Crystal growth in aqueous hydrofluoric acid and (HF)x · pyridine solutions: syntheses and crystal structures of [Ni(H2O)6][MF6] (M = Ti, Zr, Hf) and Ni3(py)12F6 · 7H2O

The syntheses and structures of [Ni(H₂O)₆]²⁺[MF₆]²⁻ (M = Ti,Zr,Hf) and Ni₃(py)₁₂F₆·7H₂O are reported. The former three compounds are isostructural, crystallizing in the trigonal space group (No. 148) with Z = 3. The lattice parameters are a = 9.489(4), C = 9.764(7) Å, with V = 761(1) ų for Ti; a = 9.727(2), C = 10.051(3) Å, with V = 823.6(6) ų for Zr; and a = 9.724(3), C = 10.028(4)Å, with V = 821.2(8)ų for Hf. The structures consist of discrete [Ni(H₂O)₆]²⁺ and [MF₆]²⁻ octahedra joined by O---HF hydrogen bond Large single crystals were grown in an aqueous hydrofluoric acid solution. Ni₃(py)₁₂F₆·7H₂O crystallizes in the monoclinic space group I2/a (No. 15) with Z = 4. The lattice parameters are a = 16.117(4), B = 8.529(3), C = 46.220(7) Å, β = 92.46(2)°, and V = 6348(5) ų. The structure consists of discrete Ni(py)₄F₂ octahedra linked through H---O---HF and H---O---HO hydrogen bonding interactions. Single c were grown from a (HF)_x·pyridine/pyridine/water solution.     

Molecular structures of Fe(II) complexes with mono- and di-protonated ethylenediamine-N,N,N′,N′-tetraacetate (Hedta and H2edta), as determined by X-ray crystal analyses

The molecular structure of the title complexes [Fe(H₂O)₄][Fe(Hedta)(H₂O)]₂ · 4H₂O (I) and [Fe(H[₂edta)(H₂O)] · 2H₂O (II) have been determined by single-crystal X-ray analyses. The crystal data are as follows: I: monoclinic, P2₁/n, A = 11.794(2), B = 15.990(2), C = 9.206(2) Å, β = 90.33(1)°, V = 1736.1(5) ų, Z = 2 and R = 0.030; II: monoclinic, C2/c, A = 11.074(2), B = 9.856(2), C = 14.399(2) Å, β = 95.86(1)°, V = 1563.3(4) ų, Z = 4 and R = 0.025. I is found to be isomorphous with the Mn^II analog reported earlier and to contain a seven-coordinate and approximately pentagonal-bipyramidal (PB) [Fe^II(Hedta)(H₂O]⁻ unit in which Hedta acts as a hexadentate ligand. The [Fe^II(H₂edta)(H₂O)] unit in II has also a seven-coordinate PB structure with the two protonated equatorial glycine arms both remaining coordinated, and thus bears a structural resemblance to the seven-coordinate [Co^II(H₂edta)(H₂O)] reported previously.     

Synthesis, crystal structure and magnetic properties of the first structurally characterized 1,2-dithiocroconato-containing Cu(II) complex, [Cu(bpca)(H2O)]2[Cu(1,2-dtcr)2]·2H2O

The first crystal and molecular structure of a transition metal complex containing 1,2-dithiocroconate (1,2-dtcr, dianion of 1,2-dimercaptocylopent-1-ene-3,4,5-trione), [Cu(bpca)(H₂O)]₂[Cu(1,2-dtcr)₂]·2H₂O (where bpca is the bis(2-pyrdidylcarbonyl)amide anion), has been determined by single crystal X-ray diffraction methods. The compound crystallizesin the monoclinic syste, space group P2₁/c, with a = 11.661(3), b = 20.255(6), c = 8.265(3) Å, ß = 107.26(2)° and Z = 2. The structure is formally built of [Cu(1,2-dtcr)₂]²⁻ and [Cu(bpca)(H₂O)]⁺ ions and water of hydration. The copper atom of the anion is situated at a crystallographic inversion centre, bonded to four sulfur atoms in a planar, approximately square arrangement. In the cation the copper equatorial plane is formed by the three nitrogen atoms of the bpca ligand and a water oxygen atom. In addition there is a very weak axial bond to one of the sulfur atoms of a 1,2-dtcr ligand in the anion. Through these latter weak bonds each anion is connected to, and sandwiched between, two cations, resulting in neutral, trinuclear, centrosymmetric formula units. The triple-decker molecules are arranged in stacks along the crystallographic a-axis creating close contacts between the terminal copper atoms and bpca groups of the neighbouring molecules. This intermolecular interaction is, however, too weak to define the structure as a chain compound. The distance between adjacent copper atoms within the trinuclear unit is 4.189(1) Å, while the shortest intra-stack metal-metal separation between terminal copper atoms is 5.281(1) Å. Variable-temperature magnetic susceptibility measurements in the temperature r.2–140 K reveal that a Curie law is followed; with three non-interacting copper(II) ions in the formula unit.     

