共查询到20条相似文献,搜索用时 62 毫秒
1.
The hydrothermal reactions of (Ph4P)[VO2Cl2] and H2C2O4 at 150 and 125°C yield (Ph4P)2[V2O2(H2O)2(C2O4)3]·4H2O (1) and (Ph4P)[VOCl(C2O4)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO6 coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph4P+ cations occupying regions between [VOCl(C2O4)]−∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H2O, monoclinic P21/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) Å3, Z = 2, Dcalc = 1.501 g cm−3, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P43, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) Å3, Z = 4, R = 0.0452. 相似文献
2.
New mixed metal complexes SrCu2(O2CR)3(bdmap)3 (R = CF3 (1a), CH3 (1b)) and a new dinuclear bismuth complex Bi2(O2CCH3)4(bdmap)2(H2O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF2 and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi2O3 at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm−1. Crystal data for 1a: C27H51N6O9F9Cu2Sr/THF, monoclinic space group P21/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) Å3, Z = 2; for 1b: C27H60N6O9Cu2Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) Å3, Z = 8; for 2: C22H48O11N4Bi2, monoclinic space group P21/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) Å3, Z = 4. 相似文献
3.
Reaction of LaCl3·7H2O containing small amounts of La(NO3)3·7H2O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH3CN:CH3OH resulted in the isolation of the mixed anion complexes [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]. The nine-coordinate dimer, [LaCl2(NO3)(12-crown-4)]2, has all of the anions in the inner coordination sphere and La3+ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and Dcalc = 2.08 g cm−3 for Z = 4. The second complex isolated from the same reaction, [La(NO3)(OH2)4(12-crown-4)]Cl2·CH3CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P21 with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and Dcalc = 1.80 g cm−3 for Z = 2. The 18-crown-6 complex, [LaCl2(NO3)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La3+ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and Dcalc = 1.89 g cm−3 for Z = 8. 相似文献
4.
Complexes of type A4[VO(tart)]2·nH2O, where A = Rb or Cs and tart =d,l-tartrate(4−) (n = 2) or d,d-tartrate(4−) (n = 2 for Rb and n = 3 for Cs), were prepared from an aqueous mixture of V2O5, AOH and H4tart. These complexes were studied by single-crystal X-ray diffraction methods: Rb4[VO(d,l-tart)]2·2H2O, space group P1 with a = 8.156(1),b = 8.246(1),c = 8.719(1)Å, = 66.09(1)°, β = 65.07(1)°, γ = 82.40(1)°,Z = 2, 1917 observed reflections, and final Rw = 0.035; Cs4[VO(d,l-tart)]2·2H2O, space group P21/c with a = 9.350(1),b = 13.728(2),c = 8.479(1)Å, β = 106.77(1)°,Z = 4, 2235 observed reflections, and final Rw = 0.054; Rb4[VO(d,d-tart)]2·2H2O, space group P4122 with a = 8.072(1),c = 32.006(3)Å,Z = 8, 1014 observed reflections and final Rw = 0.038; Cs4[VO(d,d-tart)]2·3H2O, space group P122 with a = 8.184(1),c = 33.680(5)Å,Z = 8, 1310 observed reflections, and final Rw = 0.063. Bulk magnetic susceptibility data (1.5–300 K) for these compounds and A4[VOl,l-tart)]2·nH2O (A = Rb, Cs) were obtained on polycrystalline samples. These data were analyzed in terms of a Van Vleck exchange coupled S = 1/2 model which was modified to include an interdimer exchange parameters Θ. Analysis of the low-temperature (1.5–20 K) susceptibility data gave 2J = +1.30 cm−1 and Θ = −1.86 K for Rb4[VO(d,l-tart)]2·2H2O, 2J = +1.16 cm−1 and Θ = −1.69 K for Cs4[VO(d,l-tart)]2·2H2O, 2J = +1.90 cm−1 and Θ = −0.82 K for Rb4[VO(d,d-tart)]2·2H2O, 2J = +2.04 cm−1 and Θ = −0.80 K for Rb4[VO(l,l-tart)]2·2H2O, 2J = +1.52 cm−1 and Θ = −0.25 K for Cs4[VO(d,d-tart)]2·3H2O, and 2J = +1.64 cm−1 and Θ = −0.31 K for Cs4[VO(l,l-tart)]2·3H2O. These results suggest the magnitudes of intradimer (ferromagnetic and interdimer (antiferromagnetic) exchange interactions are similar in these complexes, as observed for the analogous Na salts. 相似文献
5.
