NO)4(PEt3)3] [Fe4S3(NO)7] and partially substituted [Fe4S3(NO)4(PPh3)2− (PPri3)] have been determined by X-ray diffraction in order to define the cuboidal Fe4S3 core, previously known only in Roussin's black anion and its reduced form, [Fe4S3(NO)77]1−,2−, and as a part of the iron-molybdenum cofactor of nitrogenase. 相似文献
12.
Four complexes of the type [Cu4I4(CH3CN)2(L)2], L = aniline derivative: Cu4I4(CH3CN)2(2,6-dimethylaniline)2 (I), triclinic,
, a = 12.449(3), B = 14.108(6), C = 10.606(4) Å, = 73.46(3), β = 95.00(2), γ = 73.42(3)°, V = 1682.3(10) Å3; Cu4I4(CH3CN)2(o-ethylaniline)2 (II), triclinic, , V = 1734.0(8) Å3; Cu4I4(CH3CN)2(6-ethyl-o-toluidine)2 (III), orthorhombic, Pnam, a = 14.976(6), b = 21.187(6), C = 12.545(2) Å, V = 3980.7(2) Å3; Cu4I4(CH3CN)2(p-anisidine)2 (IV), monoclinic, A2/a, A = 20.032(10), B = 7.863(1), C = 18.715(9) Å, β = 101.56(4)°, V = 2888.0(2) Å3; were examined by single crystal X-ray diffraction. Complexes I and II have no internal symmetry elements, III has an internal mirror and IV has a two-fold axis. Ab initio calculations based on the atomic positional parameters of complexes containing the three types of symmetry elements reveal HOMO orbitals to be dominated by the p orbitals of the iodine atoms whereas the LUMO orbitals contain major contributions from copper based p orbitals. 相似文献
13.
Reaction of LaCl3·7H2O containing small amounts of La(NO3)3·7H2O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH3CN:CH3OH resulted in the isolation of the mixed anion complexes [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]. The nine-coordinate dimer, [LaCl2(NO3)(12-crown-4)]2, has all of the anions in the inner coordination sphere and La3+ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and Dcalc = 2.08 g cm−3 for Z = 4. The second complex isolated from the same reaction, [La(NO3)(OH2)4(12-crown-4)]Cl2·CH3CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P21 with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and Dcalc = 1.80 g cm−3 for Z = 2. The 18-crown-6 complex, [LaCl2(NO3)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La3+ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and Dcalc = 1.89 g cm−3 for Z = 8. 相似文献
14.
J.A. García-Vázquez J. Romero R. Castro A. Sousa D.J. Rose J. Zubieta 《Inorganica chimica acta》1997,260(2):2900-223
(3-Trimethylsilyl-pyridine-2-thiolato-S,N)copper(I), [Cu(3-Me3Sipyt)], was obtained by electrochemical oxidation of copper metal in an acetonitrile solution of the neutral ligand. The compound is tetrameric and the four copper atoms are arranged with distorted tetrahedral geometry, each copper atom being trigonally coordinated to one nitrogen and two sulfur atoms of three different ligands. Crystal data: 141/a, a=14.608(2), C=19.366(4) Å, V=4133(2), Å, Z=4, Dcalc=1.581 g cm−3, R=0.0397 for 848 reflections. 相似文献
15.