Structures and magnetism of rubidium and cesium salts of dimeric oxovanadium(IV) tartrate(4−) complexes

Complexes of type A₄[VO(tart)]₂·nH₂O, where A = Rb or Cs and tart =d,l-tartrate(4−) (n = 2) or d,d-tartrate(4−) (n = 2 for Rb and n = 3 for Cs), were prepared from an aqueous mixture of V₂O₅, AOH and H₄tart. These complexes were studied by single-crystal X-ray diffraction methods: Rb₄[VO(d,l-tart)]₂·2H₂O, space group P1 with a = 8.156(1),b = 8.246(1),c = 8.719(1)Å, = 66.09(1)°, β = 65.07(1)°, γ = 82.40(1)°,Z = 2, 1917 observed reflections, and final R_w = 0.035; Cs₄[VO(d,l-tart)]₂·2H₂O, space group P₂₁/c with a = 9.350(1),b = 13.728(2),c = 8.479(1)Å, β = 106.77(1)°,Z = 4, 2235 observed reflections, and final R_w = 0.054; Rb₄[VO(d,d-tart)]₂·2H₂O, space group P₄₁₂₂ with a = 8.072(1),c = 32.006(3)Å,Z = 8, 1014 observed reflections and final R_w = 0.038; Cs₄[VO(d,d-tart)]₂·3H₂O, space group P₁₂₂ with a = 8.184(1),c = 33.680(5)Å,Z = 8, 1310 observed reflections, and final R_w = 0.063. Bulk magnetic susceptibility data (1.5–300 K) for these compounds and A₄[VOl,l-tart)]₂·nH₂O (A = Rb, Cs) were obtained on polycrystalline samples. These data were analyzed in terms of a Van Vleck exchange coupled S = 1/2 model which was modified to include an interdimer exchange parameters Θ. Analysis of the low-temperature (1.5–20 K) susceptibility data gave 2J = +1.30 cm⁻¹ and Θ = −1.86 K for Rb₄[VO(d,l-tart)]₂·2H₂O, 2J = +1.16 cm⁻¹ and Θ = −1.69 K for Cs₄[VO(d,l-tart)]₂·2H₂O, 2J = +1.90 cm⁻¹ and Θ = −0.82 K for Rb₄[VO(d,d-tart)]₂·2H₂O, 2J = +2.04 cm⁻¹ and Θ = −0.80 K for Rb₄[VO(l,l-tart)]₂·2H₂O, 2J = +1.52 cm⁻¹ and Θ = −0.25 K for Cs₄[VO(d,d-tart)]₂·3H₂O, and 2J = +1.64 cm⁻¹ and Θ = −0.31 K for Cs₄[VO(l,l-tart)]₂·3H₂O. These results suggest the magnitudes of intradimer (ferromagnetic and interdimer (antiferromagnetic) exchange interactions are similar in these complexes, as observed for the analogous Na salts.     

Heterobimetallic aggregates of copper(I) with thiotungstates and thiomolybdates. Synthesis and characterization of polymeric (NEt4)3[Cu4(NCS)5WS4], (NEt4)2[(CuNCS)3WS4] and (NEt4)2[(CuNCS)4WS4], M = Mo, W