Paramasivan Halasyamani Michael J. Willis Charlotte L. Stern Kenneth R. Poeppelmeier 《Inorganica chimica acta》1995,240(1-2):109-115
The syntheses and structures of [Ni(H2O)6]2+[MF6]2− (M = Ti,Zr,Hf) and Ni3(py)12F6·7H2O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group
(No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) Å3 for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) Å3 for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)Å3 for Hf. The structures consist of discrete [Ni(H2O)6]2+ and [MF6]2− octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni3(py)12F6·7H2O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) Å3. The structure consists of discrete Ni(py)4F2 octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)x·pyridine/pyridine/water solution. 相似文献
6.
Katsuyuki Aoki Ning-Hai Hu Tsutomu Tokuno Adegboye O. Adeyemo George N. Williams 《Inorganica chimica acta》1999,290(2):38-152
The reaction of thiamine with K2PtIICl4 and with PtIVCl4 in the presence of excess NaSCN in aqueous solution gave thiamine salts, (H-thiamine)[Pt(SCN)4] · 3H2O (1) and (H-thiamine)[Pt(SCN)6] · H2O (2), respectively, structures of which have been determined by X-ray diffraction. The thiamine molecule adopts the usual F conformation in each salt. In 1, [Pt(SCN)4]2− ions act as large planar spacers in the crystal lattice and interact scarcely with thiamine, except for a hydrogen bonding with the terminal hydroxy O(5γ). Instead, water molecules form two types of host–guest-like interactions with the pyrimidine and the thiazolium moieties of a thiamine molecule, one being a C(2)–Hwaterpyrimidine bridge and the other being an N(4′)–Hwaterthiazolium bridge. In 2, despite the much larger ion size, octahedral [Pt(SCN)6]2− ions form a C(2)–Hanionpyrimidine bridge and an N(4′)–Hanionthiazolium bridge. An additional hydrogen bonding between the anion and the terminal O(5γ) of thiamine creates a hydrogen-bonded macrocyclic ring {thiaminium–[Pt(SCN)6]2−}2, a supramolecule. 相似文献
7.
Christopher L. Sheppard Santokh S. Tandon Laurence K. Thompson John N. Bridson David O. Miller Makoto Handa Francesc Lloret 《Inorganica chimica acta》1996,250(1-2):227-239
Two novel, weakly antiferromagnetically coupled, tetranuclear copper(II) complexes [Cu4(PAP)2(μ2-1,1-N3)2(μ2-1,3-N3)2(μ2-CH3OH)2(N3)4 (1) (PAP = 1,4-bis-(2′-pyridylamino)phthalazine) and [Cu4(PAP3Me)2 (μ2-1,1-N3)2(μ2-1,3-N3)2(H2O)2(NO2)2]- (NO3)2 (2) (PAP3Me = 1,4-bis-(3′-methyl-2′-pyridyl)aminophthalazine) contain a unique structural with two μ2-1,1-azide intramolecular bridges, and two μ2-1,3-azide intermolecular bridges linking pairs of copper(II) centers. Four terminal azide groups complete the five-coordinate structures in 1, while two terminal waters and two nitrates complete the coordination spheres in 2. The dinuclear complexes [Cu2(PPD)(μ2-1,1-N3)(N3)2(CF3SO3)]CH3OH) (3) and [Cu2(PPD)(μ2-1,1-N3)(N3)2(H2O)(ClO4)] (4) (PPD = 3,6-bis-(1′-pyrazolyl)pyridazine) contain pairs of copper centers with intramolecular μ2-1,1-azid and pyridazine bridges, and exhibit strong antiferromagnetic coupling. A one-dimensional chain structure in 3 occurs through intermolecular μ2-1,1-azide bridging interactions. Intramolecular Cu-N3-Cu bridge angles in 1 and 2 are small (107.9 and 109.4°, respectively), but very large in 3 and 4 (122.5 and 123.2°, respectively), in keeping with the magnetic properties. 2 crystallizes in the monoclinic system, space group C2/c with a = 26.71(1), b = 13.51(3), c = 16.84(1) Å, β = 117.35(3)° and R = 0.070, Rw = 0.050. 3 crystallizes in the monoclinic system, space group P21/c with a = 8.42(1), b = 20.808(9), c = 12.615(4) Å, β = 102.95(5)° and R = 0.045, Rw = 0.039. 