共查询到20条相似文献,搜索用时 140 毫秒
1.
Yi-Shan Song 《Inorganica chimica acta》2005,358(1):191-195
A novel chain-like luminescent samarium coordination polymer {Sm3(C8H4O4)4(C12N2H8)2(NO3)}n (C8H4O4 = phthalate, C12N2H8 = 1,10-phenanthroline) has been assembled by hydrothermal process. The title complex crystallizes in the monoclinic system, space group P2(1)/c, with lattice parameters a = 22.56(3) Å, b = 11.155(15) Å, c = 20.32(3) Å, β = 96.70(2)°, V = 5078(12) Å3, F(000) = 2964, GOF = 0.857, R1 = 0.0358, wR2 = 0.0597, Z = 4. Samarium ions exhibit different coordination modes from each other and lead to the unexpected high asymmetrical structure. To our knowledge, it is the first example of lanthanide coordination polymers comprising the three asymmetrical central Sm3+ fragments. The photophysical properties have been studied with excitation and emission spectra. 相似文献
2.
The first organically templated molybdenum iodates (C5H6N)2Mo2O5(IO3)4(H2O)2 (1), (C10H8N2)[MoO2(IO3)3] · H3O (2), and uranium iodate (C5H5N)2[(UO2)(IO3)3](IO3) (3), have been successfully synthesized under mild hydrothermal conditions. Compound 1 is simple zero-dimensional units consisting of [(Mo2O5(IO3)4)]2− anions, which can be described as a tetranuclear unit hanged on either side by two [IO3] groups. The [Mo2O5(IO3)4]2− anions are in a close connection through the water molecules and protonated pyridine cations, via hydrogen bonds and intermolecular actions. Compound 2 is built up from [MoO6] octahedra and [IO3] pyramids to two-dimensional layers, in which 4,4′-bipy molecules and water cations are located, forming strong hydrogen bonds with the inorganic framework, leading to pseudo three-dimensional structure. Compound 3 is one-dimensional ribbons containing {[(UO2)(IO3)3](IO3)}2− anions and charge neutrality is achieved by the protonated 4,4′-bipy cations, which reside between two ribbons, forming hydrogen bonds with the inorganic framework and resulting in pseudo two-dimensional structure. Crystal data are as follows: (C5H6N)2Mo2O5(IO3)4(H2O)2 (1), orthorhombic, Pnma, a = 24.097(5) Å, b = 13.532(3) Å, c = 7.836(16) Å, Z = 4, V = 2555.2(9) Å3; (C10H8N2)[MoO2(IO3)3] · H3O (2), monoclinic, C2/c, a = 24.176(5) Å, b = 10.751(2) Å, c = 7.5074(15) Å, β = 107.44(3)°, Z = 8, V = 1861.6(6) Å3; (C5H5N)2[(UO2)(IO3)3](IO3) (3), monoclinic, P21/n, a = 14.430(3) Å, b = 7.3459(15) Å, c = 19.811(4) Å, β = 106.70(3)°, Z = 4, V = 2011.3(7) Å3. 相似文献
3.
A series of tridentate ligands consisting of mixed aromatic and aliphatic amine derivatives of single amino acid chelates and phenylpiperazine have been developed, and their reactions with [NEt4]2[ReBr3(CO)3] have been investigated. The compounds [Re(CO)3{(NC5H4CH2)NCH3(C2H4)NHCH3}]Br (4), [Re(CO)3{(NC5H4CH2)NCH3(C2H4)NCH3(CH2)xCOOC2H5}]Br (x = 1, 5; x = 4, 6) [Re(CO)3{(NC5H4CH2)NH(C2H4)N(CH3)2}]Br (7), [Re(CO)3{(NC5H4CH2)N(CH 2COOC2H5)(C2H4)N(CH3)2}]Br (8) and [Re(CO)3(NC5H4CH2)(C2H4NH2)N(CH2)3-CH3Ophenpip]Br (9) (phenpip: phenylpiperazine, -C6H4-(CH2CH2)2N-) were prepared and characterized by elemental analysis, NMR, IR, HSMS and X-ray crystallography. All complexes exhibit fac-{Re(CO)3N3} coordination geometry in the cationic molecular unit. Crystal data for C13H17BrN3O3Re (4): orthorhombic, Pbca, a = 13.4510(8) Å, b = 10.5728(6) Å, c = 22.5378(13) Å, V = 3205.2(3) Å3, Z = 8; C17H23BrN3O5Re (5): orthorhombic, Pcca, a = 16.5907(7) Å,b = 14.8387(6) Å, c = 16.7075(7) Å, V = 4113.1(3) Å3, Z = 8; C13H25BrN3O7Re (7 · 4H2O): monoclinic, P21/n, a = 14.0698(17) Å, b = 9.6760(12) Å, c = 15.6099 (19) Å, β = 114.930(2)°, V = 1927.1(4) Å3, Z = 4; C17H23BrN3O5Re (8): monoclinic, P21/n, a = 7.5312(5) Å, b = 16.0366(10) Å, c = 16.8741(10) Å, β = 98.9990(10)°, V = 2012.9(2) Å3, Z = 4. 相似文献
4.