Reaction of (NEt₄)₂MS₄ (M = Mo, W) with CuCl and KSCN (or NH₄SCN) in acetone or acetonitrile affords a new set of mixed metal–sulfur compounds: infinite anionic chains Cu₄(NCS)₅MS_4³⁻ (1,2), (CuNCS)₃WS_4²⁻ (3) and two dimensional polymeric dianions (CuNCS)₄MS_4²⁻ (4,5). Crystal of 1 (M = W) and 3 are triclinic, space group P1(1:a = 10.356(2),b = 15.039(1),c = 17.356(2)Å, = 78.27(1)°, β = 88.89(2)° and γ = 88.60(1)°,Z = 2,R = 0.04 for 3915 independent data;3:a = 8.449(2),b = 14.622(4),c = 15.809(8)Å, = 61.84(3)°, β = 73.67(3)° and γ = 78.23(2)°,Z = 2,R = 0.029 for 6585 independent data). Crystals of 4 (M = W) and 5 (M = Mo) are monoclinic, space group P2₁/m,Z = 2 (4:a = 12.296(4),b = 14.794(4),c = 10.260(3)Åand β = 101.88(3)°,R = 0.034 for 4450 independent data;5:a = 12.306(2),b = 14.809(3),c = 10.257(2)Åand β = 101.99(3)°,R = 0.043 for 3078 independent data). The crystal structure determinations of 4 and 5 show that four edges of the tetrahedral MS_4²⁻ core are coordinated by copper atoms forming WS₄Cu₄ aggregates linked by eight-membered Cu(NCS)₂Cu rings. A two-dimensional network is thus formed in the diagonal (101) plane. The space between the anionic two-dimensional networks is filled with the NEt_4⁺ cations. Additional NCS groups lead to the [Cu₄(NCS)₅WS₄]³⁻ (1) trianion connected by NCS bridges forming pseudo-dimers. These latter are held together by weak CuS(NCS) interactions giving rise to infinite chains along a direction parallel to [100]. In contrast complex3 develops infinite chains from WS₄Cu₃ aggregates with the same Cu(NCS)₂Cu bridges as in 4 and 5. These chains are running along a direction parallel to [010]. The structural data of the different types of polymeric compounds containing MS_4²⁻ and CuNCS have been used to interpret vibrational spectroscopic data of the thiocyanate groups.     

Studies of the oxovanadium(IV)—oxalate system: syntheses and crystal structures of binuclear (Ph4P)2[(VO)2(H2O)2(C2O4)3]·4H2O and of the one-dimensional chain material, (Ph4P)[VOCl(C2O4)]

The hydrothermal reactions of (Ph₄P)[VO₂Cl₂] and H₂C₂O₄ at 150 and 125°C yield (Ph₄P)₂[V₂O₂(H₂O)₂(C₂O₄)₃]·4H₂O (1) and (Ph₄P)[VOCl(C₂O₄)] (2), respectively. The structure of the molecular anion of 1 consists of a binuclear unit of oxovanadium(IV) octahedra bridged by a bisbidentate oxalate group. The VO₆ coordination geometry at each vanadium site is defined by a terminal oxo group, an aquo ligand, and four oxygen donors — two from the bisbidentate bridging oxalate and two from the terminal bidentate oxalate. The structure of 2 consists of discrete Ph₄P⁺ cations occupying regions between [VOCl(C₂O₄)]⁻_∞ spiral chains. The structure of the one-dimensional anionic chain exhibits V(IV) octahedra bridged by bisbidentate oxalate groups. Crystal data: 1·4H₂O, monoclinic P2₁/n, A = 12.694(3), B = 12.531(3), C = 17.17(3) Å, β = 106.32(2)°, V = 2621.3(13) ų, Z = 2, D_calc = 1.501 g cm⁻³, structure solution and refinement converged at a conventional residual of 0.0518; 2, tetragonal P4₃, A = 12.145(2), C = 15.991(3) Å, V = 2358.7(12) ų, Z = 4, R = 0.0452.     

Application of the hydro(solvo)thermal technique to the synthesis of metal carbonyl chalcogenide clusters Part 3. Synthesis, structural characterization, and spectroscopic studies of the clusters [{M(CO)4}n(MS4)] (M = Mo, W; N=1, 2)

The methanothermal reactions of M(CO)₆ (M = Mo, W) with Na₂S₂ gave a series of homonuclear clusters [{M(CO)₄}_n(MS₄)]²⁻ (M=Mo, W; N=1, 2), i.e. (Ph₄P)₂[(CO)₄Mo(MoS₄)] (I), (Ph₄P)₂[(CO)₄W(WS₄)] (II), (Ph₄P)₂[(CO)₄Mo(MoS₄)Mo(CO)₄] (III) and (Ph₄P)₂[(CO)₄W(WS₄)W(CO)₄] (IV). The two dimers, I and II, as well as the two trimers, III and IV, are isostructural to each other, respectively. All compounds crystallize in the triclinic space group with Z=2. The cell dimensions are: a=12.393(8), b=19.303(9), c=11.909(6) Å, =102.39(5), β=111.54(5), γ=73.61(5)°, V=2522(3) ų at T=23 °C for I; a=12.390(3), b=19.314(4), c=11.866(2) Å, =102.66(2), β=111.49(1), γ=73.40(2)°, V=2511(1) ų at T=23 °C for II; a=11.416(3), b=22.524(4), c=10.815(4) Å, =91.03(2), β=100.57(3), γ=88.96(2)°, V=2733(1) ų at T=−100 °C for III, a=11.498(1), b=22.600(4), c=10.864(3) Å, =90.92(2), β=100.85(1), γ=88.58(1)°, V=2771(2) ų at T=23 °C for IV. The dimers are each formed by the coordination of the tetrathiometalate as a bidentate chelating ligand to an M(CO)₄ fragment while addition of another M(CO)₄ fragment to the dimers results in the trimers. All compounds contain both tetrahedral and octahedral metal centers with the formal 6+ and 0 oxidation states, respectively.     