4crystallizes in the triclinic system, space group P1, with a = 10.253(3), b = 12.338(5), c = 8.072(4) Å, = 100.65(4), β = 101.93(3), γ = 87.82(3)° and R = 0.038, Rw = 0.036 . The magnetic properties of 1 and 2 indicate the presence of weak net antiferromagnetic exchange, as indicated by the presence of a low temperature maximum in χm (80 K (1), 65 K (2)), but the data do not fit the Bleaney-Bowers equation unless the exchange integral is treated as a temperature dependent term. A similar situation has been observed for other related compounds, and various approaches to the problem will be discussed. Magnetically 3 and 4 are well described by the Bleaney-Bowers equation, exhibiting very strong antiferromagnetic exchange (− 2J = 768(24) cm−1 (3); − 2J = 829(11) cm−1 (4)). 相似文献
8.
The reaction of ReH92− with Mo(diglyme)(CO)3 leads to the formation of the mixed metal cluster trianion, ReMo3H4(CO)123−. This species has been characterized analytically, spectroscopically and through X-ray diffraction analysis. A pseudo-tetrahedral arrangement of M(CO)3 fragments is adopted, such that each set of three carbonyl ligands eclipses the adjacent three tetrahedral edges, an apparent result of the location of the hydride ligands on the tetrahedral faces. Variable temperature NMR studies revealed a fluctional process for some of the carbonyl ligands, but not for the hydrides. Crystal data for [Me4N]3[ReMo3H4(CO)12]·THF; space group P21/n, a = 12.157(2), B = 21.480(4), C = 15.964(3) Å, β = 98.26(1)°, Z = 4, R = 0.067 and Rw = 0.076. 相似文献
9.
The positive ion electrospray mass spectrometry (ESI-MS) of trans-[Ru(NO)Cl)(dpaH)2]Cl2 (dpaH=2,2′-dipyridylamine), obtained from the carrier solvent of H2O–CH3OH (50:50), revealed 1+ ions of the formulas [RuII(NO+)Cl(dpaH)(dpa)]+ (m/z=508), [RuIIICl(dpaH)(dpa−)]+ (m/z=478), [RuII(NO+)(dpa)2]+ (m/z=472), [RuIII(dpa)2]+ (m/z=442), originating from proton dissociation from the parent [RuII(NO+)Cl(dpaH)2]2+ ion with subsequent loss of NO (17.4% of dissociative events) or loss of HCl (82.6% of dissociative events). Further loss of NO from the m/z=472 fragment yields the m/z=442 fragment. Thus, ionization of the NH moiety of dpaH is a significant factor in controlling the net ionic charge in the gas phase, and allowing preferential dissociation of HCl in the fragmentation processes. With NaCl added, an ion pair, {Na[RuII(NO)Cl(dpa)2]}+ (m/z=530; 532), is detectable. All these positive mass peaks that contain Ru carry a signature ‘handprint’ of adjacent m/z peaks due to the isotopic distribution of 104Ru, 102Ru, 101Ru, 99Ru, 98Ru and 96Ru mass centered around 101Ru for each fragment, and have been matched to the theoretical isotopic distribution for each set of peaks centered on the main isotope peak. When the starting complex is allowed to undergo aquation for two weeks in H2O, loss of the axial Cl− is shown by the approximately 77% attenuation of the [RuII(NO+)Cl(dpaH)(dpa)]+ ion, being replaced by the [RuII(NO+)(H2O)(dpa)2]+ (m/z=490) as the most abundant high-mass species. Loss of H2O is observed to form [RuII(NO+)(dpa)2]+ (m/z=472). No positive ion mass spectral peaks were observed for RuCl3(NO)(H2O)2, ‘caged NO’. Negative ions were observed by proton dissociation forming [RuII(NO)Cl3(H2O)(OH)]− in the ionization chamber, detecting the parent 1− ion at m/z=274, followed by the loss of NO as the main dissociative pathway that produces [RuIIICl3(H2O)(OH)]− (m/z=244). This species undergoes reductive elimination of a chlorine atom, forming [RuIICl2(H2O)(OH)]− (m/z=208). The ease of the NO dissociation is increased for the negative ions, which should be more able to stabilize a RuIII product upon NO loss. 相似文献
10.