Tania De Simone Ron S. Dickson Brian W. Skelton Allan H. White 《Inorganica chimica acta》1995,240(1-2):323-333
The phosphinoalkenes Ph2P(CH2)nCH=CH2 (n= 1, 2, 3) and phosphinoalkynes Ph2P(CH2)n C≡CR (R = H, N = 2, 3; R = CH3, N = 1) have been prepared and reacted with the dirhodium complex (η−C5H5)2Rh2(μ−CO) (μ−η2−CF3C2CF3). Six new complexes of the type (ν−C5H5)2(Rh2(CO) (μ−η1:η1−CF3C2CF3)L, where L is a P-coordinated phosphinoalkene, or phosphinoalkyne have been isolated and fully characterized; the carbonyl and phosphine ligands are predominantly trans on the Rh---Rh bond, but there is spectroscopic evidence that a small amount of the cis-isomer is formed also. Treatment of the dirhodium-phosphinoalkene complexes with (η−CH3C5H4)Mn(CO)2thf resulted in coordination of the manganese to the alkene function. The Rh2---Mn complex [(η−C5H5)2Rh2(CO) (μ−η1:η1−CF3C2CF3) {Ph2P(CH2)3CH=CH2} (η−CH3C5H4)Mn(CO)2] was fully characterized. Simi treatment of the dirhodium-phosphinoalkyne complexes with Co2(CO)8 resulted in the coordination of Co2(CO)6 to the alkyne function. The Rh2---Co2 complex [(η−C5H5)2Rh2(CO) (μ−η1:η1−CF3C2CF3) {Ph2PCH2C≡CCH3}Co2(CO)2], C37H25Co2F6O7PRh2, was fully characteriz spectroscopically, and the molecular structure of this complex was determined by a single crystal X-ray diffraction study. It is triclinic, space group
(Ci1, No. 2) with a = 18.454(6), B = 11.418(3), C = 10.124(3) Å, = 112.16(2), β = 102.34(3), γ = 91.62(3)°, Z = 2. Conventional R on |F| was 0.052 fo observed (I > 3σ(I)) reflections. The Rh2 and Co2 parts of the molecule are distinct, the carbonyl and phosphine are mutually trans on the Rh---Rh bond, and the orientations of the alkynes are parallel for Rh2 and perpendicular for Co2. Attempts to induce Rh2Co2 cluster formation were unsuccessful. 相似文献
16.
Oleg V. Gusev Mikhail A. Ievlev Konstantin A. Lyssenko Pavel V. Petrovskii Nikolai A. Ustynyuk Peter M. Maitlis 《Inorganica chimica acta》1998,280(1-2):249-256
The reaction of RuCl3(H2O), with C5Me4CF3J in refluxing EtOH gives [Ru2(η5-C5Me1CF2)2 (μ-Cl2] (20 in 44% yield. Dimer 2 antiferromagnetic (−2J=200 cm1). The crystal structures of 2 (rhombohedral system, R3 space group, Z=9, R=0.0589) and [Rh2(η5-C5Me4CF3(2Cl2(μ-Cl)2] (3) (rhombohedral system.
space group, Z = 9, R = 0.0641) were solved; both complexes have dimeric structures with a trans arrangement of the η5-C5Me4CF4 rings. Comparison of the geometry of 2 and 3 with those of the corresponding η5-C5Me5 complexes shows that lowering the ring symmetry causes significant distortion of the M2(μ-Cl)2 moiety. The analysis of the MCl3 fragment conformations in 2 and 3 and in the η5-C5ME5 analogues shows that they are correlated with the M---M distances. The Cl atoms are displaced by Br on reaction of 2 with KBr in MeOH to give the diamagnetic dimer [Ru2(η5-C5Me4CF3)2Br2 (μ-Br2] (4). Complex 2 reacts with O2 in CH2Cl2 solution at ambient temperature to form a mixture of isomeric η6-fulvene dimers [Ru2(η6-C5Me3CF3 = CH2)2Cl2(μ-Cl)2] (5). Reactions of 5 with CO and allyl chloride give Ru(η5-C5Me3CF3CH2Cl)(CO)2Cl (6) and Ru(η5-C5Me3CF3CF3CH2Cl)(η3-C3H5)Cl2 (7) respectively. 相似文献
17.
Li-Cheng Song Lu-Yan Zhang Qing-Mei Hu Xiao-Ying Huang 《Inorganica chimica acta》1995,230(1-2):127-131
An improved synthetic procedure for pentabenzylcyclopentadiene Bz5C5H was developed. Six new organomolybdenum and organotungsten halides η5-Bz5C5M(CO)3X(M = Mo, W; X = Cl, Br, I) were syntesized through the reaction of η5-Bz5C5M(CO)3Li (derived from Bz5C5H, n-BuLi and M(CO)6) with PCl3, PBr3 or I2 and characterized by elemental analysis, IR and 1H NMR spectroscopy. The structure of η5-Bz5C5Mo(CO)3I was determined by single-crystal X-ray diffraction techniques. It crystallized in the monoclinic space groupp P2/c with cell parameters a = 13.294(4), B = 15.147(4), C = 19.027(3) Å, β = 108.32(2)°, V = 3637(2) Å3, Z = 4 and Dx = 1.50 g cm−3. The final R value was 0.035 for 4564 observed reflections. 相似文献
18.