Mixed anion lanthanide(III) crown ether complexes: crystal structures of [LaCl2(NO3)(12-crown-4)]2, [La(NO3)(OH2)4-(12-crown-4)]Cl2·CH3CN and [LaCl2(NO3)(18-crown-6)]

Reaction of LaCl₃·7H₂O containing small amounts of La(NO₃)₃·7H₂O as an impurity with 12-crown-4 or 18-crown-6 in 3:1 CH₃CN:CH₃OH resulted in the isolation of the mixed anion complexes [LaCl₂(NO₃)(12-crown-4)]₂, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN and [LaCl₂(NO₃)(18-crown-6)]. The nine-coordinate dimer, [LaCl₂(NO₃)(12-crown-4)]₂, has all of the anions in the inner coordination sphere and La³⁺ has a capped square antiprismatic geometry. It crystallizes in the orthorhombic space group Pbca with (at −150 °C) a = 12.938(6), B = 15.704(3), C = 13.962(2) Å, and D_calc = 2.08 g cm⁻³ for Z = 4. The second complex isolated from the same reaction, [La(NO₃)(OH₂)₄(12-crown-4)]Cl₂·CH₃CN, has the bidentate nitrate anion in the inner coordination sphere but the two chloride anions are in a hydrogen bonded outer sphere. This complex is ten-coordinate 4A,6B-expanded dodecahedral and crystallizes in the monoclinic space group P2₁ with (at 20 °C) A = 7.651(2), B = 11.704(7), C = 11.608(4) Å, β = 95.11(2)°, and D_calc = 1.80 g cm⁻³ for Z = 2. The 18-crown-6 complex, [LaCl₂(NO₃)(18-crown-6)], has all inner sphere anions and has ten-coordinate 4A,6B-expanded dodecahedral La³⁺ centers. It crystallizes in the orthorhombic space group Pbca with (at 20 °C) a = 14.122(7), B = 13.563(5), C = 19.311(9) Å, and D_calc = 1.89 g cm⁻³ for Z = 8.     

Synthesis and characterization of SrCu2(O2CR)3(bdmap)3 and Bi2(O2CCH3)4(bdmap)2(H2O) (R = CH3, CF3; bdmap = 1,3-bis(dimethylamino)-2-propanolato)

New mixed metal complexes SrCu₂(O₂CR)₃(bdmap)₃ (R = CF₃ (1a), CH₃ (1b)) and a new dinuclear bismuth complex Bi₂(O₂CCH₃)₄(bdmap)₂(H₂O) (2) have been synthesized. Their crystal structures have been determined by single-crystal X-ray diffraction analyses. Thermal decomposition behaviors of these complexes have been examined by TGA and X-ray powder diffraction analyses. While compound 1a decomposes to SrF₂ and CuO at about 380°C, compound 1b decomposes to the corresponding oxides above 800°C. Compound 2 decomposes cleanly to Bi₂O₃ at 330°C. The magnetism of 1a was examined by the measurement of susceptibility from 5–300 K. Theoretical fitting for the susceptibility data revealed that 1a is an antiferromagnetically coupled system with g = 2.012(7), −2J = 34.0(8) cm⁻¹. Crystal data for 1a: C₂₇H₅₁N₆O₉F₉Cu₂Sr/THF, monoclinic space group P2₁/m, A = 10.708(6), B = 15.20(1), C = 15.404(7) Å, β = 107.94(4)°, V = 2386(2) ų, Z = 2; for 1b: C₂₇H₆₀N₆O₉Cu₂Sr/THF, orthorhombic space group Pbcn, A = 19.164(9), B = 26.829(8), C = 17.240(9) Å, V = 8864(5) ų, Z = 8; for 2: C₂₂H₄₈O₁₁N₄Bi₂, monoclinic space group P2₁/c, A = 17.614(9), B = 10.741(3), C = 18.910(7) Å, β = 109.99(3)°, V = 3362(2) ų, Z = 4.     