Jian-Qing Tao Zhi-Guo Gu Tian-Wei Wang Qiao-Fang Yang Jing-Lin Zuo Xiao-Zeng You 《Inorganica chimica acta》2007,360(15):4125-4132
Two new spin-crossover complexes, [Fe(Medpq)(py)2(NCS)2] · py · 0.5H2O (1) and [Fe(Medpq)(py)2(NCSe)2] · py (2) (Medpq = 2-methyldipyrido[3,2-f:2′,3′-h]-quinoxaline, py = pyridine), have been synthesized. The crystal structures were determined at both room temperature (298 K) and low temperature (110 K). Complexes 1 and 2 crystallize in the orthorhombic space group Pbca and monoclinic space group P21/n, respectively. In both complexes, the distorted [FeN6] octahedron is formed by six nitrogen atoms from Medpq, the trans pyridine molecules and the cis NCX− groups. The thermal spin transition is accompanied by the shortening of the mean Fe–N distances by 0.194 Å for 2. The mononuclear [Fe(Medpq)(py)2(NCS)2] and [Fe(Medpq)(py)2(NCSe)2] neutral species interact each other via π-stacking, resulting in a one-dimensional extended structure for both 1 and 2. There exist C–HX (X = S, Se) hydrogen bonds for both complexes. Variable-temperature magnetic susceptibility measurements and Mössbauer spectroscopy reveal the occurrence of a gradual spin transition. The transitions are centered at T1/2 = 120 K for 1 and T1/2 = 180 K for 2, respectively. 相似文献
11.
The reactions of the polysulfur and selenium cationic clusters S82+ and Se82+ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF6− as a counterion, the cluster [Fe3(E2)2(CO)10] [SbF6]2·SO2 (E = S, Se) could be isolated from the reaction of E82+ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se2 groups, with the whole fragment capped by an Fe(CO)4 group. Crystallographic data for C10O12Fe3Se4Sb2F12S (I): space group monoclinic P21/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) Å3, Z = 4, R = 0.0426, Rw = 0.0503. When Sb2F11− is present as the counterion, or Se4[Sb2F11]2 is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe4(Se2)3(CO)12] [SbF6]2·3SO2. The dication contains two Fe2Se2 fragments bridged by an Se2 group. Crystallographic data for C12O18Fe4Se6Sb2F12S3 (III): space group triclinic
, b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) Å3, Z = 2, R = 0.0328, Rw = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO2 when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated. 相似文献
12.