The binuclear mixed valence copper(I/II) compound [CuI(CN)3CuII(tn)2] (1) (tn = propane-1,3-diamine) and its acetonitrile adduct [CuI(CN)3CuII(tn)2] · 2MeCN (2) have been synthesized. Complex 1 crystallizes triclinic, space group , a = 8.117(2) Å, b = 8.389(2) Å, c = 11.920(2) Å, α = 108.728(3)°, β = 100.024(3)°, γ = 104.888(4)°, Z = 2, and compound 2 monoclinic, space group P21/m, a = 8.752(2) Å, b = 13.243(3) Å, c = 9.549(2) Å, β = 114.678(4)°, Z = 2. In both crystal structures, the binuclear [CuI(CN)3CuII(tn)2] complex with slightly different bonding geometries is formed. One of the three nitrogen atoms of a CuI(CN)3 moiety is coordinated to Cu(II) at the apex of a square-pyramid with two chelating ligands tn on its base. The shortest intramolecular CuII?CuII distance in 1 is 5.640(7) Å. The EPR behaviour of 1 has been investigated at room temperature and at 77 K. The magnetic properties were measured in the temperature range 1.8-300 K. 相似文献
5.
Adrienne Hammerschmidt 《Inorganica chimica acta》2005,358(14):4247-4252
Yellow thallium(I)-tetra(2-butanethiolato)-thallium(III) Tl[Tl(SC4H9)4] (1) crystallizes from a solution of thallium(I) carbonate and 2-butanethiol in DMF after heating under reflux in air. In the crystal structure (space group: , a = 8.941(3) Å, b = 11.078(4) Å, c = 13.458(4) Å, α = 70.81(3)°, β = 83.65(3)°, γ = 74.78(3)°, Z = 2) regular, TlS4 tetrahedra are bridged by thallium(I) atoms to an one-dimensional framework. The thallium(I) atoms are in fivefold distorted coordination and are linked to four further TlS4 tetrahedra. The resulting Tl4(S-Bu)8 units consist of two face-sharing Tl3S4 defect cubane entities.TlSC3H7 (2) was obtained from a solution of thallium(I) carbonate and 2-propanethiol in DMF after heating under reflux in air. The crystal structure (space group C2/c, a = 22.501(5) Å, b = 10.360(2) Å, c = 12.760(3) Å, β = 107.92(2)°, Z = 16) contains novel [Tl4(SPr)5]− units which are linked via thallium atoms to one-dimensional molecular chains running parallel to [0 0 1]. 相似文献
6.
Anthony Baker 《Inorganica chimica acta》2005,358(12):3513-3518
New ruthenium(II) complexes with cyanamide ligands, cis-[Ru(bpy)2(Ipcyd)2] (1) and [Ru(bpy)2(OHpcyd)2] (2) (bpy = 2,2′-bipyridine, Ipcyd = 4-iodophenylcyanamide anion, OHpcyd = 4-(3-hydroxy-3-methylbut-1-ynil)phenylcyanamide), have been prepared and characterized by UV-Vis, IR and 1H NMR spectroscopies as well as electrochemical technique (CV). The complex cis-[Ru(bpy)2(Ipcyd)2] (1) crystallized with empirical formula of C34H24I2N8Ru in a monoclinic crystal system and space group of P21/c with a = 11.769(7) Å, b = 24.188(12) Å, c = 11.623(2) Å, β = 91.63(3)°, V = 3308(3) Å3 and Z = 4. 相似文献
7.