The reaction of cytochrome c with [Fe(EDTA)(H2O)]

The interaction of horse ferricytochrome c with the reagents [Fe(EDTA)(H₂O)]⁻ and [Cr(CN)₆]³⁻ were studied at pH 7 and 25°C by ¹H-NMR spectroscopy. Two binding regions near to the heme crevice of cytochrome c were identified. Both regions bound both reagents but they exhibited different selectivities.

The relevance of this finding to the electron-transfer function of cytochrome c is discussed.     

Ferrocenyl-derived face-capping ligands: syntheses and molecular structures of [(FcTt)Cu]4 and [FcTt]2M (M = Fe, Co, Ni; FcTt = ferrocenyltris((methylthio)methyl)borate)

The synthesis and characterization of a ferrocenyl-derived tridentate ligand, ferrocenyltris((methylthio)methyl)borate (FcTtP⁻), and its representative metal complexes, [(FcTt)Cu]₄ and [FcTt]₂M (M = Fe, Co and Ni), are reported. The M = Fe complex exhibits spin-crossover behavior with a μ_eff = 1.19 μ_B at 25°C. The low-spin Co(II) derivative (1.88 μ_B) exhibits a characteristic axial electron paramagnetic resonance (EPR) spectrum, g_av = 2.13, A = 53 G and A_¦ = 43 G. The [FcTt]₂M complexes display reversible two-electron redox processes assigned to ligand-centered events about 200 mV negative of the ferrocene-ferrocenium couple. [(FcTt)Cu]₄ and [FcTt]₂Ni have been characterized by X-ray diffraction. X-ray data for [(FcTt)Cu]₄: monoclinic space group C2/c, with a = 24.3747(3) Å, b = 20.0857(2) Å, c = 17.2747(4) Å, β = 95.843(1)°, V = 8413.5(3) ų, and Z = 4; [FcTt]₂Ni: monoclinic space group C2/c, with a = 12.6220(3) Å, b = 11.6002(3) Å, c = 25.0125(7) Å, β = 94.067(1)°, V = 3653.1(2) ų, and Z = 4.     

On the lability of dimethylsulfoxide (DMSO) coordinated to the [Ru(II)-NO(+)] species: X-ray structures of mer-[RuCl(3)(DMSO)(2)(NO)] and mer-[RuCl(3)(CD(3)CN)(DMSO)(NO)

The syntheses of nitrosyl–dimethylsulfoxide–ruthenium(II) complexes with general formula mer-[RuCl₃(L)(DMSO)(NO)] (L=DMSO or CD₃CN) is reported. The mer-[RuCl₃(DMSO)₂(NO)] (1) complex was obtained from the reaction of [RuCl₃(NO)] with the sulfoxide ligand in acetone. The mer-[RuCl₃(CD₃CN)(DMSO)(NO)] (2) compound was obtained from mer-[RuCl₃(DMSO)₂(NO)] maintained in deuterated acetonitrile. These data suggest a slow kinetic reaction due the low lability of the DMSO ligand coordinated to the {Ru^II–NO⁺} species. The crystal and molecular structures of (1) and (2) have been determined from X-ray studies. Crystal data: for (1), monoclinic, P2₁/c, a=8.8340(2) Å, b=12.0230(3) Å, c=13.7064(4) Å, β=114.546(2)°, Z=4, R1=0.0429; for (2), monoclinic, P21/n, a=10.0180(7) Å, b=9.5070(7) Å, c=13.3340(9) Å, β=102.264(4)°, Z=4, R1=0.0472. The spectroscopic characterization of (1), in solid state (infrared spectrum) and in solution (nuclear magnetic resonance and cyclic voltammetry) is also described.     

The monofunctionalized 1,4,7-triazacyclononane derivatives 1,4,7-triazacyclononane-N-acetate (L) and N-(2-hydroxybenzyl-1,4,7-triazacyclononane (HL) and their complexes with vanadium(IV)/(V). Localized and delocalized electronic structures in compounds containing the mixed valent [OV---O---VO] core