Tania De Simone Ron S. Dickson Brian W. Skelton Allan H. White 《Inorganica chimica acta》1995,240(1-2):323-333
The phosphinoalkenes Ph2P(CH2)nCH=CH2 (n= 1, 2, 3) and phosphinoalkynes Ph2P(CH2)n C≡CR (R = H, N = 2, 3; R = CH3, N = 1) have been prepared and reacted with the dirhodium complex (η−C5H5)2Rh2(μ−CO) (μ−η2−CF3C2CF3). Six new complexes of the type (ν−C5H5)2(Rh2(CO) (μ−η1:η1−CF3C2CF3)L, where L is a P-coordinated phosphinoalkene, or phosphinoalkyne have been isolated and fully characterized; the carbonyl and phosphine ligands are predominantly trans on the Rh---Rh bond, but there is spectroscopic evidence that a small amount of the cis-isomer is formed also. Treatment of the dirhodium-phosphinoalkene complexes with (η−CH3C5H4)Mn(CO)2thf resulted in coordination of the manganese to the alkene function. The Rh2---Mn complex [(η−C5H5)2Rh2(CO) (μ−η1:η1−CF3C2CF3) {Ph2P(CH2)3CH=CH2} (η−CH3C5H4)Mn(CO)2] was fully characterized. Simi treatment of the dirhodium-phosphinoalkyne complexes with Co2(CO)8 resulted in the coordination of Co2(CO)6 to the alkyne function. The Rh2---Co2 complex [(η−C5H5)2Rh2(CO) (μ−η1:η1−CF3C2CF3) {Ph2PCH2C≡CCH3}Co2(CO)2], C37H25Co2F6O7PRh2, was fully characteriz spectroscopically, and the molecular structure of this complex was determined by a single crystal X-ray diffraction study. It is triclinic, space group
(Ci1, No. 2) with a = 18.454(6), B = 11.418(3), C = 10.124(3) Å, = 112.16(2), β = 102.34(3), γ = 91.62(3)°, Z = 2. Conventional R on |F| was 0.052 fo observed (I > 3σ(I)) reflections. The Rh2 and Co2 parts of the molecule are distinct, the carbonyl and phosphine are mutually trans on the Rh---Rh bond, and the orientations of the alkynes are parallel for Rh2 and perpendicular for Co2. Attempts to induce Rh2Co2 cluster formation were unsuccessful. 相似文献
13.
The reactions of [(H5C6)3P]2ReH6− with (CH3CN)3Cr(CO)3, (diglyme)Mo(CO)3 or (C3H7CN)3W(CO)3 led to the formation of [(H5C6)3P]2ReH6M(CO)3− (M = Cr, Mo, W) complexes. These have been characterized by IR and NMR spectroscopies, as well as elemental analyses. A single crystal X-ray diffraction study has also been carried out for the M = Cr complex as a K(18-crown-6)+ salt. The complex crystallizes as a THF monosolvate in the monoclinic space group P21/n with a = 22.323(6), B = 9.523(2), C = 27.502(5) Å, β = 104.98(2)0 and V = 5648 Å3 for Z = 4. The Re---Cr separation is 2.5745(12) Å, and the two phosphine ligands are oriented unsymmetrically. Although the hydride ligands were not found, the presence of three bridging hydrides and a dodecahedral coordination geometry about rhenium could be inferred. Low temperature 1H and 31P NMR spectroscopic studies did not reveal the low symmetry of the solid state structure. 相似文献
14.
Cristina Femoni Maria Carmela Iapalucci Giuliano Longoni Per H. Svensson 《Inorganica chimica acta》2002,330(1):111-117
The reaction of [N(PPh3)2]2[Ni6(CO)12] with Cu(PPh3)xCl (x=1, 2), as well as the degradation of [N(PPh3)2]2[H2Ni12(CO)21] with PPh3, affords the new and unstable dark orange–brown [N(PPh3)2]2[Ni9(CO)16].THF salt in low yields. This salt has been characterized by a CCD X-ray diffraction determination, along with IR spectroscopy and elemental analysis. The close-packed two-layer metal core geometry of the [Ni9(CO)16]2− dianion is directly related to that of the bimetallic [Ni6Rh3(CO)17]3− trianion and may be envisioned to be formally derived from the hcp three-layer geometry of [Ni12(CO)21]4− by the substitution of one of the two outer [Ni3(CO)3(μ−CO)3]2− layers with a face-bridging carbonyl group. 相似文献
15.