Ring coupled bimetallic derivatives (μ-η5:5-C5H4C5H4)[Nb(CO)4]2 and [μ-CH2(η5-C5H4)2][M(CO)4]2, where M = Nb and Ta have been prepared. The molecular structures of the latter two compounds have been determined: , triclinic, , a = 8.028(2) Å, b = 11.414(1) Å, c = 12.711(2) Å, α = 75.020(8)°, β = 80.34(2)°, γ = 79.46(2)°, V = 1097.3(4) Å3, Z = 2, R(F) = 2.79%; [μ-CH2(η5-C5H4)2][Ta(CO)4]2, triclinic, , a = 7.815(3) Å, b = 10.275(4) Å, c = 13.135(4) Å, α = 104.25(3)°, β = 100.26(4)°, γ = 96.86(3)°, V = 991.2(6) Å3, Z = 2, R(F) = 3.00%. 相似文献
8.
The coordination chemistry of the oxadiazole-containing rigid bidentate ligands 2,5-bis(4-pyridyl)-1,3,4-oxadiazole (L1) and 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L2) with inorganic IIB metal salts have been investigated. Five new coordination polymers (1-5) were prepared by solution reactions and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. Cd(L1)2(CH3CN)2](ClO4)2 · (CH3CN)2 (1) crystallized in the monoclinic space group P21/c, a = 8.4028(5) Å, b = 21.3726(13) Å, c = 10.5617(7) Å, β = 95.1200(10)°, and Z = 2. In the solid state, it adopts an infinite two-dimensional polymeric structural motif with effective cross section of ca. 14.31 × 14.31 Å. Cd(L2)(H2O)(NO3)2 (2) crystallized in the monoclinic space group Ia, a = 7.1203(5) Å, b = 22.2475(15) Å, c = 20.2652(16) Å, β = 90.6080(10)°, and Z = 8. In the solid state, the two Cd(II) centers are connected to each other by L2 ligands and bridging nitrates into a two-dimensional network. [ZnCl2(L1)] (3) and [HgI2(L1)] · CH3CN (4) crystallized in the monoclinic crystal system (3: P21/c, a = 5.3702(3) Å, b = 20.4800(11) Å, c = 12.4093(7) Å, β = 94.7930(10)°, and Z = 4; 4: P2/n, a = 17.2733(11) Å, b = 5.2173(3) Å, c = 20.4069(13) Å, β = 102.8690(10)°, and Z = 4). In the solid state, Zn(II) and Hg(II) metal centers are connected to each other by L1 ligands into a zigzag chain motif. Compound 5 (HgBr2(L2) is different from 3 and 4, monoclinic, P2(1)/n, a = 5.470(4) Å, b = 16.271(13) Å, c = 16.486(12) Å, β = 93.197(15)°, and Z = 4) adopts a novel one-dimensional helical chain motif which resulted from the relative different coordinated orientation of the two N-donors on L2 ligand. 相似文献
9.
Yu Xie Hao-Han Wu Yong Cui Long Pan Rong Fan Yang-Chao Tian Liu-Si Sheng 《Inorganica chimica acta》2007,360(5):1669-1677
Three homochiral metal-organic coordination networks [Co2(l-Trp)2(Py)6] · Py · (ClO4)2 (1), [Ni(l-Trp)(Py)3] · H2O · ClO4 (2) and [Co2(l-Trp)(INT)2(H2O)2(ClO4)] (3), all containing natural amino acid l-HTrp (l-typtophan), were hydrothermally synthesized and structurally characterized. The compounds 1 and 2 crystallize in the orthorhombic space group C2221, with a = 10.731(2) Å, b = 19.709(4) Å, c = 27.365(6) Å and Z = 4 for 1 and a = 10.710(10) Å, b = 20.088(18) Å, c = 27.63(3) Å and Z = 8 for 2, respectively. The compound 3 has the monoclinic space group P21, with a = 8.1934(14) Å, b = 13.209(2) Å, c = 12.464(2) Å, β = 104.107(3)° and Z = 2. Both 1 and 2 consist of 1D helical chains. Compound 3 is composed of 2D networks, which further assemble into a 3D supramolecular structure via weak interlayer interactions. The optically pure amino acid l-HTrp plays an important role leading to homochiral structures reported here. 相似文献
10.