The synthesis of the tetradentate pendant arm macrocycles 1,4,7-triazacyclononane-N-acetate (L¹) and N-(2-hydroxybenzyl)-1,4,7-triazacyclononane (HL²) and their coordination chemistry with vanadium(IV) and (V) are reported. The following mononuclear species have been prepared and characterized by UV-Vis, IR spectroscopy: [L¹V^IVO(NCS)] (1), [L¹VO₂]·H₂O (2), [L²VO(NCS)] (3), [L²VO(NCS)]Cl (4), and [L²VO₂] (5). In addition, the dinuclear, mixed valent complexes [L₂¹V₂O₃]Br (6), [L₂²V₂O₃](ClO₄)·0.5acetone (7), and the homovalent complex [L₂²V₂O₃](ClO₄)₂ (8) have been synthesized. Complexes 2, 3, 6 and 7 have been characterized by single crystal X-ray crystallography. Crystal data: 2, space group P2₁c,a=9.944(4),b=6.701(3),c=18.207(8)Å, β=102.88(3)°, V=1182.7 ų, Z=4, D_calc=1.51 g cm⁻³, R=0.049 based on 4760 reflections; 3, space group Pbca, A=11.003(6), b=14.295(7), C=20.21(1) Å, V=3178.8 ų, Z=8, D_calc=1,50 g cm⁻³, R=0.057 based on 1049 reflections; 6, space Pbcn, a=12.922(3), B=13.852(3), C=12.739(3) Å, V=2280.3 ų, Z=4, D_calc=1,75 g cm⁻³, R=0.047 based on 1172 reflections; 7, space group C2/c, A=23.553(9), B=13.497(5), C=20.951(8) Å, β=90.03(3)°, V=6660.2 ų, Z=8, D_calc=1.49 g cm⁻³, R=0.053 based on 3698 reflections. Complexes 6 and 7 are mixed valent V(IV)/(V) complexes containing the [OV---O---VO]³⁺ core. In the solid state 6 belongs to class III (delocalized) and 7 to class I (localized) according to the Robin and Day classification of mixed valent compounds. A rationale for these differing electronic structures is given.     

One-dimensional polymeric chlorocadmate(II) systems of N-methylpiperazinium and N,N′-dimethylpiperazinium compounds: synthesis, structural and thermal properties

The chlorocadmate(II) systems of (H₂me₂pipz)[Cd₂Cl₆(H₂O)₂] (1) and (H₂mepipz)₂[Cd₃Cl₁₀(H₂O)] (2) (L = me₂pipz = N,N′-dimethylpiperazine; L′ = mepipz = N-methylpiperazine) were prepared and their structural and thermal properties investigated. Compound 1 is monoclinic, space group P2₁/c, A = 7.664(1), B = 7.472(4), C = 15.347(1) Å, β = 99.468(7)°, Z = 2, R = 0.024. The crystal structure consists of organic cations and infinite one-dimensional chains of [CdCl₃(H₂O)]_n³⁻ anions. Each Cd atom is octahedrally surrounded by bridged and terminal chlorine atoms and by a water molecule, which is in trans position with respect to the terminal chlorine atom. Inter- and intrachain hydrogen bond interactions between the terminal chlorine atoms and the water molecules contribute to the crystal packing. Compound 2 is orthorhombic, space group Cmc2₁, A = 15.286(3), B = 13.354(3), C = 13.154(3) Å, R = 0.023. The crystal structure consists of organic dications and infinite chains of [Cd₂Cl₆(CdCl₄H₂O]_n⁴⁻ units running along the [001] axis. Each unit is formed of regularly alternate six-coordinated Cd atoms, one of them linking one pentacoordinated Cd atom which completes its coordination througha water molecule. A strong hydrogen bond interaction involving the organic dication and the inorganic chain contributes to the crystal packing. Differential hydrogen bond interaction involving the organic dication and the inorganic chain contributes to the crystal packing. Differential scanning calorimetry measurements did not show the presence of any structural phase transitions. The structures are compared with those of (H₂pipz)[Cd₂Cl₆(H₂O)₂] (3), (H₂mepipz)[Cd₂Cl₆(H₂O)₂]·H₂O (4) and (H₂mepipz)[Cd₂Cl₆] (5) (L = pipz = piperazine, L′ = mepipz = N-ethylpiperazine).     

The coordination chemistry of cationic main group clusters: syntheses and structures of [Fe3(Se2)2(CO)10] and [Fe4(Se2)3(CO)12]