Cristina Femoni Maria Carmela Iapalucci Giuliano Longoni Per H. Svensson 《Inorganica chimica acta》2002,330(1):111-117
The reaction of [N(PPh3)2]2[Ni6(CO)12] with Cu(PPh3)xCl (x=1, 2), as well as the degradation of [N(PPh3)2]2[H2Ni12(CO)21] with PPh3, affords the new and unstable dark orange–brown [N(PPh3)2]2[Ni9(CO)16].THF salt in low yields. This salt has been characterized by a CCD X-ray diffraction determination, along with IR spectroscopy and elemental analysis. The close-packed two-layer metal core geometry of the [Ni9(CO)16]2− dianion is directly related to that of the bimetallic [Ni6Rh3(CO)17]3− trianion and may be envisioned to be formally derived from the hcp three-layer geometry of [Ni12(CO)21]4− by the substitution of one of the two outer [Ni3(CO)3(μ−CO)3]2− layers with a face-bridging carbonyl group. 相似文献
19.
The labile cations [Cu(F-BF3)(PCy3)2] and [Cu(OTf)(PCy3)2] are versatile precursors for the formation of [Cu(X)(PCy3)2] (X = Br, I, SCN, N3) complexes by metathesis with NaX. The azide [Cu(N3)(PCy3)2] is triclinic, space group
, a = 9.755(4), B = 22.78(1), C = 9.284(6) Å, = 96.76(3), β = 115.36(3), γ = 94.20(5)°, Z = 2. 相似文献
20.
Christopher L. Sheppard Santokh S. Tandon Laurence K. Thompson John N. Bridson David O. Miller Makoto Handa Francesc Lloret 《Inorganica chimica acta》1996,250(1-2):227-239
Two novel, weakly antiferromagnetically coupled, tetranuclear copper(II) complexes [Cu4(PAP)2(μ2-1,1-N3)2(μ2-1,3-N3)2(μ2-CH3OH)2(N3)4 (1) (PAP = 1,4-bis-(2′-pyridylamino)phthalazine) and [Cu4(PAP3Me)2 (μ2-1,1-N3)2(μ2-1,3-N3)2(H2O)2(NO2)2]- (NO3)2 (2) (PAP3Me = 1,4-bis-(3′-methyl-2′-pyridyl)aminophthalazine) contain a unique structural with two μ2-1,1-azide intramolecular bridges, and two μ2-1,3-azide intermolecular bridges linking pairs of copper(II) centers. Four terminal azide groups complete the five-coordinate structures in 1, while two terminal waters and two nitrates complete the coordination spheres in 2. The dinuclear complexes [Cu2(PPD)(μ2-1,1-N3)(N3)2(CF3SO3)]CH3OH) (3) and [Cu2(PPD)(μ2-1,1-N3)(N3)2(H2O)(ClO4)] (4) (PPD = 3,6-bis-(1′-pyrazolyl)pyridazine) contain pairs of copper centers with intramolecular μ2-1,1-azid and pyridazine bridges, and exhibit strong antiferromagnetic coupling. A one-dimensional chain structure in 3 occurs through intermolecular μ2-1,1-azide bridging interactions. Intramolecular Cu-N3-Cu bridge angles in 1 and 2 are small (107.9 and 109.4°, respectively), but very large in 3 and 4 (122.5 and 123.2°, respectively), in keeping with the magnetic properties. 2 crystallizes in the monoclinic system, space group C2/c with a = 26.71(1), b = 13.51(3), c = 16.84(1) Å, β = 117.35(3)° and R = 0.070, Rw = 0.050. 3 crystallizes in the monoclinic system, space group P21/c with a = 8.42(1), b = 20.808(9), c = 12.615(4) Å, β = 102.95(5)° and R = 0.045, Rw = 0.039. 4crystallizes in the triclinic system, space group P1, with a = 10.253(3), b = 12.338(5), c = 8.072(4) Å, = 100.65(4), β = 101.93(3), γ = 87.82(3)° and R = 0.038, Rw = 0.036 . The magnetic properties of 1 and 2 indicate the presence of weak net antiferromagnetic exchange, as indicated by the presence of a low temperature maximum in χm (80 K (1), 65 K (2)), but the data do not fit the Bleaney-Bowers equation unless the exchange integral is treated as a temperature dependent term. A similar situation has been observed for other related compounds, and various approaches to the problem will be discussed. Magnetically 3 and 4 are well described by the Bleaney-Bowers equation, exhibiting very strong antiferromagnetic exchange (− 2J = 768(24) cm−1 (3); − 2J = 829(11) cm−1 (4)). 相似文献