Ping Li 《Inorganica chimica acta》2011,378(1):323-325
A novel mixture cations templated indium phosphates, Li(C2N2H10)[In2(HPO4)3(PO4)], has been synthesized under mild hydrothermal conditions and characterized by elemental analysis and FT-IR spectrum. The crystal structure of title compound was determined by single crystal X-ray diffraction data. It belongs to monoclinic, space group P2/n with unit cell dimension a = 9.4692(13) Å, b = 9.1622(12) Å, c = 9.7063(14) Å, β = 117.5620(10)°. Its structure is characterized as a three-dimensional open-framework with 8-membered ring channels along a axis, where the inorganic lithium cation and organic double-protonated ethylenediamine cation are located and interact with the framework both electrostatically and via hydrogen bonds of N-H?O. 相似文献
11.
By varying the solvents and temperatures under solvothermal conditions, two new magnesium based coordination networks were synthesized using 2,5-thiophenedicarbxoylate as a linker. Mg3(TDC)3(DMF)3 [1; TDC = 2,5 thiophenedicarboxylate; space group P21/c, a = 17.747(4) Å, b = 9.805(2) Å, c = 21.359(4) Å, β = 103.13(3)°] is constructed by a combination of magnesium polyhedral trimers, which are connected by the TDC2− linkers to form a 3-D network. Coordinated DMF molecules are present within the channels. Mg(TDC)(H2O)2 [2; space group Pnma, a = 7.296(4) Å, b = 17.760(4) Å, c = 6.6631(3) Å] is formed by 1-D chains of magnesium octahedra connected by the TDC2− linker. Water molecules are coordinated at the axial positions of the magnesium octahedra. Compound 1 is formed using DMF as the synthesis solvent at 180 °C, while compound 2 is formed using ethanol as the synthesis solvent at 100 °C. Both compounds show enhanced photoluminescence intensity when excited at 397 nm compared to the free TDC ligand, suggesting a charge transfer between the ligand and the magnesium metal center. 相似文献
12.
A novel 2-D metal-organic coordination polymer [Ni0.5(apddica)(H2O)] · H2O 1 (Hapddica=2-(4-Amino-phenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid) has been hydrothermally synthesized and structurally characterized by element analyses, IR and XPS spectra, TG analyses and single crystal X-ray diffraction. Crystal data: C15H13N2Ni0.5O6, monoclinic, P2(1)/c, a=12.181(2) Å, b=7.9392(6) Å, c=14.835(3) Å, β=94.25(3) °, V=1430(75) Å3, Z=4. Compound 1 exhibits a novel 2-D double-layers network based on apddica and Ni center. It is noteworthy that new ligand Hapddica was first prepared with hydrothermal technique involving in situ ligand synthesis and used for constructing coordination polymers. There are unusual parallelogram tunnels along a-axis in which the dissociative water molecules filled in. The magnetic property of compound has been studied. 相似文献
13.
Yuri V. Mironov Konstantin A. Brylev Sung-Jin Kim Svetlana G. Kozlova Vladimir E. Fedorov 《Inorganica chimica acta》2011,370(1):363-368
A hexarhenium cyanohydroxo anionic cluster complex [Re6Se8(CN)4(OH)2]4− was synthesized for the first time starting from [Re6Se8(OH)6]4−, which was crystallized as a salt of the composition Cs2.75K1.25[Re6Se8(CN)4(OH)2]·H2O (1). The reaction of the complex with Cu2+ in an aqueous ammonia or methylamine solutions afforded [Cu(NH3)5]2[Re6Se8(CN)4(OH)2]·8H2O (2) or [{Cu(CH3NH2)4}2Re6Se8(CN)4(OH)2] (3), respectively. All of these three compounds were characterized by a single-crystal X-ray diffraction method. Compound 1 is crystallized in the tetragonal space group I4/m with eight formula units per cell (a = b = 17.4823(14) Å, c = 19.430(2) Å, V = 5938.3(10) Å3); compound 2 is crystallized in the monoclinic space group P21/n with two formula units per cell (a = 12.1845(13) Å, b = 8.6554(9) Å, c = 19.2568(19) Å, β = 91.081(2)°, V = 2030.5(4) Å3); compound 3 is crystallized in the orthorhombic space group Cmcm with four formula units per cell (a = 19.816(4) Å, b = 14.611(3) Å, c = 13.751(3) Å, V = 3981.2(13) Å3). The luminescence properties of 1 were studied in both aqueous solution and solid state. In addition, the electronic structure of [Re6Se8(CN)4(OH)2]4− was elucidated by DFT calculations. 相似文献
14.