The reactions of the polysulfur and selenium cationic clusters S₈²⁺ and Se₈²⁺ with various iron carbonyls were investigated. Several new chalcogen containing iron carbonyl cluster cations were isolated, depending on the nature of the counteranion. In the presence of SbF₆⁻ as a counterion, the cluster [Fe₃(E₂)₂(CO)₁₀] [SbF₆]₂·SO₂ (E = S, Se) could be isolated from the reaction of E₈²⁺ and excess iron carbonyl. The cluster is a picnic-basket shaped molecule of two iron centers linked by two Se₂ groups, with the whole fragment capped by an Fe(CO)₄ group. Crystallographic data for C₁₀O₁₂Fe₃Se₄Sb₂F₁₂S (I): space group monoclinic P2₁/c, A = 11.810(9), b = 24.023(6), c = 10.853(7) Å, β = 107.15(5)°, V = 2942(3) ų, Z = 4, R = 0.0426, R_w = 0.0503. When Sb₂F₁₁⁻ is present as the counterion, or Se₄[Sb₂F₁₁]₂ is used as the cluster cation source, a different cluster can be isolated, which has the formula [Fe₄(Se₂)₃(CO)₁₂] [SbF₆]₂·3SO₂. The dication contains two Fe₂Se₂ fragments bridged by an Se₂ group. Crystallographic data for C₁₂O₁₈Fe₄Se₆Sb₂F₁₂S₃ (III): space group triclinic , b = 18.400(9), C = 10.253(4) Å, = 93.10(4), β = 103.74(3), γ = 93.98(3)°, V = 1995(1) ų, Z = 2, R = 0.0328, R_w = 0.0325. The CO stretches in the IR spectrum all show a large shift to higher wavenumbers, suggesting almost no τ backbonding from the metals. This also correlates with the observed bond distances. All the compounds are extremely sensitive to air and water, and readily lose SO₂ when removed from the solvent. Thus all the crystals were handled at −100°C. The clusters seem to be either insoluble or unstable in all solvents investigated.     

Crystal and molecular structure of μ-oxo-bis((5,10,15,20)tetrakispentafluorophenyl)porphinatoiron(III)

In this paper, we report the crystal and molecular structure of μ-oxo-bis(5,10,15,20)tetrakispentafluorophenyl)porphinatoiron(III) [(TPP(F₅)Fe)₂O]. The crystals belong to the tetragonal system, space group I4₁/a, with a =b = 26.362(7),c = 30.886(8)Å,V = 21465ų,Z = 8 and D_calc = 1.496. Discrepancy indices are R₁ = 0.084 and R₂ = 0.104 for 3320 reflections having I3σ(I). The FeN_p average distance, 2.088(11)Å, is at the long end of the range of high-spin ferric porphyrin while the FeO distances (1.775(1)Å) are similar to those of the non-halogenated analog (TPPFe)₂O. The FeOFe angle of 178.4(5)° shows an essentially linear oxo bridge. The 0.673(2)Ådisplacement of the iron atom from the porphyrin mean plane is unusually large. The facing porphyrin rings are twisted 47° with respect of each other giving the molecule nearly exact D_4d symmetry.     

A dicopper complex of N,N′-bis[2,2-dimethyl-4-(2-hydroxyphenyl)-3-aza-3-buten] oxamide. Structure and magnetic behaviour of the mono hydrated form

The ligand N, N′-bis[2,2-dimethyl-4-(2-hydroxyphenyl)-3-aza-3-buten] oxamide with two identical coordination sites reacts with copper ions in its tetradeprotonated form to yield the dinuclear complex [Cu₂(C₂₄H₂₆N₄O₄)]·H₂O. The structure of this compound has been determined by the X-ray diffraction method. The crystals are orthorhombic with a = 11.744(1), B = 16.369(2), C = 26.340(3) Å, V = 5064(1) ų, Z = 8, space group Pbca. The oxamide is in a trans conformation with two different environments for the copper centres, a (4 + 1) coordination mode for the first one and a square planar environment for the other one. The water molecule is not directly bound to a copper centre, but involved in hydrogen bonding with the two oxygen atoms of an N₂O₂ coordination site. Indeed, extra coordination comes from a phenolic oxygen atom belonging to an adjacent dinuclear unit. Static susceptibility measurements point to a strong intrapair antiferromagnetic exchange interaction of 2J = −520(±4) cm⁻¹ and possibly an interpair ferromagnetic exchange interaction of 10(±5) cm⁻¹.     