Ademir Neves Karl Wieghardt Bernhard Nuber Johannes Weiss 《Inorganica chimica acta》1988,150(2):183-187
The reaction of N,N,N′,N′-tetrakis(2-pyridylmethyl)ethylenediamine (tpen) with VCl3 in CH3CN yields Cl3V(tpen)VCl3 which was hydrolyzed in water in the presence of oxygen affording [V2O2(μ-OH)2(tpen)]I2·2H2O, the crystal structure of which has been determined. Asyn-{OV(μ-OH)2VO}2+ core has been identified where the V(IV) centers are antiferromagnetically coupled (J = −150 cm−1;g = 1.80). 相似文献
16.
Shakti L. Mukerjee Alberto A. Gonzalez Steven P. Nolan Telvin D. Ju Russell F. Lang Carl D. Hoff 《Inorganica chimica acta》1995,240(1-2):175-182
The enthalpies of reaction of HMo(CO)3C5R5 (R = H, CH3) with diphenyldisulfide producing PhSMo(CO)3C5R5 and PhSH have been measured in toluene and THF solution (R = H, ΔH= −8.5 ± 0.5 kcal mol−1 (tol), −10.8 ± 0.7 kcal mol−1 (THF); R = CH3, ΔH = −11.3±0.3 kcal mol−1 (tol), −13.2±0.7 kcal mol−1 (THF)). These data are used to estimate the Mo---SPh bond strength to be on the order of 38–41 kcal mol−1 for these complexes. The increased exothermicity of oxidative addition of disulfide in THF versus toluene is attributed to hydrogen bonding between thiophenol produced in the reaction and THF. This was confirmed by measurement of the heat of solution of thiophenol in toluene and THF. Differential scanning calorimetry as well as high temperature calorimetry have been performed on the dimerization and subsequent decarbonylation reactions of PhSMo(CO)3Cp yielding [PhSMo(CO)2Cp]2 and [PhSMo(CO)Cp]2. The enthalpies of reaction of PhSMo(CO)3Cp and [PhSMo(CO)2Cp]2 with PPh3, PPh2Me and P(OMe)3 have also been measured. The disproportionation reaction: 2[PhSMo(CO)2Cp]2 → 2PhSMo(CO)3Cp + [PhSMP(CO)Cp]2 is reported and its enthalpy has also been measured. These data allow determination of the enthalpy of formation of the metal-sulfur clusters [PhSMo(CO)nC5H5]2, N = 1,2. 相似文献
17.
Peter J. Schebler Charles G. Riordan Louise Liable-Sands Arnold L. Rheingold 《Inorganica chimica acta》1998,270(1-2):543-549
The synthesis and characterization of a ferrocenyl-derived tridentate ligand, ferrocenyltris((methylthio)methyl)borate (FcTtP−), and its representative metal complexes, [(FcTt)Cu]4 and [FcTt]2M (M = Fe, Co and Ni), are reported. The M = Fe complex exhibits spin-crossover behavior with a μeff = 1.19 μB at 25°C. The low-spin Co(II) derivative (1.88 μB) exhibits a characteristic axial electron paramagnetic resonance (EPR) spectrum, gav = 2.13, A = 53 G and A¦ = 43 G. The [FcTt]2M complexes display reversible two-electron redox processes assigned to ligand-centered events about 200 mV negative of the ferrocene-ferrocenium couple. [(FcTt)Cu]4 and [FcTt]2Ni have been characterized by X-ray diffraction. X-ray data for [(FcTt)Cu]4: monoclinic space group C2/c, with a = 24.3747(3) Å, b = 20.0857(2) Å, c = 17.2747(4) Å, β = 95.843(1)°, V = 8413.5(3) Å3, and Z = 4; [FcTt]2Ni: monoclinic space group C2/c, with a = 12.6220(3) Å, b = 11.6002(3) Å, c = 25.0125(7) Å, β = 94.067(1)°, V = 3653.1(2) Å3, and Z = 4. 相似文献
18.