Shu-Fei Huang Phalguni Misra Sasankasekhar Mohanta Ho-Hsiang Wei 《Inorganica chimica acta》2004,357(5):1627-1631
The syntheses, structures, and magnetic properties of two new μ-alkoxo-μ-pyrazolato heterobridged compounds, [Cu II2(L1-F)(μ-prz)] (1) and [Cu II2(L1-2OMe) (μ-prz)] · 0.5 CH3CN (2) (prz=pyrazolato; H2L1-F=1,3-bis(3-fluorosalicylideneamino)-2-propanol; H2L1-2OMe=1,3-bis(4,6-dimethoxy salicylideneamino)-2-propanol) have been reported. Compound 1 crystallizes in triclinic space group with a=8.6392(10) Å, b=10.6431(9) Å, c=11.6809(13) Å, α=85.972(8)°, β=71.492(9)°, and γ=72.221(9)°, while the unit cell parameters of 2 are as follows: space group: monoclinic C2/c, a=28.2948(5) Å, b=7.3033(2) Å, c=26.3933(5) Å, and β=96.243(1)°. The variable-temperature magnetic susceptibility measurements reveal that the metal centers in both the compounds are antiferromagnetically coupled with J=−200 cm−1 for 1 and J=−175 cm−1 for 2. The magnetic behaviors have been explained on the basis of two opposing factors, complementarity and countercomplementarity of magnetic orbitals. 相似文献
15.
The reaction of lacunary polyanion [α-H2P2W12O48]12−, zinc acetate, bpp (1,3-bis(4-pyridyl)propane) and BTC (1,3,5-benzenetricarboxylate) in an acidic aqueous solution led to the isolation of a new complex [Zn3(BTC)2(chtpy)(H2O)2] · 2H2O (1), which crystallizes in the space group C2/c with a = 28.988(6) Å, b = 11.254(2) Å, c = 17.347(4) Å, V = 4682.5(2) Å3, Z = 4. X-ray diffraction analysis reveals that there exists the generation of in situ ligand through simultaneous dehydrogenative coupling and hydroxylation of an N-heterocyclic ligand in complex 1. More interestingly, it exhibits an unprecedented (3,4)-connected (82.10)2(83)2(84.10.12)(85.10) topology which has been reported for the first time and shows self-penetrating nature at the same time. 相似文献
16.
A tetranuclear copper(II) complex [Cu4(NSI)4] · 2C2H5OH · 2H2O (NSI=hydroxethylsalicydeneimine) has been synthesized and characterized by X-ray diffraction analysis. The compound crystallizes in the monoclinic system, space group P2(1), a=9.494(3) Å, b=18.687(5) Å, c=13.149(4) Å, β=110.162(5)°, Z=2, R1=0.0482 and wR2=0.0978. The crystal structure contains a tetranuclear pseudo-cubane core based on an approximately cubane array of alternating copper and oxygen atoms. Each copper atom resides in a distorted square planar coordination environment with one nitrogen and three oxygen atoms from two NSI ligands. The tetranuclear units are linked in the crystal by O-H?O hydrogen bonds and weak Cu?O co-ordination bonds into one-dimensional structure. Variable temperature (5-300 K) magnetic measurements indicate the existence of ferromagnetic interactions among copper atoms. The IR and ESR spectra have also been investigated. 相似文献
17.