Thermal and photochemical substitution reactions of CpRe(PPh3)2H2 and CpRe(PPh3)H4. Catalytic insertion of ethylene into the C-H bond of benzene

The thermal and photochemical reactions of CpRe(PPh₃)₂H₄ and CpRe(PPh₃)H₄ (Cp = η⁵-C₅H₅) with PMe₃, P(p-tolyl)₃, PMe₂Ph, DMPE, DPPE, DPPM, CO, 2,6-xylylisocyanide and ethylene have been examined. While CpRe(PPh₃)₂H₂ is thermally inert, it will undergo photochemical substitution of one or two PPh₃ ligands. With ethylene, substitution is followed by insertion of the olefin into the C-H bond of benzene, giving ethylbenzene. CpRe(PPh₃)H₄ undergoes thermal loss of PPh₃, which leads to substituted products of the type CpRe(L) H₄. Photochemically, reductive elimination of dihydrogen occurs preferentially. The complex trans-CpRe(DMPE)H₂ was structurally characterized, crystallizing in the monoclinic space group P2₁/n (No. 14) with a = 6.249(6), b = 16.671(8), c = 13.867(7) Å, β = 92.11(6)°, V = 1443.7(2.9) Å and Z = 4. The complex trans-CpRe(PMe₂Ph)₂H₂ was structurally characterized, crystallizing in the monoclinic space group P2₁/n (No. 14) with a = 7.467(3), b = 23.874(14), c = 11.798(6) Å, β = 100.16(4)°, V = 2070.2(3.4) ų and Z = 4.     

Molecular structures and some properties of tris(2-aminoethyl) amine cobalt(III) complexes with thiocarboxylato-O,S such as 3-mercaptopropionato, 2-mercaptoacetato and their derivatives

Cobalt(III) complexes with a thiolate or thioether ligand, t-[Co(mp)(tren)]⁺ (2), t-[Co(mtp)(tren)]²⁺ (1Me) and t-[Co(mta)(tren)]²⁺ (2Me), (mp = 3-mercaptopropionate, MA = 3-(methylthio)propionate and MTA = 2-(methylthio)acetate) have been prepared in aqueous solutions. The crystal structures of 1, 2, 1Me and 2Me were determined by X-ray diffraction methods. The crystal data are as follows, t-[Co(mp)(tren)]ClO₄ (1CIO₄): monoclinic, P2₁/n, A = 10.877(8), B = 11.570(4), c = 12.173(7) Å, β = 92.20(5)°, V = 1531(1) ų, Z = 4 and R = 0.060; t-[Co(ma)(tren)]Cl·3H₂O (2Cl·3H₂O): monoclinic, P2₁/n, a = 7.7688(8), B = 27.128(2), C = 7.858(1) Å, β = 100.63(1)°, V = 1627.7(3) ų, Z = 4 and R = 0.066; (+)₄₆₅^CD-t-[Co(mtp)(tren)](ClO₄)₂ ((+)₄₆₅^CD-1Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, A = 10.6610(7), B = 11.746(1), C = 15.555(1) Å, V = 1947.9(3) ų, Z = 4 and R = 0.068; (+)₄₆₅^CD-t-[Co(mta)(tren)](ClO₄)₂ ((+)₄₆₅^CD-2Me(ClO₄)₂): orthorhombic, P2₁2₁2₁, a = 10.564(1), B = 11.375(1), C = 15.434(2) Å, V = 1854.7(4) ų, Z = 4 and R = 0.047. All central Co(III) atoms have approximately octahedral geometry, coordinated by four N, one O, and one S atoms. All of the complexes are only isomer, of which the sulfur atom in the didentate-O,S ligands are located at the trans position to the tertiary amine nitrogen atom of tren. 1 and 1Me contain six-membered chelate ring, and 2 and 2Me do five-membered chelate ring in the didentate ligand. The chirality of the asymmetric sulfur donor atom in (+)₄₆₅^CD-1Me is the S configuration and that in (+)₄₆₅^CD-2Me is the R one. The ¹H NMR, ¹³C NMR and electronic absorption spectral behaviors and electrochemical properties of the present complexes are discussed in relation to their stereochemistries.     

Peroxo aminopolycarboxylato vanadate(V) of an unusually low toxicity: synthesis and structure of the very stable K2[VO(O2)(C6H6NO6)]·2H2O

The synthesis and structure of a monoperoxo vanadate(V) of the formula K₂[VO(O₂)NTA]·2H[₂O, where NTA = C₆H₆NO₆ ³⁻, the nitrilotriacetate, is described. This stable compound crystallizes in the orthorhombic system (space group Pna2₁): a = 7.621(1), B = 13.002(3), C = 13.155(1) Å. A tetradentate NTA encloses vanadium in a distorted pentagonal bipyramid with an apical V = O group. Cis to it, in the pentagonal plane, a non-symmetrically coordinated peroxo group is located with an (O---O) bond length of 1.438(4) Å. Complex IR spectra display rich absorption due to coordinated NTA, in addition to the characteristic V = O and (O---O) stretching vibrations. Aqueous solutions of the complex show a (peroxo → V(V)) charge transfer band at γ_max = 425 nm.