Tamotsu Yamamoto Kazuki Mikata Katsuhiko Miyoshi Hayami Yoneda 《Inorganica chimica acta》1988,150(2):237-244
The crystal structures of Li[Fe(trtda)]·3H2O and Na[Fe(eddda)]·5H2O (trtda = trimethylenediaminetetraacetate and eddda = ethylenediamine-N,N′-diacetate-N,N′-di-3-propionate) have been determined by single crystal X-ray diffraction techniques. The former crystal was monoclinic with the space group P21/n,a = 17.775(3),b = 10.261(1),c = 8.883(2)Å, β = 95.86(4)° and Z = 4. The latter was also monoclinic with the space group P21/n,a = 6.894(2),b = 20.710(6),c = 13.966(3)Å, β = 101.44(2)° and Z = 4. Both complex anions were found to adopt an octahedral six-coordinated structure with all of six ligand atoms of trdta4− or eddda4− coordinated to the Fe(III) ion, unlike the corresponding edta4− complex which is usually seven-coordinate with the seventh coordination site occupied by H2O. Of the three geometrical isomers possible for the eddda complex, the trans(O5) isomer was actually found in the latter crystal. Factors determining the structural types of metal–edta complexes are discussed in detail. 相似文献
19.
Yuh-herng Chen Jon W. Merkert Zakir Murtaza Clifton Woods D. Paul Rillema 《Inorganica chimica acta》1995,240(1-2):41-47
The complex Pt(bph) (CO)2 crystallizes in the space group Cmcm with a = 18.647(6), B = 9.566(2) and C = 6.4060(5) Å. The geometry of the molecule is slightly distorted from square planar with a Pt---C(CO) bond distance of 1.98(2) Å and a Pt---C(bph) bond distance of 2.04(2) Å. The Pt(bph)(CO)2 complex serves as a precursor for the preparation of a wide variety of Pt(bph)X2 complexes, where X = monodentate ligands such as acetonitrile, pyridine, etc., and X2 = bidentate ligands such as bypyridine, 1,10-phenanthroline, etc. In the solid state, the complex exhibits a green color, but when ground with an alkali metal salt turns deep blue to purple. In CH2Cl2, the color disappears but optical transitions are observed at 271 nm (2.7 × 104 M−1 cm−1), 303 nm (1.1 × 104 M−1 cm−1) and 330 nm (5.5 × 103 M−1 cm−1). The complex is a weak emitter exhibiting a structured spectrum in CH2Cl2 at r.t. with maxima located at 562 and 594 nm and an emission lifetime of 3.1 μs when excited at 337 nm. 相似文献
20.
Elizabeth Babian-Kibala Hong Chen F. Albert Cotton Lee M. Daniels Larry R. Falvello Günter Schmid Zhengui Yao 《Inorganica chimica acta》1996,250(1-2):359-364
Compounds of formula [Al(CH3CN)6][MCl6]3(CH3CN)3 (M=Ta (1); Nb (2); Sb (3)) have been synthesized from the reactions of MCl5 and AlCl3 in acetonitrile and characterized by X-ray crystallography. Complex 1 crystallizes in the tetragonal space group P4/mbm with a = B = 10.408(2), C = 7.670(3) Å, V = 830.9(4) Å3 and Z = 2/3. Complex 2 crystallizes in the tetragonal space group P4/mnc with a = B = 330(a), C = 15.320(3) Å3 V = 1634.8(4) Å3 and Z = 4/3. Complex 3 also crystallizes in the tetragonal space group P4/mnc with a = B = 10.313(1), C = 15.238(2) Å, V = 1621.0(1) Å3 and Z = 4/3. The non-integer Z values for complexes 1–3 result unusual problems of disorder and/or twinning in these crystal structures due to their high symmetry. The M---Cl distances range from 2.329(3) Å in the Ta complex to 2.355(1) Å in the Sb complex, while the Al---N distances are similar in all three complexes, ranging from 1.92(1) to 1.97(1) Å, respectively. Complexes 1–3 are the first structurally characterized complexes that contain a (hexaacetonitrile)aluminum(III) cation. 相似文献