Crystal and molecular structure of silver magnesium mellitate, Ag2Mg2[C6(COO)6] · 8H2O, was synthesized hydrothermally and characterized by X-ray structure analysis. The complex crystallizes in the monoclinic system, space group P2/n, with unit cell dimensions of a=7.4347(2), b=9.9858(2), c=14.4248(3) Å, β=99.2429(5)°, V=1055.01(4) Å3, and Z=2. The structure was solved and refined to R=0.036 (Rw=0.045) for 1707 independent reflections [Io>2σ(Io)]. The Ag cations are coordinated by six carboxylic oxygen atoms of mellitate anions with composition of [C6(COO)6]6− on the (1 0 1) plane; each mellitate anion linking three neighboring Ag distorted trigonal prisms produces a two-dimensional layered structure parallel to (1 0 1). The Mg cations, which are coordinated by four water molecules and two carboxylic oxygen atoms, are intercalated between the two-dimensional layer stacks. The carboxylate group coordinated to Mg and Ag cations serve as a tridentate ligand in that structure. The number of water molecules incorporated into the mellitate compound is controlled mainly by ionic radii of metal cation in the structure. Furthermore, the ionic radii of metal cations in the mellitate compound play an essential role in arrangement of mellitate anions in the structure, whether as a one-dimensional infinite chain, a two-dimensional layered structure, or a three-dimensional framework structure. 相似文献
18.
A novel three-dimensional organically templated zincophosphite, [C6N2H18] · [Zn3(HPO3)4], was synthesized under milder hydrothermal conditions and structurally characterized by single-crystal X-ray diffraction, differential thermal-thermogravimetric analysis, powder X-ray diffraction, 31P MAS NMR spectrum, and IR spectroscopy. It crystallizes in the monoclinic system, space group C2/c with cell parameters: a = 8.7820(4) Å, b = 14.9417(7) Å, c = 15.4943(5) Å, β = 92.940(2)°, and Z = 4. The structure consists of a network of strictly alternating ZnO4 tetrahedra and pseudo-pyramid, forming 4-membered ring chains. The structure has a 4.8.16-net and 8- and 16-membered ring channels where completely protonated N,N,N′,N′-tetramethylenediamine cations are encapsulated. The structure is stabilized by template-to-framework hydrogen bonding. In phosphites system, this compound possesses extra-large-pores. 相似文献
19.
Chihiro Kachi-TerajimaHitoshi Miyasaka Tomohiko IshiiKen-ichi Sugiura Masahiro Yamashita 《Inorganica chimica acta》2002,332(1):210-215
The ligand substitution reaction of Ru2(O2CCH3)4Cl with 2-amino-4,6-dimethylpyrimidine (Hadmpym) under gentle refluxing conditions in methanol led to the formation of a bridging-ligand mono-substituted compound, [Ru2(O2CCH3)3(admpym)(Cl)(MeOH)] (1). Compound 1 crystallized in monoclinic space group P21/n (no. 14) with a=8.3074(8) Å, b=12.3722(8) Å, c=18.913(1) Å, β=95.559(3)°, V=1934.8(3) Å3, and Z=4. Temperature dependence of the magnetic susceptibility of 1 revealed it to be in a spin ground state S=3/2 arising from the electronic configuration of σ2π4δ2(δ*π*)3. Compound 1 undergoes three metal-centered redox reactions in electrochemistry: E1/2 (ox)=+0.72 V (Ia/Ic<1, ΔEp=0.17 V); E1/2 (1,red)=−0.65 V (Ia/Ic≈1, ΔEp=0.10 V); and E1/2 (2,red)=−1.80 V (Ia/Ic?1, ΔEp=0.16 V). Then, the redox species produced by electrolysis were characterized by spectroscopic studies. 相似文献
20.
G. Calvez C. Daiguebonne P.-E. Car V. Guillerm Y. Gérault F. Le Dret N. Mahé 《Inorganica chimica acta》2008,361(8):2349-2356
Two new hexanuclear complexes involving two of the lightest lanthanide ions have been synthesized and structurally described. Their chemical formula is [Ln6(μ6-O)(μ3-OH)8(NO3)6(H2O)14] · 2NO3 · 2H2O with Ln = Pr or Nd. The structure has been solved for the Pr3+-containing compound. It crystallizes in the monoclinic system, space group P21/n (no. 14) with a = 12.4163(2) Å, b = 10.51210(10) Å, c = 16.0389(2) Å, β = 95.7810(6)° and Z = 4. The chemical and thermal stabilities of both the compounds have been studied. These studies reveal that they can be used as molecular chemical precursors for further materials synthesis. To the best of our knowledge, this praseodymium-containing hexanuclear complex is the first ever reported. 相似文献